From 0ea5fc66924303d1bf73ba283a383e2aadee02f2 Mon Sep 17 00:00:00 2001 From: neodarz Date: Sat, 11 Aug 2018 20:21:34 +0200 Subject: Initial commit --- docs/doxygen/nel/a04223.html | 18729 +++++++++++++++++++++++++++++++++++++++++ 1 file changed, 18729 insertions(+) create mode 100644 docs/doxygen/nel/a04223.html (limited to 'docs/doxygen/nel/a04223.html') diff --git a/docs/doxygen/nel/a04223.html b/docs/doxygen/nel/a04223.html new file mode 100644 index 00000000..02fa1ef5 --- /dev/null +++ b/docs/doxygen/nel/a04223.html @@ -0,0 +1,18729 @@ + + +NeL: driver_opengl_extension_def.h File Reference + + + +
+

driver_opengl_extension_def.h File Reference


Detailed Description

+External OpenGL extension definition.

+

Id
driver_opengl_extension_def.h,v 1.20 2004/02/06 18:07:25 vizerie Exp
+ +

+Definition in file driver_opengl_extension_def.h. +

+#include "nel/misc/types_nl.h"
+#include <GL/gl.h>
+#include <GL/glext.h>
+ +

+Go to the source code of this file. + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Defines

#define GL_2X_BIT_ATI   0x00000001
#define GL_4X_BIT_ATI   0x00000002
#define GL_8X_BIT_ATI   0x00000004
#define GL_ADD_ATI   0x8963
#define GL_ADD_SIGNED_ARB   0x8574
#define GL_ALL_COMPLETED_NV   0x84F2
#define GL_ARB_fragment_program   1
#define GL_ARB_texture_env_combine   1
#define GL_ARRAY_OBJECT_BUFFER_ATI   0x8766
#define GL_ARRAY_OBJECT_OFFSET_ATI   0x8767
#define GL_ATI_envmap_bumpmap   1
#define GL_ATI_fragment_shader   1
#define GL_ATI_map_object_buffer   1
#define GL_ATI_vertex_array_object   1
#define GL_ATTRIB_ARRAY_POINTER_NV   0x8645
#define GL_ATTRIB_ARRAY_SIZE_NV   0x8623
#define GL_ATTRIB_ARRAY_STRIDE_NV   0x8624
#define GL_ATTRIB_ARRAY_TYPE_NV   0x8625
#define GL_BIAS_BIT_ATI   0x00000008
#define GL_BLUE_BIT_ATI   0x00000004
#define GL_BUMP_ENVMAP_ATI   0x877B
#define GL_BUMP_NUM_TEX_UNITS_ATI   0x8777
#define GL_BUMP_ROT_MATRIX_ATI   0x8775
#define GL_BUMP_ROT_MATRIX_SIZE_ATI   0x8776
#define GL_BUMP_TARGET_ATI   0x877C
#define GL_BUMP_TEX_UNITS_ATI   0x8778
#define GL_CND0_ATI   0x896B
#define GL_CND_ATI   0x896A
#define GL_COLOR_ALPHA_PAIRING_ATI   0x8975
#define GL_COMBINE_ALPHA_ARB   0x8572
#define GL_COMBINE_ARB   0x8570
#define GL_COMBINE_RGB_ARB   0x8571
#define GL_COMP_BIT_ATI   0x00000002
#define GL_CON_0_ATI   0x8941
#define GL_CON_10_ATI   0x894B
#define GL_CON_11_ATI   0x894C
#define GL_CON_12_ATI   0x894D
#define GL_CON_13_ATI   0x894E
#define GL_CON_14_ATI   0x894F
#define GL_CON_15_ATI   0x8950
#define GL_CON_16_ATI   0x8951
#define GL_CON_17_ATI   0x8952
#define GL_CON_18_ATI   0x8953
#define GL_CON_19_ATI   0x8954
#define GL_CON_1_ATI   0x8942
#define GL_CON_20_ATI   0x8955
#define GL_CON_21_ATI   0x8956
#define GL_CON_22_ATI   0x8957
#define GL_CON_23_ATI   0x8958
#define GL_CON_24_ATI   0x8959
#define GL_CON_25_ATI   0x895A
#define GL_CON_26_ATI   0x895B
#define GL_CON_27_ATI   0x895C
#define GL_CON_28_ATI   0x895D
#define GL_CON_29_ATI   0x895E
#define GL_CON_2_ATI   0x8943
#define GL_CON_30_ATI   0x895F
#define GL_CON_31_ATI   0x8960
#define GL_CON_3_ATI   0x8944
#define GL_CON_4_ATI   0x8945
#define GL_CON_5_ATI   0x8946
#define GL_CON_6_ATI   0x8947
#define GL_CON_7_ATI   0x8948
#define GL_CON_8_ATI   0x8949
#define GL_CON_9_ATI   0x894A
#define GL_CONST_EYE_NV   0x86E5
#define GL_CONSTANT_ARB   0x8576
#define GL_CULL_FRAGMENT_NV   0x86E7
#define GL_CULL_MODES_NV   0x86E0
#define GL_CURRENT_ATTRIB_NV   0x8626
#define GL_CURRENT_MATRIX_ARB   0x8641
#define GL_CURRENT_MATRIX_NV   0x8641
#define GL_CURRENT_MATRIX_STACK_DEPTH_ARB   0x8640
#define GL_CURRENT_MATRIX_STACK_DEPTH_NV   0x8640
#define GL_CURRENT_VERTEX_EXT   0x87e2
#define GL_DEPENDENT_AR_TEXTURE_2D_NV   0x86E9
#define GL_DEPENDENT_GB_TEXTURE_2D_NV   0x86EA
#define GL_DISCARD_ATI   0x8763
#define GL_DOT2_ADD_ATI   0x896C
#define GL_DOT3_ATI   0x8966
#define GL_DOT4_ATI   0x8967
#define GL_DOT_PRODUCT_CONST_EYE_REFLECT_CUBE_MAP_NV   0x86F3
#define GL_DOT_PRODUCT_DEPTH_REPLACE_NV   0x86ED
#define GL_DOT_PRODUCT_DIFFUSE_CUBE_MAP_NV   0x86F1
#define GL_DOT_PRODUCT_NV   0x86EC
#define GL_DOT_PRODUCT_REFLECT_CUBE_MAP_NV   0x86F2
#define GL_DOT_PRODUCT_TEXTURE_2D_NV   0x86EE
#define GL_DOT_PRODUCT_TEXTURE_3D_NV   0x86EF
#define GL_DOT_PRODUCT_TEXTURE_CUBE_MAP_NV   0x86F0
#define GL_DOT_PRODUCT_TEXTURE_RECTANGLE_NV   0x864E
#define GL_DS_BIAS_NV   0x8716
#define GL_DS_SCALE_NV   0x8710
#define GL_DSDT8_MAG8_INTENSITY8_NV   0x870B
#define GL_DSDT8_MAG8_NV   0x870A
#define GL_DSDT8_NV   0x8709
#define GL_DSDT_MAG_INTENSITY_NV   0x86DC
#define GL_DSDT_MAG_NV   0x86F6
#define GL_DSDT_MAG_VIB_NV   0x86F7
#define GL_DSDT_NV   0x86F5
#define GL_DT_BIAS_NV   0x8717
#define GL_DT_SCALE_NV   0x8711
#define GL_DU8DV8_ATI   0x877A
#define GL_DUDV_ATI   0x8779
#define GL_DYNAMIC_ATI   0x8761
#define GL_EIGHTH_BIT_ATI   0x00000020
#define GL_FENCE_CONDITION_NV   0x84F4
#define GL_FENCE_STATUS_NV   0x84F3
#define GL_FRAGMENT_PROGRAM_ARB   0x8804
#define GL_FRAGMENT_SHADER_ATI   0x8920
#define GL_FULL_RANGE_EXT   0x87e1
#define GL_GREEN_BIT_ATI   0x00000002
#define GL_HALF_BIT_ATI   0x00000008
#define GL_HI_BIAS_NV   0x8714
#define GL_HI_SCALE_NV   0x870E
#define GL_HILO16_NV   0x86F8
#define GL_HILO_NV   0x86F4
#define GL_IDENTITY_NV   0x862A
#define GL_INTERPOLATE_ARB   0x8575
#define GL_INVARIANT_DATATYPE_EXT   0x87eb
#define GL_INVARIANT_EXT   0x87c2
#define GL_INVARIANT_VALUE_EXT   0x87ea
#define GL_INVERSE_NV   0x862B
#define GL_INVERSE_TRANSPOSE_NV   0x862D
#define GL_LERP_ATI   0x8969
#define GL_LO_BIAS_NV   0x8715
#define GL_LO_SCALE_NV   0x870F
#define GL_LOCAL_CONSTANT_DATATYPE_EXT   0x87ed
#define GL_LOCAL_CONSTANT_EXT   0x87c3
#define GL_LOCAL_CONSTANT_VALUE_EXT   0x87ec
#define GL_LOCAL_EXT   0x87c4
#define GL_MAD_ATI   0x8968
#define GL_MAGNITUDE_BIAS_NV   0x8718
#define GL_MAGNITUDE_SCALE_NV   0x8712
#define GL_MAP1_VERTEX_ATTRIB0_4_NV   0x8660
#define GL_MAP1_VERTEX_ATTRIB10_4_NV   0x866A
#define GL_MAP1_VERTEX_ATTRIB11_4_NV   0x866B
#define GL_MAP1_VERTEX_ATTRIB12_4_NV   0x866C
#define GL_MAP1_VERTEX_ATTRIB13_4_NV   0x866D
#define GL_MAP1_VERTEX_ATTRIB14_4_NV   0x866E
#define GL_MAP1_VERTEX_ATTRIB15_4_NV   0x866F
#define GL_MAP1_VERTEX_ATTRIB1_4_NV   0x8661
#define GL_MAP1_VERTEX_ATTRIB2_4_NV   0x8662
#define GL_MAP1_VERTEX_ATTRIB3_4_NV   0x8663
#define GL_MAP1_VERTEX_ATTRIB4_4_NV   0x8664
#define GL_MAP1_VERTEX_ATTRIB5_4_NV   0x8665
#define GL_MAP1_VERTEX_ATTRIB6_4_NV   0x8666
#define GL_MAP1_VERTEX_ATTRIB7_4_NV   0x8667
#define GL_MAP1_VERTEX_ATTRIB8_4_NV   0x8668
#define GL_MAP1_VERTEX_ATTRIB9_4_NV   0x8669
#define GL_MAP2_VERTEX_ATTRIB0_4_NV   0x8670
#define GL_MAP2_VERTEX_ATTRIB10_4_NV   0x867A
#define GL_MAP2_VERTEX_ATTRIB11_4_NV   0x867B
#define GL_MAP2_VERTEX_ATTRIB12_4_NV   0x867C
#define GL_MAP2_VERTEX_ATTRIB13_4_NV   0x867D
#define GL_MAP2_VERTEX_ATTRIB14_4_NV   0x867E
#define GL_MAP2_VERTEX_ATTRIB15_4_NV   0x867F
#define GL_MAP2_VERTEX_ATTRIB1_4_NV   0x8671
#define GL_MAP2_VERTEX_ATTRIB2_4_NV   0x8672
#define GL_MAP2_VERTEX_ATTRIB3_4_NV   0x8673
#define GL_MAP2_VERTEX_ATTRIB4_4_NV   0x8674
#define GL_MAP2_VERTEX_ATTRIB5_4_NV   0x8675
#define GL_MAP2_VERTEX_ATTRIB6_4_NV   0x8676
#define GL_MAP2_VERTEX_ATTRIB7_4_NV   0x8677
#define GL_MAP2_VERTEX_ATTRIB8_4_NV   0x8678
#define GL_MAP2_VERTEX_ATTRIB9_4_NV   0x8679
#define GL_MATRIX0_ARB   0x88C0
#define GL_MATRIX0_NV   0x8630
#define GL_MATRIX10_ARB   0x88CA
#define GL_MATRIX11_ARB   0x88CB
#define GL_MATRIX12_ARB   0x88CC
#define GL_MATRIX13_ARB   0x88CD
#define GL_MATRIX14_ARB   0x88CE
#define GL_MATRIX15_ARB   0x88CF
#define GL_MATRIX16_ARB   0x88D0
#define GL_MATRIX17_ARB   0x88D1
#define GL_MATRIX18_ARB   0x88D2
#define GL_MATRIX19_ARB   0x88D3
#define GL_MATRIX1_ARB   0x88C1
#define GL_MATRIX1_NV   0x8631
#define GL_MATRIX20_ARB   0x88D4
#define GL_MATRIX21_ARB   0x88D5
#define GL_MATRIX22_ARB   0x88D6
#define GL_MATRIX23_ARB   0x88D7
#define GL_MATRIX24_ARB   0x88D8
#define GL_MATRIX25_ARB   0x88D9
#define GL_MATRIX26_ARB   0x88DA
#define GL_MATRIX27_ARB   0x88DB
#define GL_MATRIX28_ARB   0x88DC
#define GL_MATRIX29_ARB   0x88DD
#define GL_MATRIX2_ARB   0x88C2
#define GL_MATRIX2_NV   0x8632
#define GL_MATRIX30_ARB   0x88DE
#define GL_MATRIX31_ARB   0x88DF
#define GL_MATRIX3_ARB   0x88C3
#define GL_MATRIX3_NV   0x8633
#define GL_MATRIX4_ARB   0x88C4
#define GL_MATRIX4_NV   0x8634
#define GL_MATRIX5_ARB   0x88C5
#define GL_MATRIX5_NV   0x8635
#define GL_MATRIX6_ARB   0x88C6
#define GL_MATRIX6_NV   0x8636
#define GL_MATRIX7_ARB   0x88C7
#define GL_MATRIX7_NV   0x8637
#define GL_MATRIX8_ARB   0x88C8
#define GL_MATRIX9_ARB   0x88C9
#define GL_MATRIX_EXT   0x87c0
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_INSTRUCTIONS_EXT   0x87ca
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_INVARIANTS_EXT   0x87cd
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_LOCAL_CONSTANTS_EXT   0x87cc
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_LOCALS_EXT   0x87ce
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_VARIANTS_EXT   0x87cb
#define GL_MAX_PROGRAM_ALU_INSTRUCTIONS_ARB   0x880B
#define GL_MAX_PROGRAM_ATTRIBS_ARB   0x88AD
#define GL_MAX_PROGRAM_ENV_PARAMETERS_ARB   0x88B5
#define GL_MAX_PROGRAM_INSTRUCTIONS_ARB   0x88A1
#define GL_MAX_PROGRAM_LOCAL_PARAMETERS_ARB   0x88B4
#define GL_MAX_PROGRAM_MATRICES_ARB   0x862F
#define GL_MAX_PROGRAM_MATRIX_STACK_DEPTH_ARB   0x862E
#define GL_MAX_PROGRAM_NATIVE_ALU_INSTRUCTIONS_ARB   0x880E
#define GL_MAX_PROGRAM_NATIVE_ATTRIBS_ARB   0x88AF
#define GL_MAX_PROGRAM_NATIVE_INSTRUCTIONS_ARB   0x88A3
#define GL_MAX_PROGRAM_NATIVE_PARAMETERS_ARB   0x88AB
#define GL_MAX_PROGRAM_NATIVE_TEMPORARIES_ARB   0x88A7
#define GL_MAX_PROGRAM_NATIVE_TEX_INDIRECTIONS_ARB   0x8810
#define GL_MAX_PROGRAM_NATIVE_TEX_INSTRUCTIONS_ARB   0x880F
#define GL_MAX_PROGRAM_PARAMETERS_ARB   0x88A9
#define GL_MAX_PROGRAM_TEMPORARIES_ARB   0x88A5
#define GL_MAX_PROGRAM_TEX_INDIRECTIONS_ARB   0x880D
#define GL_MAX_PROGRAM_TEX_INSTRUCTIONS_ARB   0x880C
#define GL_MAX_TEXTURE_COORDS_ARB   0x8871
#define GL_MAX_TEXTURE_IMAGE_UNITS_ARB   0x8872
#define GL_MAX_TRACK_MATRICES_NV   0x862F
#define GL_MAX_TRACK_MATRIX_STACK_DEPTH_NV   0x862E
#define GL_MAX_VERTEX_SHADER_INSTRUCTIONS_EXT   0x87c5
#define GL_MAX_VERTEX_SHADER_INVARIANTS_EXT   0x87c7
#define GL_MAX_VERTEX_SHADER_LOCAL_CONSTANTS_EXT   0x87c8
#define GL_MAX_VERTEX_SHADER_LOCALS_EXT   0x87c9
#define GL_MAX_VERTEX_SHADER_VARIANTS_EXT   0x87c6
#define GL_MODELVIEW_PROJECTION_NV   0x8629
#define GL_MODULATE_ADD_ATIX   0x8744
#define GL_MODULATE_SIGNED_ADD_ATIX   0x8745
#define GL_MODULATE_SUBTRACT_ATIX   0x8746
#define GL_MOV_ATI   0x8961
#define GL_MUL_ATI   0x8964
#define GL_MVP_MATRIX_EXT   0x87e3
#define GL_NEGATE_BIT_ATI   0x00000004
#define GL_NEGATIVE_W_EXT   0x87dc
#define GL_NEGATIVE_X_EXT   0x87d9
#define GL_NEGATIVE_Y_EXT   0x87da
#define GL_NEGATIVE_Z_EXT   0x87db
#define GL_NEGEXTVE_ONE_EXT   0x87df
#define GL_NORMALIZED_RANGE_EXT   0x87e0
#define GL_NUM_FRAGMENT_CONSTANTS_ATI   0x896F
#define GL_NUM_FRAGMENT_REGISTERS_ATI   0x896E
#define GL_NUM_INPUT_INTERPOLATOR_COMPONENTS_ATI   0x8973
#define GL_NUM_INSTRUCTIONS_PER_PASS_ATI   0x8971
#define GL_NUM_INSTRUCTIONS_TOTAL_ATI   0x8972
#define GL_NUM_LOOPBACK_COMPONENTS_ATI   0x8974
#define GL_NUM_PASSES_ATI   0x8970
#define GL_NV_fence   1
#define GL_NV_vertex_array_range2   1
#define GL_NV_vertex_program   1
#define GL_OBJECT_BUFFER_SIZE_ATI   0x8764
#define GL_OBJECT_BUFFER_USAGE_ATI   0x8765
#define GL_OFFSET_TEXTURE_2D_BIAS_NV   GL_OFFSET_TEXTURE_BIAS_NV
#define GL_OFFSET_TEXTURE_2D_MATRIX_NV   GL_OFFSET_TEXTURE_MATRIX_NV
#define GL_OFFSET_TEXTURE_2D_NV   0x86E8
#define GL_OFFSET_TEXTURE_2D_SCALE_NV   GL_OFFSET_TEXTURE_SCALE_NV
#define GL_OFFSET_TEXTURE_BIAS_NV   0x86E3
#define GL_OFFSET_TEXTURE_MATRIX_NV   0x86E1
#define GL_OFFSET_TEXTURE_RECTANGLE_NV   0x864C
#define GL_OFFSET_TEXTURE_RECTANGLE_SCALE_NV   0x864D
#define GL_OFFSET_TEXTURE_SCALE_NV   0x86E2
#define GL_ONE_EXT   0x87de
#define GL_OP_ADD_EXT   0x8787
#define GL_OP_CLAMP_EXT   0x878e
#define GL_OP_CROSS_PRODUCT_EXT   0x8797
#define GL_OP_DOT3_EXT   0x8784
#define GL_OP_DOT4_EXT   0x8785
#define GL_OP_EXP_BASE_2_EXT   0x8791
#define GL_OP_FLOOR_EXT   0x878f
#define GL_OP_FRAC_EXT   0x8789
#define GL_OP_INDEX_EXT   0x8782
#define GL_OP_LOG_BASE_2_EXT   0x8792
#define GL_OP_MADD_EXT   0x8788
#define GL_OP_MAX_EXT   0x878a
#define GL_OP_MIN_EXT   0x878b
#define GL_OP_MOV_EXT   0x8799
#define GL_OP_MUL_EXT   0x8786
#define GL_OP_MULTIPLY_MATRIX_EXT   0x8798
#define GL_OP_NEGATE_EXT   0x8783
#define GL_OP_POWER_EXT   0x8793
#define GL_OP_RECIP_EXT   0x8794
#define GL_OP_RECIP_SQRT_EXT   0x8795
#define GL_OP_ROUND_EXT   0x8790
#define GL_OP_SET_GE_EXT   0x878c
#define GL_OP_SET_LT_EXT   0x878d
#define GL_OP_SUB_EXT   0x8796
#define GL_OPERAND0_ALPHA_ARB   0x8598
#define GL_OPERAND0_RGB_ARB   0x8590
#define GL_OPERAND1_ALPHA_ARB   0x8599
#define GL_OPERAND1_RGB_ARB   0x8591
#define GL_OPERAND2_ALPHA_ARB   0x859A
#define GL_OPERAND2_RGB_ARB   0x8592
#define GL_OUTPUT_COLOR0_EXT   0x879b
#define GL_OUTPUT_COLOR1_EXT   0x879c
#define GL_OUTPUT_FOG_EXT   0x87bd
#define GL_OUTPUT_TEXTURE_COORD0_EXT   0x879d
#define GL_OUTPUT_TEXTURE_COORD10_EXT   0x87a7
#define GL_OUTPUT_TEXTURE_COORD11_EXT   0x87a8
#define GL_OUTPUT_TEXTURE_COORD12_EXT   0x87a9
#define GL_OUTPUT_TEXTURE_COORD13_EXT   0x87aa
#define GL_OUTPUT_TEXTURE_COORD14_EXT   0x87ab
#define GL_OUTPUT_TEXTURE_COORD15_EXT   0x87ac
#define GL_OUTPUT_TEXTURE_COORD16_EXT   0x87ad
#define GL_OUTPUT_TEXTURE_COORD17_EXT   0x87ae
#define GL_OUTPUT_TEXTURE_COORD18_EXT   0x87af
#define GL_OUTPUT_TEXTURE_COORD19_EXT   0x87b0
#define GL_OUTPUT_TEXTURE_COORD1_EXT   0x879e
#define GL_OUTPUT_TEXTURE_COORD20_EXT   0x87b1
#define GL_OUTPUT_TEXTURE_COORD21_EXT   0x87b2
#define GL_OUTPUT_TEXTURE_COORD22_EXT   0x87b3
#define GL_OUTPUT_TEXTURE_COORD23_EXT   0x87b4
#define GL_OUTPUT_TEXTURE_COORD24_EXT   0x87b5
#define GL_OUTPUT_TEXTURE_COORD25_EXT   0x87b6
#define GL_OUTPUT_TEXTURE_COORD26_EXT   0x87b7
#define GL_OUTPUT_TEXTURE_COORD27_EXT   0x87b8
#define GL_OUTPUT_TEXTURE_COORD28_EXT   0x87b9
#define GL_OUTPUT_TEXTURE_COORD29_EXT   0x87ba
#define GL_OUTPUT_TEXTURE_COORD2_EXT   0x879f
#define GL_OUTPUT_TEXTURE_COORD30_EXT   0x87bb
#define GL_OUTPUT_TEXTURE_COORD31_EXT   0x87bc
#define GL_OUTPUT_TEXTURE_COORD3_EXT   0x87a0
#define GL_OUTPUT_TEXTURE_COORD4_EXT   0x87a1
#define GL_OUTPUT_TEXTURE_COORD5_EXT   0x87a2
#define GL_OUTPUT_TEXTURE_COORD6_EXT   0x87a3
#define GL_OUTPUT_TEXTURE_COORD7_EXT   0x87a4
#define GL_OUTPUT_TEXTURE_COORD8_EXT   0x87a5
#define GL_OUTPUT_TEXTURE_COORD9_EXT   0x87a6
#define GL_OUTPUT_VERTEX_EXT   0x879a
#define GL_PASS_THROUGH_NV   0x86E6
#define GL_PRESERVE_ATI   0x8762
#define GL_PREVIOUS_ARB   0x8578
#define GL_PREVIOUS_TEXTURE_INPUT_NV   0x86E4
#define GL_PRIMARY_COLOR_ARB   0x8577
#define GL_PROGRAM_ALU_INSTRUCTIONS_ARB   0x8805
#define GL_PROGRAM_ATTRIBS_ARB   0x88AC
#define GL_PROGRAM_BINDING_ARB   0x8677
#define GL_PROGRAM_ERROR_POSITION_ARB   0x864B
#define GL_PROGRAM_ERROR_POSITION_NV   0x864B
#define GL_PROGRAM_ERROR_STRING_ARB   0x8874
#define GL_PROGRAM_FORMAT_ARB   0x8876
#define GL_PROGRAM_FORMAT_ASCII_ARB   0x8875
#define GL_PROGRAM_INSTRUCTIONS_ARB   0x88A0
#define GL_PROGRAM_LENGTH_ARB   0x8627
#define GL_PROGRAM_LENGTH_NV   0x8627
#define GL_PROGRAM_NATIVE_ALU_INSTRUCTIONS_ARB   0x8808
#define GL_PROGRAM_NATIVE_ATTRIBS_ARB   0x88AE
#define GL_PROGRAM_NATIVE_INSTRUCTIONS_ARB   0x88A2
#define GL_PROGRAM_NATIVE_PARAMETERS_ARB   0x88AA
#define GL_PROGRAM_NATIVE_TEMPORARIES_ARB   0x88A6
#define GL_PROGRAM_NATIVE_TEX_INDIRECTIONS_ARB   0x880A
#define GL_PROGRAM_NATIVE_TEX_INSTRUCTIONS_ARB   0x8809
#define GL_PROGRAM_PARAMETER_NV   0x8644
#define GL_PROGRAM_PARAMETERS_ARB   0x88A8
#define GL_PROGRAM_RESIDENT_NV   0x8647
#define GL_PROGRAM_STRING_ARB   0x8628
#define GL_PROGRAM_STRING_NV   0x8628
#define GL_PROGRAM_TARGET_NV   0x8646
#define GL_PROGRAM_TEMPORARIES_ARB   0x88A4
#define GL_PROGRAM_TEX_INDIRECTIONS_ARB   0x8807
#define GL_PROGRAM_TEX_INSTRUCTIONS_ARB   0x8806
#define GL_PROGRAM_UNDER_NATIVE_LIMITS_ARB   0x88B6
#define GL_QUARTER_BIT_ATI   0x00000010
#define GL_RED_BIT_ATI   0x00000001
#define GL_REG_0_ATI   0x8921
#define GL_REG_10_ATI   0x892B
#define GL_REG_11_ATI   0x892C
#define GL_REG_12_ATI   0x892D
#define GL_REG_13_ATI   0x892E
#define GL_REG_14_ATI   0x892F
#define GL_REG_15_ATI   0x8930
#define GL_REG_16_ATI   0x8931
#define GL_REG_17_ATI   0x8932
#define GL_REG_18_ATI   0x8933
#define GL_REG_19_ATI   0x8934
#define GL_REG_1_ATI   0x8922
#define GL_REG_20_ATI   0x8935
#define GL_REG_21_ATI   0x8936
#define GL_REG_22_ATI   0x8937
#define GL_REG_23_ATI   0x8938
#define GL_REG_24_ATI   0x8939
#define GL_REG_25_ATI   0x893A
#define GL_REG_26_ATI   0x893B
#define GL_REG_27_ATI   0x893C
#define GL_REG_28_ATI   0x893D
#define GL_REG_29_ATI   0x893E
#define GL_REG_2_ATI   0x8923
#define GL_REG_30_ATI   0x893F
#define GL_REG_31_ATI   0x8940
#define GL_REG_3_ATI   0x8924
#define GL_REG_4_ATI   0x8925
#define GL_REG_5_ATI   0x8926
#define GL_REG_6_ATI   0x8927
#define GL_REG_7_ATI   0x8928
#define GL_REG_8_ATI   0x8929
#define GL_REG_9_ATI   0x892A
#define GL_RGB_SCALE_ARB   0x8573
#define GL_RGBA_UNSIGNED_DOT_PRODUCT_MAPPING_NV   0x86D9
#define GL_SATURATE_BIT_ATI   0x00000040
#define GL_SCALAR_EXT   0x87be
#define GL_SECONDARY_INTERPOLATOR_ATI   0x896D
#define GL_SHADER_CONSISTENT_NV   0x86DD
#define GL_SHADER_OPERATION_NV   0x86DF
#define GL_SIGNED_ALPHA8_NV   0x8706
#define GL_SIGNED_ALPHA_NV   0x8705
#define GL_SIGNED_HILO16_NV   0x86FA
#define GL_SIGNED_HILO_NV   0x86F9
#define GL_SIGNED_INTENSITY8_NV   0x8708
#define GL_SIGNED_INTENSITY_NV   0x8707
#define GL_SIGNED_LUMINANCE8_ALPHA8_NV   0x8704
#define GL_SIGNED_LUMINANCE8_NV   0x8702
#define GL_SIGNED_LUMINANCE_ALPHA_NV   0x8703
#define GL_SIGNED_LUMINANCE_NV   0x8701
#define GL_SIGNED_RGB8_NV   0x86FF
#define GL_SIGNED_RGB8_UNSIGNED_ALPHA8_NV   0x870D
#define GL_SIGNED_RGB_NV   0x86FE
#define GL_SIGNED_RGB_UNSIGNED_ALPHA_NV   0x870C
#define GL_SIGNED_RGBA8_NV   0x86FC
#define GL_SIGNED_RGBA_NV   0x86FB
#define GL_SOURCE0_ALPHA_ARB   0x8588
#define GL_SOURCE0_RGB_ARB   0x8580
#define GL_SOURCE1_ALPHA_ARB   0x8589
#define GL_SOURCE1_RGB_ARB   0x8581
#define GL_SOURCE2_ALPHA_ARB   0x858A
#define GL_SOURCE2_RGB_ARB   0x8582
#define GL_STATIC_ATI   0x8760
#define GL_SUB_ATI   0x8965
#define GL_SUBTRACT_ARB   0x84E7
#define GL_SWIZZLE_STQ_ATI   0x8977
#define GL_SWIZZLE_STQ_DQ_ATI   0x8979
#define GL_SWIZZLE_STR_ATI   0x8976
#define GL_SWIZZLE_STR_DR_ATI   0x8978
#define GL_SWIZZLE_STRQ_ATI   0x897A
#define GL_SWIZZLE_STRQ_DQ_ATI   0x897B
#define GL_TEXTURE_BORDER_VALUES_NV   0x871A
#define GL_TEXTURE_DS_SIZE_NV   0x871D
#define GL_TEXTURE_DT_SIZE_NV   0x871E
#define GL_TEXTURE_HI_SIZE_NV   0x871B
#define GL_TEXTURE_LO_SIZE_NV   0x871C
#define GL_TEXTURE_MAG_SIZE_NV   0x871F
#define GL_TEXTURE_SHADER_NV   0x86DE
#define GL_TRACK_MATRIX_NV   0x8648
#define GL_TRACK_MATRIX_TRANSFORM_NV   0x8649
#define GL_TRANSPOSE_CURRENT_MATRIX_ARB   0x88B7
#define GL_TRANSPOSE_NV   0x862C
#define GL_UNSIGNED_INT_8_8_S8_S8_REV_NV   0x86DB
#define GL_UNSIGNED_INT_S8_S8_8_8_NV   0x86DA
#define GL_VARIANT_ARRAY_EXT   0x87e8
#define GL_VARIANT_ARRAY_POINTER_EXT   0x87e9
#define GL_VARIANT_ARRAY_STRIDE_EXT   0x87e6
#define GL_VARIANT_ARRAY_TYPE_EXT   0x87e7
#define GL_VARIANT_DATATYPE_EXT   0x87e5
#define GL_VARIANT_EXT   0x87c1
#define GL_VARIANT_VALUE_EXT   0x87e4
#define GL_VECTOR_EXT   0x87bf
#define GL_VERTEX_ARRAY_RANGE_WITHOUT_FLUSH_NV   0x8533
#define GL_VERTEX_ATTRIB_ARRAY0_NV   0x8650
#define GL_VERTEX_ATTRIB_ARRAY10_NV   0x865A
#define GL_VERTEX_ATTRIB_ARRAY11_NV   0x865B
#define GL_VERTEX_ATTRIB_ARRAY12_NV   0x865C
#define GL_VERTEX_ATTRIB_ARRAY13_NV   0x865D
#define GL_VERTEX_ATTRIB_ARRAY14_NV   0x865E
#define GL_VERTEX_ATTRIB_ARRAY15_NV   0x865F
#define GL_VERTEX_ATTRIB_ARRAY1_NV   0x8651
#define GL_VERTEX_ATTRIB_ARRAY2_NV   0x8652
#define GL_VERTEX_ATTRIB_ARRAY3_NV   0x8653
#define GL_VERTEX_ATTRIB_ARRAY4_NV   0x8654
#define GL_VERTEX_ATTRIB_ARRAY5_NV   0x8655
#define GL_VERTEX_ATTRIB_ARRAY6_NV   0x8656
#define GL_VERTEX_ATTRIB_ARRAY7_NV   0x8657
#define GL_VERTEX_ATTRIB_ARRAY8_NV   0x8658
#define GL_VERTEX_ATTRIB_ARRAY9_NV   0x8659
#define GL_VERTEX_PROGRAM_BINDING_NV   0x864A
#define GL_VERTEX_PROGRAM_NV   0x8620
#define GL_VERTEX_PROGRAM_POINT_SIZE_NV   0x8642
#define GL_VERTEX_PROGRAM_TWO_SIDE_NV   0x8643
#define GL_VERTEX_SHADER_BINDING_EXT   0x8781
#define GL_VERTEX_SHADER_EXT   0x8780
#define GL_VERTEX_SHADER_INSTRUCTIONS_EXT   0x87cf
#define GL_VERTEX_SHADER_INVARIANTS_EXT   0x87d1
#define GL_VERTEX_SHADER_LOCAL_CONSTANTS_EXT   0x87d2
#define GL_VERTEX_SHADER_LOCALS_EXT   0x87d3
#define GL_VERTEX_SHADER_OPTIMIZED_EXT   0x87d4
#define GL_VERTEX_SHADER_VARIANTS_EXT   0x87d0
#define GL_VERTEX_STATE_PROGRAM_NV   0x8621
#define GL_VIBRANCE_BIAS_NV   0x8719
#define GL_VIBRANCE_SCALE_NV   0x8713
#define GL_W_EXT   0x87d8
#define GL_X_EXT   0x87d5
#define GL_Y_EXT   0x87d6
#define GL_Z_EXT   0x87d7
#define GL_ZERO_EXT   0x87dd
#define WGL_ACCELERATION_ARB   0x2003
#define WGL_ACCUM_ALPHA_BITS_ARB   0x2021
#define WGL_ACCUM_BITS_ARB   0x201D
#define WGL_ACCUM_BLUE_BITS_ARB   0x2020
#define WGL_ACCUM_GREEN_BITS_ARB   0x201F
#define WGL_ACCUM_RED_BITS_ARB   0x201E
#define WGL_ALPHA_BITS_ARB   0x201B
#define WGL_ALPHA_SHIFT_ARB   0x201C
#define WGL_ARB_pbuffer   1
#define WGL_ARB_pixel_format   1
#define WGL_AUX_BUFFERS_ARB   0x2024
#define WGL_BLUE_BITS_ARB   0x2019
#define WGL_BLUE_SHIFT_ARB   0x201A
#define WGL_COLOR_BITS_ARB   0x2014
#define WGL_DEPTH_BITS_ARB   0x2022
#define WGL_DOUBLE_BUFFER_ARB   0x2011
#define WGL_DRAW_TO_BITMAP_ARB   0x2002
#define WGL_DRAW_TO_PBUFFER_ARB   0x202D
#define WGL_DRAW_TO_WINDOW_ARB   0x2001
#define WGL_FULL_ACCELERATION_ARB   0x2027
#define WGL_GENERIC_ACCELERATION_ARB   0x2026
#define WGL_GREEN_BITS_ARB   0x2017
#define WGL_GREEN_SHIFT_ARB   0x2018
#define WGL_MAX_PBUFFER_HEIGHT_ARB   0x2030
#define WGL_MAX_PBUFFER_PIXELS_ARB   0x202E
#define WGL_MAX_PBUFFER_WIDTH_ARB   0x202F
#define WGL_NEED_PALETTE_ARB   0x2004
#define WGL_NEED_SYSTEM_PALETTE_ARB   0x2005
#define WGL_NO_ACCELERATION_ARB   0x2025
#define WGL_NUMBER_OVERLAYS_ARB   0x2008
#define WGL_NUMBER_PIXEL_FORMATS_ARB   0x2000
#define WGL_NUMBER_UNDERLAYS_ARB   0x2009
#define WGL_PBUFFER_HEIGHT_ARB   0x2035
#define WGL_PBUFFER_LARGEST_ARB   0x2033
#define WGL_PBUFFER_LOST_ARB   0x2036
#define WGL_PBUFFER_WIDTH_ARB   0x2034
#define WGL_PIXEL_TYPE_ARB   0x2013
#define WGL_RED_BITS_ARB   0x2015
#define WGL_RED_SHIFT_ARB   0x2016
#define WGL_SHARE_ACCUM_ARB   0x200E
#define WGL_SHARE_DEPTH_ARB   0x200C
#define WGL_SHARE_STENCIL_ARB   0x200D
#define WGL_STENCIL_BITS_ARB   0x2023
#define WGL_STEREO_ARB   0x2012
#define WGL_SUPPORT_GDI_ARB   0x200F
#define WGL_SUPPORT_OPENGL_ARB   0x2010
#define WGL_SWAP_COPY_ARB   0x2029
#define WGL_SWAP_EXCHANGE_ARB   0x2028
#define WGL_SWAP_LAYER_BUFFERS_ARB   0x2006
#define WGL_SWAP_METHOD_ARB   0x2007
#define WGL_SWAP_UNDEFINED_ARB   0x202A
#define WGL_TRANSPARENT_ALPHA_VALUE_ARB   0x203A
#define WGL_TRANSPARENT_ARB   0x200A
#define WGL_TRANSPARENT_BLUE_VALUE_ARB   0x2039
#define WGL_TRANSPARENT_GREEN_VALUE_ARB   0x2038
#define WGL_TRANSPARENT_INDEX_VALUE_ARB   0x203B
#define WGL_TRANSPARENT_RED_VALUE_ARB   0x2037
#define WGL_TYPE_COLORINDEX_ARB   0x202C
#define WGL_TYPE_RGBA_ARB   0x202B

Typedefs

typedef GLenum void * addr
typedef GLuint address
typedef GLclampf GLclampf
+GLclampf 
alpha
typedef GLuint GLuint arg1
typedef GLuint GLuint GLuint arg2
typedef GLuint GLuint GLuint
+GLuint 
arg3
typedef GLbyte GLbyte blue
typedef GLint GLenum GLsizei
+GLsizei GLsizei GLint 
border
typedef GLint GLenum GLsizei
+GLuint 
buffer
typedef GLenum cap
typedef GLenum GLenum GLuint components
typedef GLenum condition
typedef GLenum coord
typedef GLuint GLsizei count
typedef GLint GLenum GLsizei
+GLsizei GLsizei GLint GLsizei
+const GLvoid * 
data
typedef GLint GLenum GLsizei
+GLsizei GLsizei 
depth
typedef const GLuint * fences
typedef GLint GLint GLint
+GLint GLsizei GLsizei GLsizei
+GLenum 
format
typedef GLint fsize
typedef GLbyte green
typedef GLint GLenum GLsizei
+GLsizei 
height
typedef GLuint id
typedef GLint GLenum GLsizei
+GLsizei GLsizei GLint GLsizei 
imageSize
typedef GLint void * img
typedef GLuint in
typedef GLuint index
typedef GLint GLenum internalformat
typedef GLuint GLsizei len
typedef GLint level
typedef GLuint GLenum matrix
typedef GLvoid(APIENTRY * NEL_PFNGLALPHAFRAGMENTOP1ATIPROC )(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod)
typedef GLvoid(APIENTRY * NEL_PFNGLALPHAFRAGMENTOP2ATIPROC )(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod)
typedef GLvoid(APIENTRY * NEL_PFNGLALPHAFRAGMENTOP3ATIPROC )(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod, GLuint arg3, GLuint arg3Rep, GLuint arg3Mod)
typedef GLvoid(APIENTRY * NEL_PFNGLBEGINFRAGMENTSHADERATIPROC )(GLvoid)
typedef GLvoid(APIENTRY * NEL_PFNGLBINDFRAGMENTSHADERATIPROC )(GLuint id)
typedef GLvoid(APIENTRY * NEL_PFNGLBINDPROGRAMARBPROC )(GLenum target, GLuint program)
typedef GLvoid(APIENTRY * NEL_PFNGLCOLORFRAGMENTOP1ATIPROC )(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod)
typedef GLvoid(APIENTRY * NEL_PFNGLCOLORFRAGMENTOP2ATIPROC )(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod)
typedef GLvoid(APIENTRY * NEL_PFNGLCOLORFRAGMENTOP3ATIPROC )(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod, GLuint arg3, GLuint arg3Rep, GLuint arg3Mod)
typedef GLvoid(APIENTRY * NEL_PFNGLDELETEFRAGMENTSHADERATIPROC )(GLuint id)
typedef GLvoid(APIENTRY * NEL_PFNGLDELETEPROGRAMSARBPROC )(GLsizei n, const GLuint *programs)
typedef GLvoid(APIENTRY * NEL_PFNGLENDFRAGMENTSHADERATIPROC )(GLvoid)
typedef GLuint(APIENTRY * NEL_PFNGLGENFRAGMENTSHADERSATIPROC )(GLuint range)
typedef GLvoid(APIENTRY * NEL_PFNGLGENPROGRAMSARBPROC )(GLsizei n, GLuint *programs)
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMENVPARAMETERDVARBPROC )(GLenum target, GLuint index, GLdouble *params)
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMENVPARAMETERFVARBPROC )(GLenum target, GLuint index, GLfloat *params)
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMIVARBPROC )(GLenum target, GLenum pname, int *params)
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMLOCALPARAMETERDVARBPROC )(GLenum target, GLuint index, GLdouble *params)
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMLOCALPARAMETERFVARBPROC )(GLenum target, GLuint index, GLfloat *params)
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMSTRINGARBPROC )(GLenum target, GLenum pname, GLvoid *string)
typedef GLboolean(APIENTRY * NEL_PFNGLISPROGRAMARBPROC )(GLuint program)
typedef void *(APIENTRY * NEL_PFNGLMAPOBJECTBUFFERATIPROC )(GLuint buffer)
typedef GLvoid(APIENTRY * NEL_PFNGLPASSTEXCOORDATIPROC )(GLuint dst, GLuint coord, GLenum swizzle)
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMENVPARAMETER4DARBPROC )(GLenum target, GLuint index, GLdouble x, GLdouble y, GLdouble z, GLdouble w)
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMENVPARAMETER4DVARBPROC )(GLenum target, GLuint index, const GLdouble *params)
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMENVPARAMETER4FARBPROC )(GLenum target, GLuint index, GLfloat x, GLfloat y, GLfloat z, GLfloat w)
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMENVPARAMETER4FVARBPROC )(GLenum target, GLuint index, const GLfloat *params)
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMLOCALPARAMETER4DARBPROC )(GLenum target, GLuint index, GLdouble x, GLdouble y, GLdouble z, GLdouble w)
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMLOCALPARAMETER4DVARBPROC )(GLenum target, GLuint index, const GLdouble *params)
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMLOCALPARAMETER4FARBPROC )(GLenum target, GLuint index, GLfloat x, GLfloat y, GLfloat z, GLfloat w)
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMLOCALPARAMETER4FVARBPROC )(GLenum target, GLuint index, const GLfloat *params)
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMSTRINGARBPROC )(GLenum target, GLenum format, GLsizei len, const GLvoid *string)
typedef GLvoid(APIENTRY * NEL_PFNGLSAMPLEMAPATIPROC )(GLuint dst, GLuint interp, GLenum swizzle)
typedef GLvoid(APIENTRY * NEL_PFNGLSETFRAGMENTSHADERCONSTANTATIPROC )(GLuint dst, const GLfloat *value)
typedef void(APIENTRY * NEL_PFNGLUNMAPOBJECTBUFFERATIPROC )(GLuint buffer)
typedef GLuint GLuint num
typedef GLuint offset
typedef GLuint GLenum GLenum
+GLenum GLenum 
outW
typedef GLuint GLenum outX
typedef GLuint GLenum GLenum outY
typedef GLuint GLenum GLenum
+GLenum 
outZ
typedef GLint * param
typedef GLuint const GLfloat * params
typedef GLvoid(APIENTRY * PFNGLALPHAFRAGMENTOP1ATIPROC )(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod)
typedef GLvoid(APIENTRY * PFNGLALPHAFRAGMENTOP2ATIPROC )(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod)
typedef GLvoid(APIENTRY * PFNGLALPHAFRAGMENTOP3ATIPROC )(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod, GLuint arg3, GLuint arg3Rep, GLuint arg3Mod)
typedef GLvoid(APIENTRY * PFNGLBEGINFRAGMENTSHADERATIPROC )(GLvoid)
typedef GLvoid(APIENTRY * PFNGLBINDFRAGMENTSHADERATIPROC )(GLuint id)
typedef GLvoid(APIENTRY * PFNGLBINDPROGRAMARBPROC )(GLenum target, GLuint program)
typedef GLvoid(APIENTRY * PFNGLCOLORFRAGMENTOP1ATIPROC )(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod)
typedef GLvoid(APIENTRY * PFNGLCOLORFRAGMENTOP2ATIPROC )(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod)
typedef GLvoid(APIENTRY * PFNGLCOLORFRAGMENTOP3ATIPROC )(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod, GLuint arg3, GLuint arg3Rep, GLuint arg3Mod)
typedef GLvoid(APIENTRY * PFNGLDELETEFRAGMENTSHADERATIPROC )(GLuint id)
typedef GLvoid(APIENTRY * PFNGLDELETEPROGRAMSARBPROC )(GLsizei n, const GLuint *programs)
typedef GLvoid(APIENTRY * PFNGLENDFRAGMENTSHADERATIPROC )(GLvoid)
typedef GLuint(APIENTRY * PFNGLGENFRAGMENTSHADERSATIPROC )(GLuint range)
typedef GLvoid(APIENTRY * PFNGLGENPROGRAMSARBPROC )(GLsizei n, GLuint *programs)
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMENVPARAMETERDVARBPROC )(GLenum target, GLuint index, GLdouble *params)
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMENVPARAMETERFVARBPROC )(GLenum target, GLuint index, GLfloat *params)
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMIVARBPROC )(GLenum target, GLenum pname, int *params)
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMLOCALPARAMETERDVARBPROC )(GLenum target, GLuint index, GLdouble *params)
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMLOCALPARAMETERFVARBPROC )(GLenum target, GLuint index, GLfloat *params)
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMSTRINGARBPROC )(GLenum target, GLenum pname, GLvoid *string)
typedef GLboolean(APIENTRY * PFNGLISPROGRAMARBPROC )(GLuint program)
typedef void *(APIENTRY * PFNGLMAPOBJECTBUFFERATIPROC )(GLuint buffer)
typedef GLvoid(APIENTRY * PFNGLPASSTEXCOORDATIPROC )(GLuint dst, GLuint coord, GLenum swizzle)
typedef GLvoid(APIENTRY * PFNGLPROGRAMENVPARAMETER4DARBPROC )(GLenum target, GLuint index, GLdouble x, GLdouble y, GLdouble z, GLdouble w)
typedef GLvoid(APIENTRY * PFNGLPROGRAMENVPARAMETER4DVARBPROC )(GLenum target, GLuint index, const GLdouble *params)
typedef GLvoid(APIENTRY * PFNGLPROGRAMENVPARAMETER4FARBPROC )(GLenum target, GLuint index, GLfloat x, GLfloat y, GLfloat z, GLfloat w)
typedef GLvoid(APIENTRY * PFNGLPROGRAMENVPARAMETER4FVARBPROC )(GLenum target, GLuint index, const GLfloat *params)
typedef GLvoid(APIENTRY * PFNGLPROGRAMLOCALPARAMETER4DARBPROC )(GLenum target, GLuint index, GLdouble x, GLdouble y, GLdouble z, GLdouble w)
typedef GLvoid(APIENTRY * PFNGLPROGRAMLOCALPARAMETER4DVARBPROC )(GLenum target, GLuint index, const GLdouble *params)
typedef GLvoid(APIENTRY * PFNGLPROGRAMLOCALPARAMETER4FARBPROC )(GLenum target, GLuint index, GLfloat x, GLfloat y, GLfloat z, GLfloat w)
typedef GLvoid(APIENTRY * PFNGLPROGRAMLOCALPARAMETER4FVARBPROC )(GLenum target, GLuint index, const GLfloat *params)
typedef GLvoid(APIENTRY * PFNGLPROGRAMSTRINGARBPROC )(GLenum target, GLenum format, GLsizei len, const GLvoid *string)
typedef GLvoid(APIENTRY * PFNGLSAMPLEMAPATIPROC )(GLuint dst, GLuint interp, GLenum swizzle)
typedef GLvoid(APIENTRY * PFNGLSETFRAGMENTSHADERCONSTANTATIPROC )(GLuint dst, const GLfloat *value)
typedef void(APIENTRY * PFNGLUNMAPOBJECTBUFFERATIPROC )(GLuint buffer)
typedef GLuint GLenum pname
typedef GLenum GLvoid ** pointer
typedef GLuint GLsizei const
+GLvoid GLenum 
preserve
typedef GLenum GLubyte * program
typedef const GLuint * programs
typedef GLdouble GLdouble
+GLdouble GLdouble 
q
typedef GLdouble GLdouble
+GLdouble 
r
typedef GLenum GLenum range
typedef GLuint res
typedef const GLuint GLboolean * residences
typedef GLdouble s
typedef GLuint GLsizei size
typedef GLuint src
typedef GLenum storagetype
typedef GLint GLenum GLsizei stride
typedef GLdouble GLdouble t
typedef GLuint GLenum GLenum transform
typedef GLint GLenum type
typedef const GLvoid GLenum usage
typedef GLuint const GLdouble * v
typedef GLenum value
typedef GLuint GLdouble GLdouble
+GLdouble GLdouble 
w
typedef GLint GLenum GLsizei width
typedef GLuint GLdouble x
typedef GLint GLint xoffset
typedef GLuint GLdouble GLdouble y
typedef GLint GLint GLint yoffset
typedef GLuint GLdouble GLdouble
+GLdouble 
z
typedef GLint GLint GLint
+GLint 
zoffset

Functions

typedef GLboolean (APIENTRY *PFNGLAREPROGRAMSRESIDENTNVPROC)(GLsizei n
typedef GLuint (APIENTRY *PFNGLNEWOBJECTBUFFERATIPROC)(GLsizei size
typedef void (APIENTRY *PFNGLBINDPROGRAMNVPROC)(GLenum target
+


Define Documentation

+

+ + + + +
+ + +
#define GL_2X_BIT_ATI   0x00000001 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 791 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::fetchPerturbedEnvMapR200().

+

+ + + + +
+ + +
#define GL_4X_BIT_ATI   0x00000002 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 792 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_8X_BIT_ATI   0x00000004 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 793 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ADD_ATI   0x8963 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 763 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ADD_SIGNED_ARB   0x8574 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 373 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ALL_COMPLETED_NV   0x84F2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 386 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CVertexBufferHardGLNVidia::setFence().

+

+ + + + +
+ + +
#define GL_ARB_fragment_program   1 +
+
+ + + + + +
+   + + +

+GL_ARB_fragment_program +

+Definition at line 857 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ARB_texture_env_combine   1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 355 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ARRAY_OBJECT_BUFFER_ATI   0x8766 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 623 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ARRAY_OBJECT_OFFSET_ATI   0x8767 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 624 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ATI_envmap_bumpmap   1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 672 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ATI_fragment_shader   1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 695 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ATI_map_object_buffer   1 +
+
+ + + + + +
+   + + +

+GL_ATI_map_object_buffer +

+Definition at line 841 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ATI_vertex_array_object   1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 628 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ATTRIB_ARRAY_POINTER_NV   0x8645 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 98 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ATTRIB_ARRAY_SIZE_NV   0x8623 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 72 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ATTRIB_ARRAY_STRIDE_NV   0x8624 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 73 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ATTRIB_ARRAY_TYPE_NV   0x8625 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 74 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_BIAS_BIT_ATI   0x00000008 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 800 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::fetchPerturbedEnvMapR200().

+

+ + + + +
+ + +
#define GL_BLUE_BIT_ATI   0x00000004 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 790 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_BUMP_ENVMAP_ATI   0x877B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 680 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::forceActivateTexEnvMode().

+

+ + + + +
+ + +
#define GL_BUMP_NUM_TEX_UNITS_ATI   0x8777 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 676 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::initEMBM().

+

+ + + + +
+ + +
#define GL_BUMP_ROT_MATRIX_ATI   0x8775 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 674 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setEMBMMatrix().

+

+ + + + +
+ + +
#define GL_BUMP_ROT_MATRIX_SIZE_ATI   0x8776 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 675 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_BUMP_TARGET_ATI   0x877C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 681 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::initEMBM().

+

+ + + + +
+ + +
#define GL_BUMP_TEX_UNITS_ATI   0x8778 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 677 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::initEMBM().

+

+ + + + +
+ + +
#define GL_CND0_ATI   0x896B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 771 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CND_ATI   0x896A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 770 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_COLOR_ALPHA_PAIRING_ATI   0x8975 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 781 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_COMBINE_ALPHA_ARB   0x8572 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 359 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_COMBINE_ARB   0x8570 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 357 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_COMBINE_RGB_ARB   0x8571 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 358 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_COMP_BIT_ATI   0x00000002 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 798 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_0_ATI   0x8941 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 730 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::fetchPerturbedEnvMapR200(), and NL3D::CDriverGL::setupWaterPassR200().

+

+ + + + +
+ + +
#define GL_CON_10_ATI   0x894B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 740 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_11_ATI   0x894C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 741 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_12_ATI   0x894D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 742 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_13_ATI   0x894E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 743 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_14_ATI   0x894F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 744 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_15_ATI   0x8950 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 745 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_16_ATI   0x8951 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 746 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_17_ATI   0x8952 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 747 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_18_ATI   0x8953 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 748 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_19_ATI   0x8954 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 749 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_1_ATI   0x8942 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 731 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::fetchPerturbedEnvMapR200(), and NL3D::CDriverGL::setupWaterPassR200().

+

+ + + + +
+ + +
#define GL_CON_20_ATI   0x8955 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 750 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_21_ATI   0x8956 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 751 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_22_ATI   0x8957 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 752 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_23_ATI   0x8958 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 753 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_24_ATI   0x8959 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 754 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_25_ATI   0x895A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 755 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_26_ATI   0x895B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 756 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_27_ATI   0x895C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 757 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_28_ATI   0x895D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 758 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_29_ATI   0x895E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 759 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_2_ATI   0x8943 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 732 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_30_ATI   0x895F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 760 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_31_ATI   0x8960 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 761 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_3_ATI   0x8944 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 733 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_4_ATI   0x8945 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 734 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_5_ATI   0x8946 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 735 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_6_ATI   0x8947 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 736 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_7_ATI   0x8948 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 737 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_8_ATI   0x8949 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 738 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CON_9_ATI   0x894A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 739 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CONST_EYE_NV   0x86E5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 429 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CONSTANT_ARB   0x8576 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 375 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CULL_FRAGMENT_NV   0x86E7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 431 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_CULL_MODES_NV   0x86E0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 421 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CURRENT_ATTRIB_NV   0x8626 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 75 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CURRENT_MATRIX_ARB   0x8641 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 899 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CURRENT_MATRIX_NV   0x8641 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 94 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CURRENT_MATRIX_STACK_DEPTH_ARB   0x8640 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 901 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CURRENT_MATRIX_STACK_DEPTH_NV   0x8640 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 93 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_CURRENT_VERTEX_EXT   0x87e2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 600 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define GL_DEPENDENT_AR_TEXTURE_2D_NV   0x86E9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 433 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_DEPENDENT_GB_TEXTURE_2D_NV   0x86EA +
+
+ + + + + +
+   + + +

+ +

+Definition at line 434 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_DISCARD_ATI   0x8763 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 620 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DOT2_ADD_ATI   0x896C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 772 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DOT3_ATI   0x8966 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 766 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DOT4_ATI   0x8967 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 767 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DOT_PRODUCT_CONST_EYE_REFLECT_CUBE_MAP_NV   0x86F3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 442 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_DOT_PRODUCT_DEPTH_REPLACE_NV   0x86ED +
+
+ + + + + +
+   + + +

+ +

+Definition at line 436 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_DOT_PRODUCT_DIFFUSE_CUBE_MAP_NV   0x86F1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 440 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_DOT_PRODUCT_NV   0x86EC +
+
+ + + + + +
+   + + +

+ +

+Definition at line 435 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_DOT_PRODUCT_REFLECT_CUBE_MAP_NV   0x86F2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 441 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_DOT_PRODUCT_TEXTURE_2D_NV   0x86EE +
+
+ + + + + +
+   + + +

+ +

+Definition at line 437 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_DOT_PRODUCT_TEXTURE_3D_NV   0x86EF +
+
+ + + + + +
+   + + +

+ +

+Definition at line 438 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DOT_PRODUCT_TEXTURE_CUBE_MAP_NV   0x86F0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 439 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_DOT_PRODUCT_TEXTURE_RECTANGLE_NV   0x864E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 413 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DS_BIAS_NV   0x8716 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 475 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DS_SCALE_NV   0x8710 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 469 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DSDT8_MAG8_INTENSITY8_NV   0x870B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 464 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DSDT8_MAG8_NV   0x870A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 463 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DSDT8_NV   0x8709 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 462 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DSDT_MAG_INTENSITY_NV   0x86DC +
+
+ + + + + +
+   + + +

+ +

+Definition at line 417 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DSDT_MAG_NV   0x86F6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 445 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DSDT_MAG_VIB_NV   0x86F7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 446 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DSDT_NV   0x86F5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 444 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::computeMipMapMemoryUsage(), NL3D::getGlSrcTextureComponentType(), NL3D::getGlSrcTextureFormat(), and NL3D::CDriverGL::getGlTextureFormat().

+

+ + + + +
+ + +
#define GL_DT_BIAS_NV   0x8717 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 476 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DT_SCALE_NV   0x8711 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 470 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_DU8DV8_ATI   0x877A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 679 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::computeMipMapMemoryUsage(), NL3D::getGlSrcTextureComponentType(), NL3D::getGlSrcTextureFormat(), and NL3D::CDriverGL::getGlTextureFormat().

+

+ + + + +
+ + +
#define GL_DUDV_ATI   0x8779 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 678 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::getGlSrcTextureFormat().

+

+ + + + +
+ + +
#define GL_DYNAMIC_ATI   0x8761 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 618 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CVertexArrayRangeMapObjectATI::allocate(), NL3D::CVertexArrayRangeATI::allocate(), and NL3D::CVertexArrayRangeMapObjectATI::createVBHardGL().

+

+ + + + +
+ + +
#define GL_EIGHTH_BIT_ATI   0x00000020 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 796 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_FENCE_CONDITION_NV   0x84F4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 388 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_FENCE_STATUS_NV   0x84F3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 387 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_FRAGMENT_PROGRAM_ARB   0x8804 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 859 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::endWaterMultiPass(), NL3D::loadARBFragmentProgramStringNative(), and NL3D::CDriverGL::setupWaterPassARB().

+

+ + + + +
+ + +
#define GL_FRAGMENT_SHADER_ATI   0x8920 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 697 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::endWaterMultiPass(), and NL3D::CDriverGL::setupWaterPassR200().

+

+ + + + +
+ + +
#define GL_FULL_RANGE_EXT   0x87e1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 599 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_GREEN_BIT_ATI   0x00000002 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 789 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_HALF_BIT_ATI   0x00000008 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 794 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_HI_BIAS_NV   0x8714 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 473 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_HI_SCALE_NV   0x870E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 467 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_HILO16_NV   0x86F8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 447 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_HILO_NV   0x86F4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 443 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_IDENTITY_NV   0x862A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 79 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setConstantMatrix().

+

+ + + + +
+ + +
#define GL_INTERPOLATE_ARB   0x8575 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 374 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_INVARIANT_DATATYPE_EXT   0x87eb +
+
+ + + + + +
+   + + +

+ +

+Definition at line 500 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_INVARIANT_EXT   0x87c2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 567 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define GL_INVARIANT_VALUE_EXT   0x87ea +
+
+ + + + + +
+   + + +

+ +

+Definition at line 499 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_INVERSE_NV   0x862B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 80 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_INVERSE_TRANSPOSE_NV   0x862D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 82 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_LERP_ATI   0x8969 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 769 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_LO_BIAS_NV   0x8715 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 474 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_LO_SCALE_NV   0x870F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 468 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_LOCAL_CONSTANT_DATATYPE_EXT   0x87ed +
+
+ + + + + +
+   + + +

+ +

+Definition at line 502 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_LOCAL_CONSTANT_EXT   0x87c3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 568 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_LOCAL_CONSTANT_VALUE_EXT   0x87ec +
+
+ + + + + +
+   + + +

+ +

+Definition at line 501 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_LOCAL_EXT   0x87c4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 569 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_MAD_ATI   0x8968 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 768 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::fetchPerturbedEnvMapR200().

+

+ + + + +
+ + +
#define GL_MAGNITUDE_BIAS_NV   0x8718 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 477 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAGNITUDE_SCALE_NV   0x8712 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 471 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB0_4_NV   0x8660 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 121 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB10_4_NV   0x866A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 131 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB11_4_NV   0x866B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 132 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB12_4_NV   0x866C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 133 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB13_4_NV   0x866D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 134 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB14_4_NV   0x866E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 135 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB15_4_NV   0x866F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 136 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB1_4_NV   0x8661 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 122 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB2_4_NV   0x8662 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 123 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB3_4_NV   0x8663 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 124 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB4_4_NV   0x8664 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 125 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB5_4_NV   0x8665 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 126 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB6_4_NV   0x8666 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 127 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB7_4_NV   0x8667 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 128 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB8_4_NV   0x8668 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 129 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP1_VERTEX_ATTRIB9_4_NV   0x8669 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 130 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB0_4_NV   0x8670 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 137 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB10_4_NV   0x867A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 147 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB11_4_NV   0x867B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 148 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB12_4_NV   0x867C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 149 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB13_4_NV   0x867D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 150 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB14_4_NV   0x867E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 151 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB15_4_NV   0x867F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 152 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB1_4_NV   0x8671 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 138 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB2_4_NV   0x8672 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 139 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB3_4_NV   0x8673 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 140 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB4_4_NV   0x8674 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 141 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB5_4_NV   0x8675 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 142 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB6_4_NV   0x8676 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 143 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB7_4_NV   0x8677 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 144 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB8_4_NV   0x8678 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 145 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAP2_VERTEX_ATTRIB9_4_NV   0x8679 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 146 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX0_ARB   0x88C0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 907 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX0_NV   0x8630 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 85 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX10_ARB   0x88CA +
+
+ + + + + +
+   + + +

+ +

+Definition at line 917 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX11_ARB   0x88CB +
+
+ + + + + +
+   + + +

+ +

+Definition at line 918 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX12_ARB   0x88CC +
+
+ + + + + +
+   + + +

+ +

+Definition at line 919 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX13_ARB   0x88CD +
+
+ + + + + +
+   + + +

+ +

+Definition at line 920 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX14_ARB   0x88CE +
+
+ + + + + +
+   + + +

+ +

+Definition at line 921 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX15_ARB   0x88CF +
+
+ + + + + +
+   + + +

+ +

+Definition at line 922 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX16_ARB   0x88D0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 923 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX17_ARB   0x88D1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 924 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX18_ARB   0x88D2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 925 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX19_ARB   0x88D3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 926 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX1_ARB   0x88C1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 908 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX1_NV   0x8631 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 86 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX20_ARB   0x88D4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 927 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX21_ARB   0x88D5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 928 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX22_ARB   0x88D6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 929 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX23_ARB   0x88D7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 930 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX24_ARB   0x88D8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 931 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX25_ARB   0x88D9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 932 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX26_ARB   0x88DA +
+
+ + + + + +
+   + + +

+ +

+Definition at line 933 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX27_ARB   0x88DB +
+
+ + + + + +
+   + + +

+ +

+Definition at line 934 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX28_ARB   0x88DC +
+
+ + + + + +
+   + + +

+ +

+Definition at line 935 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX29_ARB   0x88DD +
+
+ + + + + +
+   + + +

+ +

+Definition at line 936 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX2_ARB   0x88C2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 909 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX2_NV   0x8632 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 87 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX30_ARB   0x88DE +
+
+ + + + + +
+   + + +

+ +

+Definition at line 937 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX31_ARB   0x88DF +
+
+ + + + + +
+   + + +

+ +

+Definition at line 938 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX3_ARB   0x88C3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 910 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX3_NV   0x8633 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 88 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX4_ARB   0x88C4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 911 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX4_NV   0x8634 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 89 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX5_ARB   0x88C5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 912 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX5_NV   0x8635 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 90 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX6_ARB   0x88C6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 913 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX6_NV   0x8636 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 91 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX7_ARB   0x88C7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 914 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX7_NV   0x8637 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 92 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX8_ARB   0x88C8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 915 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX9_ARB   0x88C9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 916 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MATRIX_EXT   0x87c0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 565 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_INSTRUCTIONS_EXT   0x87ca +
+
+ + + + + +
+   + + +

+ +

+Definition at line 575 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_INVARIANTS_EXT   0x87cd +
+
+ + + + + +
+   + + +

+ +

+Definition at line 578 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_LOCAL_CONSTANTS_EXT   0x87cc +
+
+ + + + + +
+   + + +

+ +

+Definition at line 577 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_LOCALS_EXT   0x87ce +
+
+ + + + + +
+   + + +

+ +

+Definition at line 579 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_OPTIMIZED_VERTEX_SHADER_VARIANTS_EXT   0x87cb +
+
+ + + + + +
+   + + +

+ +

+Definition at line 576 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_ALU_INSTRUCTIONS_ARB   0x880B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 890 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_ATTRIBS_ARB   0x88AD +
+
+ + + + + +
+   + + +

+ +

+Definition at line 878 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_ENV_PARAMETERS_ARB   0x88B5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 882 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_INSTRUCTIONS_ARB   0x88A1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 865 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_LOCAL_PARAMETERS_ARB   0x88B4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 881 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_MATRICES_ARB   0x862F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 902 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_MATRIX_STACK_DEPTH_ARB   0x862E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 903 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_NATIVE_ALU_INSTRUCTIONS_ARB   0x880E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 893 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_NATIVE_ATTRIBS_ARB   0x88AF +
+
+ + + + + +
+   + + +

+ +

+Definition at line 880 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_NATIVE_INSTRUCTIONS_ARB   0x88A3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 867 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_NATIVE_PARAMETERS_ARB   0x88AB +
+
+ + + + + +
+   + + +

+ +

+Definition at line 876 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_NATIVE_TEMPORARIES_ARB   0x88A7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 872 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_NATIVE_TEX_INDIRECTIONS_ARB   0x8810 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 895 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_NATIVE_TEX_INSTRUCTIONS_ARB   0x880F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 894 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_PARAMETERS_ARB   0x88A9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 874 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_TEMPORARIES_ARB   0x88A5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 869 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_TEX_INDIRECTIONS_ARB   0x880D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 892 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_PROGRAM_TEX_INSTRUCTIONS_ARB   0x880C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 891 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_TEXTURE_COORDS_ARB   0x8871 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 904 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_TEXTURE_IMAGE_UNITS_ARB   0x8872 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 905 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_TRACK_MATRICES_NV   0x862F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 84 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_TRACK_MATRIX_STACK_DEPTH_NV   0x862E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 83 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_VERTEX_SHADER_INSTRUCTIONS_EXT   0x87c5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 570 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_VERTEX_SHADER_INVARIANTS_EXT   0x87c7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 572 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MAX_VERTEX_SHADER_LOCAL_CONSTANTS_EXT   0x87c8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 573 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_MAX_VERTEX_SHADER_LOCALS_EXT   0x87c9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 574 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_MAX_VERTEX_SHADER_VARIANTS_EXT   0x87c6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 571 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_MODELVIEW_PROJECTION_NV   0x8629 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 78 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MODULATE_ADD_ATIX   0x8744 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 661 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupLightMapPass(), NL3D::CDriverGL::setupPPLNoSpecPass(), NL3D::CDriverGL::setupPPLPass(), and NL3D::CDriverGL::setupSpecularPass().

+

+ + + + +
+ + +
#define GL_MODULATE_SIGNED_ADD_ATIX   0x8745 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 662 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MODULATE_SUBTRACT_ATIX   0x8746 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 663 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_MOV_ATI   0x8961 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 762 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::initFragmentShaders().

+

+ + + + +
+ + +
#define GL_MUL_ATI   0x8964 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 764 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::initFragmentShaders().

+

+ + + + +
+ + +
#define GL_MVP_MATRIX_EXT   0x87e3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 601 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NEGATE_BIT_ATI   0x00000004 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 799 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NEGATIVE_W_EXT   0x87dc +
+
+ + + + + +
+   + + +

+ +

+Definition at line 594 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convSwizzleToGLFormat(), and NL3D::doSwizzle().

+

+ + + + +
+ + +
#define GL_NEGATIVE_X_EXT   0x87d9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 591 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convSwizzleToGLFormat(), and NL3D::doSwizzle().

+

+ + + + +
+ + +
#define GL_NEGATIVE_Y_EXT   0x87da +
+
+ + + + + +
+   + + +

+ +

+Definition at line 592 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convSwizzleToGLFormat(), and NL3D::doSwizzle().

+

+ + + + +
+ + +
#define GL_NEGATIVE_Z_EXT   0x87db +
+
+ + + + + +
+   + + +

+ +

+Definition at line 593 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convSwizzleToGLFormat(), and NL3D::doSwizzle().

+

+ + + + +
+ + +
#define GL_NEGEXTVE_ONE_EXT   0x87df +
+
+ + + + + +
+   + + +

+ +

+Definition at line 597 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NORMALIZED_RANGE_EXT   0x87e0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 598 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_NUM_FRAGMENT_CONSTANTS_ATI   0x896F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 775 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NUM_FRAGMENT_REGISTERS_ATI   0x896E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 774 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NUM_INPUT_INTERPOLATOR_COMPONENTS_ATI   0x8973 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 779 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NUM_INSTRUCTIONS_PER_PASS_ATI   0x8971 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 777 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NUM_INSTRUCTIONS_TOTAL_ATI   0x8972 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 778 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NUM_LOOPBACK_COMPONENTS_ATI   0x8974 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 780 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NUM_PASSES_ATI   0x8970 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 776 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NV_fence   1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 384 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NV_vertex_array_range2   1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 610 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_NV_vertex_program   1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 68 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OBJECT_BUFFER_SIZE_ATI   0x8764 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 621 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OBJECT_BUFFER_USAGE_ATI   0x8765 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 622 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OFFSET_TEXTURE_2D_BIAS_NV   GL_OFFSET_TEXTURE_BIAS_NV +
+
+ + + + + +
+   + + +

+ +

+Definition at line 427 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OFFSET_TEXTURE_2D_MATRIX_NV   GL_OFFSET_TEXTURE_MATRIX_NV +
+
+ + + + + +
+   + + +

+ +

+Definition at line 425 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OFFSET_TEXTURE_2D_NV   0x86E8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 432 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_OFFSET_TEXTURE_2D_SCALE_NV   GL_OFFSET_TEXTURE_SCALE_NV +
+
+ + + + + +
+   + + +

+ +

+Definition at line 426 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_OFFSET_TEXTURE_BIAS_NV   0x86E3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 424 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OFFSET_TEXTURE_MATRIX_NV   0x86E1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 422 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setMatrix2DForTextureOffsetAddrMode(), and NL3D::CDriverGL::setupWaterPassNV20().

+

+ + + + +
+ + +
#define GL_OFFSET_TEXTURE_RECTANGLE_NV   0x864C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 411 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OFFSET_TEXTURE_RECTANGLE_SCALE_NV   0x864D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 412 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OFFSET_TEXTURE_SCALE_NV   0x86E2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 423 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_ONE_EXT   0x87de +
+
+ + + + + +
+   + + +

+ +

+Definition at line 596 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::doSwizzle(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_ADD_EXT   0x8787 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 508 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_CLAMP_EXT   0x878e +
+
+ + + + + +
+   + + +

+ +

+Definition at line 515 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_CROSS_PRODUCT_EXT   0x8797 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 524 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OP_DOT3_EXT   0x8784 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 505 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_DOT4_EXT   0x8785 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 506 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_EXP_BASE_2_EXT   0x8791 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 518 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_FLOOR_EXT   0x878f +
+
+ + + + + +
+   + + +

+ +

+Definition at line 516 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_FRAC_EXT   0x8789 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 510 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_INDEX_EXT   0x8782 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 503 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_LOG_BASE_2_EXT   0x8792 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 519 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_MADD_EXT   0x8788 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 509 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_MAX_EXT   0x878a +
+
+ + + + + +
+   + + +

+ +

+Definition at line 511 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_MIN_EXT   0x878b +
+
+ + + + + +
+   + + +

+ +

+Definition at line 512 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_MOV_EXT   0x8799 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 526 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_MUL_EXT   0x8786 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 507 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_MULTIPLY_MATRIX_EXT   0x8798 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 525 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OP_NEGATE_EXT   0x8783 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 504 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_POWER_EXT   0x8793 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 520 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_RECIP_EXT   0x8794 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 521 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_RECIP_SQRT_EXT   0x8795 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 522 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_ROUND_EXT   0x8790 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 517 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OP_SET_GE_EXT   0x878c +
+
+ + + + + +
+   + + +

+ +

+Definition at line 513 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_SET_LT_EXT   0x878d +
+
+ + + + + +
+   + + +

+ +

+Definition at line 514 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OP_SUB_EXT   0x8796 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 523 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OPERAND0_ALPHA_ARB   0x8598 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 369 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OPERAND0_RGB_ARB   0x8590 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 366 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OPERAND1_ALPHA_ARB   0x8599 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 370 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OPERAND1_RGB_ARB   0x8591 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 367 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OPERAND2_ALPHA_ARB   0x859A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 371 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OPERAND2_RGB_ARB   0x8592 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 368 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_COLOR0_EXT   0x879b +
+
+ + + + + +
+   + + +

+ +

+Definition at line 528 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_COLOR1_EXT   0x879c +
+
+ + + + + +
+   + + +

+ +

+Definition at line 529 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_FOG_EXT   0x87bd +
+
+ + + + + +
+   + + +

+ +

+Definition at line 562 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD0_EXT   0x879d +
+
+ + + + + +
+   + + +

+ +

+Definition at line 530 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD10_EXT   0x87a7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 540 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD11_EXT   0x87a8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 541 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD12_EXT   0x87a9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 542 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD13_EXT   0x87aa +
+
+ + + + + +
+   + + +

+ +

+Definition at line 543 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD14_EXT   0x87ab +
+
+ + + + + +
+   + + +

+ +

+Definition at line 544 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD15_EXT   0x87ac +
+
+ + + + + +
+   + + +

+ +

+Definition at line 545 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD16_EXT   0x87ad +
+
+ + + + + +
+   + + +

+ +

+Definition at line 546 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD17_EXT   0x87ae +
+
+ + + + + +
+   + + +

+ +

+Definition at line 547 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD18_EXT   0x87af +
+
+ + + + + +
+   + + +

+ +

+Definition at line 548 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD19_EXT   0x87b0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 549 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD1_EXT   0x879e +
+
+ + + + + +
+   + + +

+ +

+Definition at line 531 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD20_EXT   0x87b1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 550 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD21_EXT   0x87b2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 551 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD22_EXT   0x87b3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 552 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD23_EXT   0x87b4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 553 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD24_EXT   0x87b5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 554 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD25_EXT   0x87b6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 555 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD26_EXT   0x87b7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 556 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD27_EXT   0x87b8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 557 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD28_EXT   0x87b9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 558 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD29_EXT   0x87ba +
+
+ + + + + +
+   + + +

+ +

+Definition at line 559 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD2_EXT   0x879f +
+
+ + + + + +
+   + + +

+ +

+Definition at line 532 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD30_EXT   0x87bb +
+
+ + + + + +
+   + + +

+ +

+Definition at line 560 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD31_EXT   0x87bc +
+
+ + + + + +
+   + + +

+ +

+Definition at line 561 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD3_EXT   0x87a0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 533 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD4_EXT   0x87a1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 534 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD5_EXT   0x87a2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 535 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD6_EXT   0x87a3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 536 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD7_EXT   0x87a4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 537 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD8_EXT   0x87a5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 538 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_TEXTURE_COORD9_EXT   0x87a6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 539 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_OUTPUT_VERTEX_EXT   0x879a +
+
+ + + + + +
+   + + +

+ +

+Definition at line 527 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convOutputRegisterToEXTVertexShader().

+

+ + + + +
+ + +
#define GL_PASS_THROUGH_NV   0x86E6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 430 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convTexAddr().

+

+ + + + +
+ + +
#define GL_PRESERVE_ATI   0x8762 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 619 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CVertexBufferHardGLATI::unlock().

+

+ + + + +
+ + +
#define GL_PREVIOUS_ARB   0x8578 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 377 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PREVIOUS_TEXTURE_INPUT_NV   0x86E4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 428 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::resetTextureShaders().

+

+ + + + +
+ + +
#define GL_PRIMARY_COLOR_ARB   0x8577 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 376 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_ALU_INSTRUCTIONS_ARB   0x8805 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 884 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_ATTRIBS_ARB   0x88AC +
+
+ + + + + +
+   + + +

+ +

+Definition at line 877 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_BINDING_ARB   0x8677 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 863 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_ERROR_POSITION_ARB   0x864B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 898 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::loadARBFragmentProgramStringNative().

+

+ + + + +
+ + +
#define GL_PROGRAM_ERROR_POSITION_NV   0x864B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 104 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::activeNVVertexProgram().

+

+ + + + +
+ + +
#define GL_PROGRAM_ERROR_STRING_ARB   0x8874 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 906 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_FORMAT_ARB   0x8876 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 862 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_FORMAT_ASCII_ARB   0x8875 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 860 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::loadARBFragmentProgramStringNative().

+

+ + + + +
+ + +
#define GL_PROGRAM_INSTRUCTIONS_ARB   0x88A0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 864 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_LENGTH_ARB   0x8627 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 861 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_LENGTH_NV   0x8627 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 76 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_NATIVE_ALU_INSTRUCTIONS_ARB   0x8808 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 887 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_NATIVE_ATTRIBS_ARB   0x88AE +
+
+ + + + + +
+   + + +

+ +

+Definition at line 879 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_NATIVE_INSTRUCTIONS_ARB   0x88A2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 866 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_NATIVE_PARAMETERS_ARB   0x88AA +
+
+ + + + + +
+   + + +

+ +

+Definition at line 875 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_NATIVE_TEMPORARIES_ARB   0x88A6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 870 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_NATIVE_TEX_INDIRECTIONS_ARB   0x880A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 889 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_NATIVE_TEX_INSTRUCTIONS_ARB   0x8809 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 888 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_PARAMETER_NV   0x8644 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 97 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_PARAMETERS_ARB   0x88A8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 873 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_RESIDENT_NV   0x8647 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 100 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_STRING_ARB   0x8628 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 897 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_STRING_NV   0x8628 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 77 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_TARGET_NV   0x8646 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 99 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_TEMPORARIES_ARB   0x88A4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 868 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_TEX_INDIRECTIONS_ARB   0x8807 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 886 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_TEX_INSTRUCTIONS_ARB   0x8806 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 885 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_PROGRAM_UNDER_NATIVE_LIMITS_ARB   0x88B6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 883 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::loadARBFragmentProgramStringNative().

+

+ + + + +
+ + +
#define GL_QUARTER_BIT_ATI   0x00000010 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 795 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_RED_BIT_ATI   0x00000001 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 788 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_0_ATI   0x8921 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 698 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::fetchPerturbedEnvMapR200(), and NL3D::CDriverGL::initFragmentShaders().

+

+ + + + +
+ + +
#define GL_REG_10_ATI   0x892B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 708 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_11_ATI   0x892C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 709 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_12_ATI   0x892D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 710 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_13_ATI   0x892E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 711 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_14_ATI   0x892F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 712 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_15_ATI   0x8930 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 713 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_16_ATI   0x8931 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 714 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_17_ATI   0x8932 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 715 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_18_ATI   0x8933 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 716 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_19_ATI   0x8934 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 717 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_1_ATI   0x8922 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 699 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::fetchPerturbedEnvMapR200().

+

+ + + + +
+ + +
#define GL_REG_20_ATI   0x8935 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 718 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_21_ATI   0x8936 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 719 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_22_ATI   0x8937 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 720 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_23_ATI   0x8938 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 721 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_24_ATI   0x8939 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 722 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_25_ATI   0x893A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 723 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_26_ATI   0x893B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 724 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_27_ATI   0x893C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 725 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_28_ATI   0x893D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 726 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_29_ATI   0x893E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 727 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_2_ATI   0x8923 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 700 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::fetchPerturbedEnvMapR200(), and NL3D::CDriverGL::initFragmentShaders().

+

+ + + + +
+ + +
#define GL_REG_30_ATI   0x893F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 728 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_31_ATI   0x8940 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 729 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_3_ATI   0x8924 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 701 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::initFragmentShaders().

+

+ + + + +
+ + +
#define GL_REG_4_ATI   0x8925 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 702 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_5_ATI   0x8926 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 703 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_6_ATI   0x8927 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 704 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_7_ATI   0x8928 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 705 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_8_ATI   0x8929 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 706 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_REG_9_ATI   0x892A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 707 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_RGB_SCALE_ARB   0x8573 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 372 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_RGBA_UNSIGNED_DOT_PRODUCT_MAPPING_NV   0x86D9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 414 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SATURATE_BIT_ATI   0x00000040 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 797 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SCALAR_EXT   0x87be +
+
+ + + + + +
+   + + +

+ +

+Definition at line 563 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_SECONDARY_INTERPOLATOR_ATI   0x896D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 773 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SHADER_CONSISTENT_NV   0x86DD +
+
+ + + + + +
+   + + +

+ +

+Definition at line 418 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SHADER_OPERATION_NV   0x86DF +
+
+ + + + + +
+   + + +

+ +

+Definition at line 420 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::resetTextureShaders(), and NL3D::CDriverGL::setTextureShaders().

+

+ + + + +
+ + +
#define GL_SIGNED_ALPHA8_NV   0x8706 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 459 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_ALPHA_NV   0x8705 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 458 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_HILO16_NV   0x86FA +
+
+ + + + + +
+   + + +

+ +

+Definition at line 449 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_HILO_NV   0x86F9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 448 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_INTENSITY8_NV   0x8708 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 461 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_INTENSITY_NV   0x8707 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 460 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_LUMINANCE8_ALPHA8_NV   0x8704 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 457 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_LUMINANCE8_NV   0x8702 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 455 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_LUMINANCE_ALPHA_NV   0x8703 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 456 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_LUMINANCE_NV   0x8701 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 454 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_RGB8_NV   0x86FF +
+
+ + + + + +
+   + + +

+ +

+Definition at line 453 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_RGB8_UNSIGNED_ALPHA8_NV   0x870D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 466 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_RGB_NV   0x86FE +
+
+ + + + + +
+   + + +

+ +

+Definition at line 452 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_RGB_UNSIGNED_ALPHA_NV   0x870C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 465 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_RGBA8_NV   0x86FC +
+
+ + + + + +
+   + + +

+ +

+Definition at line 451 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SIGNED_RGBA_NV   0x86FB +
+
+ + + + + +
+   + + +

+ +

+Definition at line 450 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SOURCE0_ALPHA_ARB   0x8588 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 363 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SOURCE0_RGB_ARB   0x8580 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 360 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SOURCE1_ALPHA_ARB   0x8589 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 364 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SOURCE1_RGB_ARB   0x8581 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 361 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SOURCE2_ALPHA_ARB   0x858A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 365 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SOURCE2_RGB_ARB   0x8582 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 362 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_STATIC_ATI   0x8760 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 617 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CVertexArrayRangeMapObjectATI::allocate(), NL3D::CVertexArrayRangeATI::allocate(), and NL3D::CVertexArrayRangeMapObjectATI::createVBHardGL().

+

+ + + + +
+ + +
#define GL_SUB_ATI   0x8965 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 765 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SUBTRACT_ARB   0x84E7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 378 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SWIZZLE_STQ_ATI   0x8977 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 783 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SWIZZLE_STQ_DQ_ATI   0x8979 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 785 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SWIZZLE_STR_ATI   0x8976 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 782 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::fetchPerturbedEnvMapR200(), and NL3D::CDriverGL::initFragmentShaders().

+

+ + + + +
+ + +
#define GL_SWIZZLE_STR_DR_ATI   0x8978 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 784 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SWIZZLE_STRQ_ATI   0x897A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 786 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_SWIZZLE_STRQ_DQ_ATI   0x897B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 787 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TEXTURE_BORDER_VALUES_NV   0x871A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 479 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TEXTURE_DS_SIZE_NV   0x871D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 482 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TEXTURE_DT_SIZE_NV   0x871E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 483 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TEXTURE_HI_SIZE_NV   0x871B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 480 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TEXTURE_LO_SIZE_NV   0x871C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 481 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TEXTURE_MAG_SIZE_NV   0x871F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 484 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TEXTURE_SHADER_NV   0x86DE +
+
+ + + + + +
+   + + +

+ +

+Definition at line 419 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::enableNVTextureShader(), NL3D::CDriverGL::resetTextureShaders(), NL3D::CDriverGL::setMatrix2DForTextureOffsetAddrMode(), NL3D::CDriverGL::setTextureShaders(), NL3D::CDriverGL::setupWaterPassNV20(), and NL3D::CDriverGL::swapBuffers().

+

+ + + + +
+ + +
#define GL_TRACK_MATRIX_NV   0x8648 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 101 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TRACK_MATRIX_TRANSFORM_NV   0x8649 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 102 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TRANSPOSE_CURRENT_MATRIX_ARB   0x88B7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 900 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_TRANSPOSE_NV   0x862C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 81 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_UNSIGNED_INT_8_8_S8_S8_REV_NV   0x86DB +
+
+ + + + + +
+   + + +

+ +

+Definition at line 416 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_UNSIGNED_INT_S8_S8_8_8_NV   0x86DA +
+
+ + + + + +
+   + + +

+ +

+Definition at line 415 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VARIANT_ARRAY_EXT   0x87e8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 497 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VARIANT_ARRAY_POINTER_EXT   0x87e9 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 498 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VARIANT_ARRAY_STRIDE_EXT   0x87e6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 495 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VARIANT_ARRAY_TYPE_EXT   0x87e7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 496 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VARIANT_DATATYPE_EXT   0x87e5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 494 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VARIANT_EXT   0x87c1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 566 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_VARIANT_VALUE_EXT   0x87e4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 493 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VECTOR_EXT   0x87bf +
+
+ + + + + +
+   + + +

+ +

+Definition at line 564 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_VERTEX_ARRAY_RANGE_WITHOUT_FLUSH_NV   0x8533 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 611 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::registerGlExtensions().

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY0_NV   0x8650 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 105 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGLStates::enableVertexAttribArray().

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY10_NV   0x865A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 115 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY11_NV   0x865B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 116 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY12_NV   0x865C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 117 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY13_NV   0x865D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 118 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY14_NV   0x865E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 119 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY15_NV   0x865F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 120 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY1_NV   0x8651 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 106 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY2_NV   0x8652 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 107 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY3_NV   0x8653 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 108 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY4_NV   0x8654 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 109 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY5_NV   0x8655 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 110 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY6_NV   0x8656 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 111 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY7_NV   0x8657 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 112 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY8_NV   0x8658 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 113 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_ATTRIB_ARRAY9_NV   0x8659 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 114 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_PROGRAM_BINDING_NV   0x864A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 103 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_PROGRAM_NV   0x8620 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 70 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::activeNVVertexProgram(), NL3D::CDriverGL::setConstant(), and NL3D::CDriverGL::setConstantMatrix().

+

+ + + + +
+ + +
#define GL_VERTEX_PROGRAM_POINT_SIZE_NV   0x8642 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 95 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_PROGRAM_TWO_SIDE_NV   0x8643 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 96 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::enableVertexProgramDoubleSidedColor().

+

+ + + + +
+ + +
#define GL_VERTEX_SHADER_BINDING_EXT   0x8781 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 585 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_SHADER_EXT   0x8780 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 492 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::activeEXTVertexShader().

+

+ + + + +
+ + +
#define GL_VERTEX_SHADER_INSTRUCTIONS_EXT   0x87cf +
+
+ + + + + +
+   + + +

+ +

+Definition at line 580 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_SHADER_INVARIANTS_EXT   0x87d1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 582 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_SHADER_LOCAL_CONSTANTS_EXT   0x87d2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 583 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_SHADER_LOCALS_EXT   0x87d3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 584 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_SHADER_OPTIMIZED_EXT   0x87d4 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 586 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_VERTEX_SHADER_VARIANTS_EXT   0x87d0 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 581 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VERTEX_STATE_PROGRAM_NV   0x8621 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 71 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VIBRANCE_BIAS_NV   0x8719 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 478 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_VIBRANCE_SCALE_NV   0x8713 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 472 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define GL_W_EXT   0x87d8 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 590 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convSwizzleToGLFormat(), NL3D::doSwizzle(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_X_EXT   0x87d5 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 587 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convSwizzleToGLFormat(), NL3D::doSwizzle(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_Y_EXT   0x87d6 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 588 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convSwizzleToGLFormat(), NL3D::doSwizzle(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_Z_EXT   0x87d7 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 589 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::convSwizzleToGLFormat(), NL3D::doSwizzle(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define GL_ZERO_EXT   0x87dd +
+
+ + + + + +
+   + + +

+ +

+Definition at line 595 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::doSwizzle(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
#define WGL_ACCELERATION_ARB   0x2003 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 291 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_ACCUM_ALPHA_BITS_ARB   0x2021 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 325 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_ACCUM_BITS_ARB   0x201D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 321 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_ACCUM_BLUE_BITS_ARB   0x2020 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 324 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_ACCUM_GREEN_BITS_ARB   0x201F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 323 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_ACCUM_RED_BITS_ARB   0x201E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 322 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_ALPHA_BITS_ARB   0x201B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 319 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define WGL_ALPHA_SHIFT_ARB   0x201C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 320 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_ARB_pbuffer   1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 340 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_ARB_pixel_format   1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 287 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_AUX_BUFFERS_ARB   0x2024 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 328 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_BLUE_BITS_ARB   0x2019 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 317 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define WGL_BLUE_SHIFT_ARB   0x201A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 318 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_COLOR_BITS_ARB   0x2014 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 312 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_DEPTH_BITS_ARB   0x2022 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 326 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define WGL_DOUBLE_BUFFER_ARB   0x2011 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 309 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_DRAW_TO_BITMAP_ARB   0x2002 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 290 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_DRAW_TO_PBUFFER_ARB   0x202D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 341 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define WGL_DRAW_TO_WINDOW_ARB   0x2001 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 289 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_FULL_ACCELERATION_ARB   0x2027 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 331 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_GENERIC_ACCELERATION_ARB   0x2026 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 330 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_GREEN_BITS_ARB   0x2017 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 315 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define WGL_GREEN_SHIFT_ARB   0x2018 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 316 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_MAX_PBUFFER_HEIGHT_ARB   0x2030 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 344 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_MAX_PBUFFER_PIXELS_ARB   0x202E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 342 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_MAX_PBUFFER_WIDTH_ARB   0x202F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 343 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_NEED_PALETTE_ARB   0x2004 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 292 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_NEED_SYSTEM_PALETTE_ARB   0x2005 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 293 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_NO_ACCELERATION_ARB   0x2025 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 329 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_NUMBER_OVERLAYS_ARB   0x2008 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 296 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_NUMBER_PIXEL_FORMATS_ARB   0x2000 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 288 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_NUMBER_UNDERLAYS_ARB   0x2009 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 297 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_PBUFFER_HEIGHT_ARB   0x2035 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 347 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::getWindowSize(), and NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define WGL_PBUFFER_LARGEST_ARB   0x2033 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 345 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_PBUFFER_LOST_ARB   0x2036 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 348 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_PBUFFER_WIDTH_ARB   0x2034 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 346 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::getWindowSize(), and NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define WGL_PIXEL_TYPE_ARB   0x2013 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 311 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_RED_BITS_ARB   0x2015 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 313 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
#define WGL_RED_SHIFT_ARB   0x2016 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 314 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SHARE_ACCUM_ARB   0x200E +
+
+ + + + + +
+   + + +

+ +

+Definition at line 306 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SHARE_DEPTH_ARB   0x200C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 304 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SHARE_STENCIL_ARB   0x200D +
+
+ + + + + +
+   + + +

+ +

+Definition at line 305 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_STENCIL_BITS_ARB   0x2023 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 327 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_STEREO_ARB   0x2012 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 310 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SUPPORT_GDI_ARB   0x200F +
+
+ + + + + +
+   + + +

+ +

+Definition at line 307 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SUPPORT_OPENGL_ARB   0x2010 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 308 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SWAP_COPY_ARB   0x2029 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 333 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SWAP_EXCHANGE_ARB   0x2028 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 332 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SWAP_LAYER_BUFFERS_ARB   0x2006 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 294 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SWAP_METHOD_ARB   0x2007 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 295 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_SWAP_UNDEFINED_ARB   0x202A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 334 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_TRANSPARENT_ALPHA_VALUE_ARB   0x203A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 302 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_TRANSPARENT_ARB   0x200A +
+
+ + + + + +
+   + + +

+ +

+Definition at line 298 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_TRANSPARENT_BLUE_VALUE_ARB   0x2039 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 301 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_TRANSPARENT_GREEN_VALUE_ARB   0x2038 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 300 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_TRANSPARENT_INDEX_VALUE_ARB   0x203B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 303 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_TRANSPARENT_RED_VALUE_ARB   0x2037 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 299 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_TYPE_COLORINDEX_ARB   0x202C +
+
+ + + + + +
+   + + +

+ +

+Definition at line 336 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
#define WGL_TYPE_RGBA_ARB   0x202B +
+
+ + + + + +
+   + + +

+ +

+Definition at line 335 of file driver_opengl_extension_def.h.

+


Typedef Documentation

+

+ + + + +
+ + +
typedef GLenum GLuint void * addr +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1127 of file driver_opengl_extension_def.h. +

+Referenced by NLNET::CListenSock::accept(), NLNET::CNetManager::addClient(), NLNET::CNetManager::addServer(), NLNET::CUnifiedNetwork::addService(), NLNET::CUdpSock::bind(), NLNET::cbRegisterBroadcast(), NLNET::CBufferizedOutPacket::CBufferizedOutPacket(), NLNET::CLoginCookie::CLoginCookie(), NLNET::CUdpSimSock::connect(), NLNET::CTcpSock::connect(), NLNET::CNamingClient::connect(), NLNET::CDummyTcpSock::connect(), NLNET::CCallbackClient::connect(), NLNET::CBufSock::connect(), NLNET::CBufClient::connect(), NLNET::CLoginClient::connectToShard(), NLNET::CTcpSock::connectWithCustomWindowSize(), NLNET::CUdpSimSock::dataAvailable(), NLNET::ESocketConnectionFailed::ESocketConnectionFailed(), NLNET::CUnifiedNetwork::init(), NLNET::CNetManager::init(), NLNET::CListenSock::init(), NLNET::internalIPAddressToString(), NLNET::CNamingClient::lookup(), NLNET::CNamingClient::lookupAlternate(), NLNET::CUdpSock::receivedFrom(), NLNET::CNamingClient::registerService(), NLNET::CNamingClient::registerServiceWithSId(), NLNET::RegistrationBroadcast(), NLNET::CMessageRecorder::replayConnectionAttempt(), NLNET::CNamingClient::resendRegisteration(), NLNET::CUdpSock::sendTo(), NLNET::CUdpSimSock::sendTo(), NLNET::CUdpSimSock::sendUDP(), NLNET::CUdpSimSock::sendUDPNow(), NLNET::stringToInternalIPAddress(), NLNET::_CUniTime::syncUniTimeFromService(), NLNET::uNetRegistrationBroadcast(), NLNET::uNetUnregistrationBroadcast(), and NLNET::UnregistrationBroadcast().

+

+ + + + +
+ + +
typedef GLuint address +
+
+ + + + + +
+   + + +

+ +

+Definition at line 229 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLclampf GLclampf GLclampf alpha +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1173 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::computeGradient(), NLMISC::CBitmap::decompressDXT1(), NLMISC::CBitmap::decompressDXT3(), NLMISC::CBitmap::decompressDXT5(), NLSOUND::CSourceDSound::fadeIn(), NLSOUND::CSourceDSound::fadeOut(), NL3D::CPatch::getTileUvInfo(), NL3D::CTessFace::initTileUvRGBA(), NLSOUND::CClusteredSound::interpolateSourceDirection(), NL3D_drawFarTileInFarTextureAdditiveAlpha(), NL3D_drawFarTileInFarTextureAlpha(), NL3D::CPSZoneRectangle::performMotion(), NL3D::CPSZoneDisc::performMotion(), NL3D::CPSZoneSphere::performMotion(), NL3D::CPSZonePlane::performMotion(), NL3D::PSValueBlend(), NL3D::CNoise3d::render2passes(), NL3D::CMeshMultiLod::renderMeshGeom(), RenderTriangle(), NL3D::CTile::serial(), NL3D::CTileFarBank::CTileFar::setPixels(), NL3D::CPSValueBlendSampleFunc< NLMISC::CRGBA, n >::setValues(), NLSOUND::CClusteredSound::soundTraverse(), and NLSOUND::CSourceDSound::xfade().

+

+ + + + +
+ + +
typedef GLuint GLuint arg1 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1119 of file driver_opengl_extension_def.h. +

+Referenced by NLMISC::CEvalNumExpr::evalExpression(), NLMISC::CEvalNumExpr::evalFunction(), NL3D::PSBinOpAdd(), NL3D::PSBinOpModulate(), and NL3D::PSBinOpSubtract().

+

+ + + + +
+ + +
typedef GLuint GLuint GLuint arg2 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1120 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::PSBinOpAdd(), NL3D::PSBinOpModulate(), and NL3D::PSBinOpSubtract().

+

+ + + + +
+ + +
typedef GLuint GLuint GLuint GLuint arg3 +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1121 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLclampf GLclampf blue +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1152 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLint GLenum GLsizei GLint border +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1013 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CTileBorder::allAlphaSet(), NL3D::CTileSet::checkTile128(), NL3D::CTileSet::checkTile256(), NL3D::CTileSet::checkTileTransition(), NLPACS::computeSurfaceBorders(), NLPACS::CRetrieverInstance::forceBorderChainLink(), NL3D::CTileSet::getComplementaryBorder(), NL3D::CTileSet::getInvertBorder(), NL3D::CTileSet::getOrientedBorder(), NL3D::CTileBorder::operator=(), NL3D::CTileBorder::operator==(), NLPACS::CLocalRetriever::replaceChain(), NL3D::CTileSet::setBorder(), NL3D::CTileSet::setTileTransition(), NL3D::CTileSet::setTileTransitionAlpha(), and NL3D::CWaterHeightMap::setWaves().

+

+ + + + +
+ + +
typedef GLenum GLsizei GLuint buffer +
+
+ + + + + +
+   + + +

+ +

+Definition at line 649 of file driver_opengl_extension_def.h. +

+Referenced by NLNET::CBufSock::advertiseSystemEvent(), NLMISC::CHeapAllocator::allocate(), NLAILOGIC::CFirstOrderOperator::backward(), NLAILOGIC::CFirstOrderAssert::backward(), NLSOUND::CSoundBank::bufferLoaded(), NLSOUND::CAudioMixerUser::bufferUnloaded(), NL3D::CMeshMRMSkinnedGeom::CPackedVertexBuffer::build(), NLSOUND::CAudioMixerUser::buildSampleBankList(), NLMISC::CFile::checkFileChange(), NL3D::CPatch::computeTileLightmapPrecomputed(), NLSOUND::ISoundDriver::createDriver(), NL3D::CDRU::createGlDriver(), NLNET::CUdpSimSock::dataAvailable(), NLNET::CBufServer::dataAvailable(), NLNET::CBufClient::dataAvailable(), NL3D::CTextContextUser::deleteRenderBuffer(), NLPACS::CLocalRetriever::dumpSurface(), NLLIGO::Error(), NLLIGO::CLigoConfig::errorMessage(), NL3D::CTextContextUser::flushRenderBuffer(), NL3D::CTextContextUser::flushRenderBufferUnProjected(), NLAILOGIC::CFirstOrderOperator::forward(), NLMISC::CBufFIFO::front(), NLSOUND::CSampleBank::get(), NLMISC::CHeapAllocator::getAllocatedSystemMemory(), NLAIAGENT::CComponentHandle::getComponent(), NLAISCRIPT::CAgentClass::getComponentIndex(), NLMISC::CPath::getCurrentPath(), NLSOUND::CSimpleSound::getDuration(), NLAISCRIPT::CAgentClass::getInheritedStaticMemberIndex(), NLMISC::CIFile::getline(), NLMEMORY::CHeapAllocator::getMainBlockSize(), NLMEMORY::CHeapAllocator::getName(), NLMISC::CSystemInfo::getOS(), getSHA1(), NL3D::CPatch::getTileLumelmapPrecomputed(), NLAIAGENT::CAgentOperation::isMember(), NLAILOGIC::CFirstOrderOperator::isValid(), NL3D::CWaterHeightMap::makeCpy(), NLMISC::CBufFIFO::push(), NLNET::CBufSock::pushBuffer(), NLNET::CBufServer::pushBufferToHost(), NLNET::CBufNetBase::pushMessageIntoReceiveQueue(), NLMISC::CI18N::readTextBuffer(), NLSOUND::CBufferDSound::readWavBuffer(), NLNET::CUdpSock::receive(), NLNET::CUdpSimSock::receive(), NLNET::CCallbackServer::receive(), NLNET::CCallbackClient::receive(), NLNET::CBufServer::receive(), NLNET::CBufClient::receive(), NLNET::CUdpSock::receivedFrom(), NLSOUND::CSoundBank::registerBufferAssoc(), NLSOUND::CAudioMixerUser::registerBufferAssoc(), NLSOUND::CSoundDriverDSound::removeBuffer(), NLSOUND::CSoundDriverAL::removeBuffer(), CAutomataDesc::removeSpaces(), NLPACS::CGlobalRetriever::CLrLoader::run(), NLSOUND::CAsyncFileManagerSound::CLoadWavFile::run(), NLAIAGENT::CCancelGoalMsg::runMethodeMember(), NLAIAGENT::CGoalMsg::runMethodeMember(), NLAIAGENT::CGetValueMsg::runMethodeMember(), NLAIAGENT::CFactMsg::runMethodeMember(), NLAIAGENT::CFailureMsg::runMethodeMember(), NLAIAGENT::CSuccessMsg::runMethodeMember(), NLNET::CUdpSimSock::send(), NLNET::CNetManager::send(), NLNET::CCallbackServer::send(), NLNET::CCallbackClient::send(), NLNET::CBufServer::send(), NLNET::CBufClient::send(), NLNET::sendEmail(), NLNET::sendEMailCommand(), NLNET::CUdpSock::sendTo(), NLNET::CUdpSimSock::sendTo(), NLNET::CUdpSimSock::sendUDP(), NLNET::CUdpSimSock::sendUDPNow(), NLSOUND::CSimpleSound::setBuffer(), NLSOUND::ILoader::setBuffer(), NL3D::CTileLumel::CStreamBit::setPtr(), NLSOUND::CSourceDSound::setStaticBuffer(), NLSOUND::CSourceAL::setStaticBuffer(), NLMISC::smprintf(), NLLIGO::CLigoConfig::syntaxError(), NLSOUND::CSampleBank::unload(), NLSOUND::CSoundBank::unregisterBufferAssoc(), NLSOUND::CAudioMixerUser::unregisterBufferAssoc(), NLGEORGES::CType::warning(), NLGEORGES::CFileHeader::warning(), NLGEORGES::CFormLoader::warning(), NLGEORGES::CFormElmAtom::warning(), NLGEORGES::CFormElmArray::warning(), NLGEORGES::CFormElmVirtualStruct::warning(), NLGEORGES::CFormElmStruct::warning(), NLGEORGES::CFormElm::warning(), NLGEORGES::CFormDfn::warning(), NLGEORGES::CForm::warning(), NLGEORGES::warning(), NLGEORGES::CType::warning2(), NLLIGO::XMLError(), and NLMISC::xmlOutputWriteCallbackForNeL().

+

+ + + + +
+ + +
typedef GLenum cap +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1137 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLenum GLenum GLuint components +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1126 of file driver_opengl_extension_def.h. +

+Referenced by NLAISCRIPT::CAgentClass::buildChildsMessageMap(), NLAISCRIPT::COperatorClass::buildNewInstance(), NLAISCRIPT::COnChangeMsgClass::buildNewInstance(), NLAISCRIPT::CFactMsgClass::buildNewInstance(), NLAISCRIPT::CCancelGoalMsgClass::buildNewInstance(), NLAISCRIPT::CGoalMsgClass::buildNewInstance(), NLAISCRIPT::CMsgNotifyParentClass::buildNewInstance(), NLAISCRIPT::CMessageClass::buildNewInstance(), NLAISCRIPT::CAgentClass::buildNewInstance(), NLAISCRIPT::CSetValueMsgClass::buildNewInstance(), NLAISCRIPT::CGetValueMsgClass::buildNewInstance(), NLAISCRIPT::CFailureMsgClass::buildNewInstance(), NLAISCRIPT::CSuccessMsgClass::buildNewInstance(), NLAISCRIPT::CSeqFsmClass::buildNewInstance(), NLAISCRIPT::CFsmClass::buildNewInstance(), NLAISCRIPT::CActorClass::buildNewInstance(), NLAIAGENT::CActorScript::CActorScript(), NLAIAGENT::CAgentScript::CAgentScript(), NLAIAGENT::CFsmScript::CFsmScript(), NLAILOGIC::CGoalPath::CGoalPath(), NLAIAGENT::CMessageScript::CMessageScript(), NLAIAGENT::COperatorScript::COperatorScript(), NLAIAGENT::CAgentScript::createComponents(), and NLAIAGENT::CSeqFsmScript::CSeqFsmScript().

+

+ + + + +
+ + +
typedef GLenum condition +
+
+ + + + + +
+   + + +

+ +

+Definition at line 405 of file driver_opengl_extension_def.h. +

+Referenced by NLLOGIC::CLogicStateMachine::addCondition(), NLNET::CBufSock::advertiseSystemEvent(), NLLOGIC::CLogicState::fillVarMap(), NLLOGIC::CLogicConditionLogicBlock::fillVarSet(), and NLLOGIC::CLogicConditionLogicBlock::testLogic().

+

+ + + + +
+ + +
typedef GLenum coord +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1134 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLsizei count +
+
+ + + + + +
+   + + +

+ +

+Definition at line 240 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CScene::animate(), NL3D::CMeshBase::applyMaterialUsageOptim(), NL3D::CMeshMRMSkinnedGeom::CLod::buildPrimitiveBlock(), NL3D::CZoneLighter::buildZoneInformation(), NL3D::CTileSet::checkTileTransition(), NL3D::CTileSet::cleanUnusedData(), NL3D::CPatchDLMContext::clearLighting(), NLAISCRIPT::COperandSimpleListOr::COperandSimpleListOr(), NLGEORGES::CFormDfn::countParentDfn(), NLMISC::CSString::countWordOrWords(), NLMISC::CSString::countWords(), NLAISCRIPT::CParam::CParam(), NLSOUND::CAudioMixerUser::createSource(), NLAISCRIPT::CStackPointer::CStackPointer(), NLMISC::CHeapAllocator::debugStatisticsReport(), NL3D::CPatch::decRefDLMContext(), NL3D::CTileSet::deleteBordersIfLast(), NLMISC::CStdDisplayer::doDisplay(), NLSOUND::CSourceDSound::fadeIn(), NLSOUND::CSourceDSound::fadeOut(), NL3D::CMeshMultiLod::getAABBox(), NLAIAGENT::CIndexVariant< T, indexMax, maxT >::getDebugString(), NL3D::CTileSet::getExistingTransitionTile(), NLNET::CUnifiedNetwork::getNetBase(), NL3D::CFlareShape::getNumTriangles(), NL3D::CMeshMRMSkinnedGeom::CLod::getRdrPassPrimitiveBlock(), NL3D::CTileSet::getTransitionTile(), NL3D::CPSLocated::getUserMatrixUsageCount(), NL3D::CPointLightNamedArray::initAnimatedLightIndex(), NL3D::CMeshBaseInstance::initAnimatedLightIndex(), NL3D::IntegrateSpeed(), NLAIAGENT::isTemplateMember(), NLMISC::CSString::left(), NLMISC::CSString::leftCrop(), NLAISCRIPT::CCodeBrancheRun::load(), NL3D::CZoneLighter::makeQuadGridFromWaterShapes(), NLLIGO::IPrimitive::read(), NL3D::IAnimatable::resize(), NLMISC::CSString::right(), NLMISC::CSString::rightCrop(), NLAISCRIPT::CCodeBrancheRun::save(), NLAIAGENT::CIndexedVarName::saveClass(), NL3D::CTileSet::serial(), NL3D::CScene::setAutomaticAnimationSet(), STRING_MANAGER::TWorksheet::setColCount(), setCPUMask(), NL3D::CPSEmitter::setMaxEmissionCount(), NL3D::CPointLightNamedArray::setPointLightFactor(), NLMISC::smprintf(), NL3D::CWaterModel::traverseRender(), NLSOUND::CBackgroundSoundManager::updateBackgroundStatus(), NLLIGO::IPrimitive::updateChildId(), NL3D::CAnimatedLightmap::updateGroupColors(), NLMISC::CSString::word(), NLMISC::CSString::wordOrWords(), and NLSOUND::CSourceDSound::xfade().

+

+ + + + +
+ + +
typedef GLenum GLfloat * data +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1013 of file driver_opengl_extension_def.h. +

+Referenced by NLSOUND::CAudioMixerUser::buildSampleBankList(), NLNET::cbnbNewDisconnection(), NLNET::cbsNewConnection(), NL3D::CHLSTextureBank::compilePtrs(), NL3D::CTextureMem::CTextureMem(), NL3D::CWaterModel::doSimpleRender(), NLMISC::EInvalidDataStream::EInvalidDataStream(), NLSOUND::CSourceDSound::fillData(), NLAISCRIPT::CCompilateur::getValidateHierarchyBase(), NLSOUND::CSampleBank::load(), NLSOUND::CSoundDriverAL::loadWavFile(), NL3D::CLandscapeVBAllocator::lockBuffer(), and NL3D::CTextureMem::setPointer().

+

+ + + + +
+ + +
typedef GLint GLint GLint GLint GLsizei GLsizei GLsizei depth +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1013 of file driver_opengl_extension_def.h. +

+Referenced by NLMISC::CHTimer::CExamStackEntry::CExamStackEntry(), NLMISC::CHTimer::displayHierarchical(), NLMISC::CHTimer::displaySummary(), H_AUTO_DECL(), NLMISC::CBitmap::load(), NLMISC::CBitmap::loadSize(), NL3D::CTextContextUser::printClipAtUnProjected(), NL3D::CTextContext::printClipAtUnProjected(), NLMISC::CBitmap::readTGA(), NL3D::CComputedString::render2DUnProjected(), NL3D::CSceneUser::setShadowMapMaxDepth(), NL3D::CScene::setShadowMapMaxDepth(), NLNET::CPacsClient::setSize(), NLPACS::CMovePrimitive::setSize(), and NLMISC::CBitmap::writeTGA().

+

+ + + + +
+ + +
typedef GLuint * fences +
+
+ + + + + +
+   + + +

+ +

+Definition at line 399 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLint GLint GLsizei GLenum format +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1016 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CVegetableShape::build(), NLMISC::CLog::display(), NLMISC::CHTimer::display(), NLMISC::CHTimer::displayByExecutionPath(), NLMISC::CLog::displayNL(), NLMISC::CLog::displayRaw(), NLMISC::CLog::displayRawNL(), NLMISC::EInvalidDataStream::EInvalidDataStream(), NLLIGO::Error(), NLLIGO::CLigoConfig::errorMessage(), NLSOUND::ESoundFileNotFound::ESoundFileNotFound(), NLMISC::Exception::Exception(), NLMISC::CLog::forceDisplayRaw(), NLSOUND::CBufferDSound::getFormat(), NLSOUND::CBufferAL::getFormat(), NL3D::CPSConstraintMesh::CMeshDisplayShare::getMeshDisplay(), NLSOUND::CSourceDSound::getPitch(), NLSOUND::CSourceDSound::getTime(), NLSOUND::CSourceDSound::init(), NLSOUND::CSoundDriverDSound::init(), NLAISCRIPT::CCallPrint::isMember(), NLSOUND::CSoundDriverAL::loadWavFile(), NLMISC::nlError(), NLMISC::nlFatalError(), NL3D::CTextContextUser::printfAt(), NL3D::CTextContext::printfAt(), NLSOUND::CSoundDriverDSound::readRawBuffer(), NLSOUND::CSoundDriverAL::readRawBuffer(), NLSOUND::CBufferDSound::readRawBuffer(), NLNET::CMessage::readType(), NLNET::CMessage::readTypeAtCurrentPos(), NLSOUND::CBufferDSound::readWavBuffer(), NL3D::CTextContextUser::render3D(), NLNET::sendAdminEmail(), NLSOUND::CBufferDSound::setFormat(), NLSOUND::CBufferAL::setFormat(), NLSOUND::CSourceDSound::setPitch(), NLNET::CMessage::setType(), NLMISC::smprintf(), NLLIGO::CLigoConfig::syntaxError(), NL3D::CTextContextUser::textPush(), NL3D::CTextContext::textPush(), NLMISC::toString(), NLGEORGES::CType::warning(), NLGEORGES::CFileHeader::warning(), NLGEORGES::CFormLoader::warning(), NLGEORGES::CFormElmAtom::warning(), NLGEORGES::CFormElmArray::warning(), NLGEORGES::CFormElmVirtualStruct::warning(), NLGEORGES::CFormElmStruct::warning(), NLGEORGES::CFormElm::warning(), NLGEORGES::CFormDfn::warning(), NLGEORGES::CForm::warning(), NLGEORGES::warning(), NLGEORGES::CType::warning2(), and NLLIGO::XMLError().

+

+ + + + +
+ + +
typedef GLint fsize +
+
+ + + + + +
+   + + +

+ +

+Definition at line 244 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLclampf green +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1152 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLint GLint GLint GLsizei GLsizei height +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1013 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CTextureFar::allocatePatch(), NLMISC::CBitmap::blit(), NL3D::CLodCharacterTmpBitmap::build(), NL3D::CCoarseMeshBuild::buildBitmap(), NL3D::BuildDsDt(), NL3D::BuildDsDtAsRGBA(), NL3D::CZoneLighter::calcSkyContribution(), NL3D::CWaterHeightMap::clearArea(), NL3D::CWaterHeightMap::clearZone(), NL3D::CDriverGL::clipRect(), NL3D::CFontManager::computeString(), NL3D::CFontManager::computeStringInfo(), NL3D::CDriverGL::copyFrameBufferToTexture(), NLMISC::CRect::CRect(), NL3D::CScissor::CScissor(), NL3D::CTextureDLM::CTextureDLM(), NL3D::CTextureMem::CTextureMem(), NLMISC::CBitmap::decompressDXT1(), NLMISC::CBitmap::decompressDXT3(), NLMISC::CBitmap::decompressDXT5(), NL3D::CTextureGrouped::doGenerate(), NL3D::CTextureEmboss::doGenerate(), NL3D::CTextureBump::doGenerate(), draw2dLine(), NL3D::CDRU::drawBitmap(), NL3D::CDriverUser::drawBitmap(), NL3D::CPatch::evalLumelBlock(), NL3D::CCoarseMeshBuild::expand(), NL3D::CLandscape::freeFarRenderPass(), NL3D::CTileBorder::get(), NL3D::CWaterModel::getAttenuatedHeight(), NL3D::CFontGenerator::getBitmap(), NL3D::CLandscape::getFarRenderPass(), NL3D::CTextureFar::getFreeListId(), NL3D::CMiniCol::getGroundNormal(), NL3D::CWaterModel::getHeight(), NL3D::CTextureFont::getLetterInfo(), NLLIGO::CZoneTemplate::getMask(), NL3D::CZoneLighter::getMaxPhi(), NL3D::CFontGenerator::getSizes(), NL3D::GetTextureSize(), NL3D::CTextureDLM::getTypeForSize(), NL3D::CTextureFar::getUpperSize(), NL3D::CViewport::getValues(), NL3D::CDriverUser::getWindowHeight(), NL3D::CDriverUser::getWindowSize(), NL3D::CDriverGL::getWindowSize(), NL3D::CDriverUser::getWindowWidth(), H_AUTO_DECL(), NL3D::CViewport::init(), NL3D::CScissor::init(), NL3D::CFrustum::init(), NL3D::CZoneLighter::lightWater(), NLMISC::CBitmap::load(), NLMISC::CBitmap::loadSize(), NL3D::CWaterHeightMap::makeCpy(), NL3D::CZoneLighter::makeQuadGridFromWaterShapes(), NL3D::NormalizeDsDt(), NL3D::NormalizeDsDtAsRGBA(), NL3D::CHeatHaze::performHeatHaze(), NL3D::CMotionBlur::performMotionBlur(), NLMISC::CBitmap::readTGA(), NL3D::CTextureFar::removePatch(), RenderTriangle(), NLMISC::ScanEdge(), NLMISC::ScanInnerEdge(), NLMISC::ScanOuterEdgeLeft(), NLMISC::ScanOuterEdgeRight(), NL3D::CTileBorder::set(), NL3D::CHLSColorTexture::setBitmap(), NL3D::CDriverGL::setDisplay(), NL3D::CTravCameraScene::setFrustum(), NL3D::CCameraUser::setFrustum(), NL3D::CCamera::setFrustum(), NLNET::CPacsClient::setHeight(), NLPACS::CMovePrimitive::setHeight(), NL3D::CTextureMem::setPointer(), NL3D::CDeform2d::setupBuffer(), NL3D::CDriverGL::setupScissor(), NL3D::CDriverGL::setupViewport(), NLMISC::CRect::setWH(), NL3D::CMiniCol::snapToGround(), NL3D::CMotionBlur::startMotionBlur(), NL3D::CTextureFar::touchPatchULAndNext(), NL3D::CFlareModel::traverseRender(), NL3D::CTextureFar::tryAllocatePatch(), and NLMISC::CBitmap::writeTGA().

+

+ + + + +
+ + +
typedef GLuint id +
+
+ + + + + +
+   + + +

+ +

+Definition at line 221 of file driver_opengl_extension_def.h. +

+Referenced by NLAISCRIPT::CCompilateur::buildObject(), NLAISCRIPT::CActorClass::CActorClass(), NLAIAGENT::CAgentNumber::CAgentNumber(), NLAISCRIPT::CCompilateur::castVariable(), NLAISCRIPT::CCancelGoalMsgClass::CCancelGoalMsgClass(), NLAISCRIPT::CFactMsgClass::CFactMsgClass(), NLAISCRIPT::CFailureMsgClass::CFailureMsgClass(), NLAISCRIPT::CFsmClass::CFsmClass(), NLAISCRIPT::CGetValueMsgClass::CGetValueMsgClass(), NLAISCRIPT::CGoalMsgClass::CGoalMsgClass(), NLAIAGENT::CIdent::CIdent(), NLAISCRIPT::CLibCallInheritedMethod::CLibCallInheritedMethod(), NLAISCRIPT::CLibCallMethod::CLibCallMethod(), NLAISCRIPT::CLibCallMethodi::CLibCallMethodi(), NLAISCRIPT::CLibHeapMemberMethod::CLibHeapMemberMethod(), NLAISCRIPT::CLibMemberInheritedMethod::CLibMemberInheritedMethod(), NLAISCRIPT::CLibMemberMethod::CLibMemberMethod(), NLAISCRIPT::CLibMemberMethodi::CLibMemberMethodi(), NLAISCRIPT::CLibStackMemberMethod::CLibStackMemberMethod(), NLAISCRIPT::CLibStackNewMemberMethod::CLibStackNewMemberMethod(), NLAIAGENT::CLocWordNumRef::CLocWordNumRef(), NLNET::CLoginCookie::CLoginCookie(), NLAISCRIPT::CManagerClass::CManagerClass(), NLAISCRIPT::CMessageClass::CMessageClass(), NLAISCRIPT::CMsgNotifyParentClass::CMsgNotifyParentClass(), NLAIAGENT::CNumericIndex::CNumericIndex(), NLAIAGENT::CObjectIdent::CObjectIdent(), NLAISCRIPT::COnChangeMsgClass::COnChangeMsgClass(), NLAISCRIPT::COperatorClass::COperatorClass(), NLAISCRIPT::CAgentClass::createComponents(), NLSOUND::CAudioMixerUser::createSource(), NLAIC::CRegistry::CRegistryClass::CRegistryClass(), NLNET::CRequest::CRequest(), NLAISCRIPT::CSeqFsmClass::CSeqFsmClass(), NLAISCRIPT::CSetValueMsgClass::CSetValueMsgClass(), NLSOUND::CSoundAnimation::CSoundAnimation(), NLSOUND::CSourceCommon::CSourceCommon(), NLAISCRIPT::CSuccessMsgClass::CSuccessMsgClass(), NLAISCRIPT::CCompilateur::definClass(), NLAIC::CRegistry::getFactory(), NLAISCRIPT::CAgentClass::getStaticMember(), NLAILINK::IOTrace::getType(), NLAISCRIPT::CCompilateur::getTypeOfClass(), NLAISCRIPT::CCompilateur::getValidateHierarchyBase(), NLAISCRIPT::CCompilateur::RegisterClass(), NLAISCRIPT::CConstraintMethode::run(), and NLSOUND::TFindId::TFindId().

+

+ + + + +
+ + +
typedef GLint GLint GLsizei GLenum GLsizei imageSize +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1013 of file driver_opengl_extension_def.h. +

+Referenced by NLMISC::CBitmap::readTGA(), and NL3D::CDriverGL::uploadTexture().

+

+ + + + +
+ + +
typedef GLint void* img +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1019 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLuint in +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1122 of file driver_opengl_extension_def.h. +

+Referenced by NLPACS::CLocalRetriever::CIntersectionMarker::CIntersectionMarker(), NLMISC::CPolygon::clip(), NLMISC::CPlane::clipPolygonBack(), NLMISC::CPlane::clipPolygonFront(), NLPACS::CRetrieverBank::diff(), NL3D::doSwizzle(), NL3D::doWriteMask(), NLMISC::EFile::EFile(), NLMISC::ENewerStream::ENewerStream(), NLMISC::EOlderStream::EOlderStream(), NLMISC::EReadError::EReadError(), NLMISC::EWriteError::EWriteError(), NL3D::CMatrix3x4::mulAddPoint(), NL3D::CMatrix3x4::mulAddVector(), NL3D::CMatrix3x4::mulSetPoint(), NL3D::CMatrix3x4::mulSetVector(), NLMISC::CMatrix::operator *(), NLMISC::CMatrix::operator *=(), NL3D::CStripifier::optimizeTriangles(), NLPACS::CGlobalRetriever::refreshLrAround(), NLPACS::CGlobalRetriever::refreshLrAroundNow(), RenderTriangle(), and NL3D::uv2st().

+

+ + + + +
+ + +
typedef GLuint index +
+
+ + + + + +
+   + + +

+ +

+Definition at line 225 of file driver_opengl_extension_def.h. +

+Referenced by NLAIAGENT::CAgentWatchTimer::addAttrib(), NL3D::CTileSet::addTile128(), NL3D::CTileSet::addTile256(), NLAISCRIPT::CCompilateur::affectation(), NLSOUND::CSoundDriverAL::allocateNewItems(), applyArraySkinNormalT(), applyArraySkinTangentSpaceT(), NL3D::CShadowMapManager::applyFakeGaussianBlur(), NL3D::CMeshMRMGeom::applySkin(), NLMISC::CConfigFile::CVar::asDouble(), NLMISC::CConfigFile::CVar::asFloat(), NLMISC::CConfigFile::CVar::asInt(), NLMISC::CConfigFile::CVar::asString(), NLAILOGIC::CRule::backWard(), NL3D::CPSLocatedBindable::bounceOccured(), NL3D::CPSEmitter::bounceOccured(), NL3D::CPSZonePlane::buildBasis(), NL3D::CTextureMultiFile::buildNonSelectableVersion(), NL3D::CTextureCube::buildNonSelectableVersion(), NL3D::ITexture::buildNonSelectableVersion(), NL3D::CMeshMRMGeom::CLod::buildSkinVertexBlocks(), NL3D::BuildTriFromMB(), NL3D::CZoneLighter::buildZoneInformation(), NL3D::CAdvance1616Iterator< T, PT >::CAdvance1616Iterator(), NL3D::CAdvance1Iterator< T, PT >::CAdvance1Iterator(), NLMISC::CConcavePolygonsVertexDesc::CConcavePolygonsVertexDesc(), NLAIE::CExceptionIndexError::CExceptionIndexError(), NLAIE::CExceptionIndexHandeledError::CExceptionIndexHandeledError(), NLMISC::CPolygon::chain(), NLAIC::CIdentType::CIdentType(), NLAISCRIPT::CLibHeapMemberMethod::CLibHeapMemberMethod(), NL3D::CTransform::clipGetChild(), NL3D::CTransform::clipGetParent(), NLAIAGENT::CIndexedVarName::CNameStruc::CNameStruc(), NL3D::CPSLocated::collisionUpdate(), NL3D::CPSRibbonBase::computeHermitteCstSizeRibbon(), NL3D::CPSRibbonBase::computeHermitteRibbon(), NL3D::CPSRibbonBase::computeLinearCstSizeRibbon(), NL3D::CPSRibbonBase::computeLinearRibbon(), NL3D::CPSRibbonBase::computeRibbon(), NL3D::CTileBank::computeXRef(), NL3D::convInputRegisterToVBFlag(), NLSOUND::CSoundDriverAL::createItem(), NLAILOGIC::CValueSet::CValueSet(), NLMISC::CHeapAllocator::debugStatisticsReport(), NLSOUND::IBuffer::decodeADPCM(), NL3D::CPSRotated2DParticle::deleteAngle2DElement(), NL3D::CPSColoredParticle::deleteColorElement(), NL3D::CPSZoneRectangle::deleteElement(), NL3D::CPSZoneCylinder::deleteElement(), NL3D::CPSZoneDisc::deleteElement(), NL3D::CPSZoneSphere::deleteElement(), NL3D::CPSZonePlane::deleteElement(), NL3D::CPSTailDot::deleteElement(), NL3D::CPSSound::deleteElement(), NL3D::CPSShockWave::deleteElement(), NL3D::CPSRibbonLookAt::deleteElement(), NL3D::CPSRibbonBase::deleteElement(), NL3D::CPSRibbon::deleteElement(), NL3D::CPSQuad::deleteElement(), NL3D::CPSConstraintMesh::deleteElement(), NL3D::CPSMesh::deleteElement(), NL3D::CPSLocated::deleteElement(), NL3D::CPSLight::deleteElement(), NL3D::CPSTurbul::deleteElement(), NL3D::CPSBrownianForce::deleteElement(), NL3D::CPSFluidFriction::deleteElement(), NL3D::CIsotropicForceT< CPSFluidFrictionFunctor >::deleteElement(), NL3D::CPSForceIntensityHelper::deleteElement(), NL3D::CPSCylindricVortex::deleteElement(), NL3D::CPSFanLight::deleteElement(), NL3D::CPSFaceLookAt::deleteElement(), NL3D::CPSFace::deleteElement(), NL3D::CPSSphericalEmitter::deleteElement(), NL3D::CPSEmitterRectangle::deleteElement(), NL3D::CPSEmitterDirectionnal::deleteElement(), NL3D::CPSEmitterOmni::deleteElement(), NL3D::CPSEmitter::deleteElement(), NL3D::CPSDot::deleteElement(), NL3D::CPSAttribMakerMemoryBase< sint32 >::deleteElement(), NL3D::CPSAttribMakerBinOp< T >::deleteElement(), NL3D::CPSAttribMaker< sint32 >::deleteElement(), NL3D::CPSModulatedEmitter::deleteEmitteeSpeedElement(), NL3D::CPSForceIntensity::deleteForceIntensityElement(), NL3D::CPSRotated3DPlaneParticle::deletePlaneBasisElement(), NL3D::CPSSizedParticle::deleteSizeElement(), NL3D::CPSTexturedParticle::deleteTextureIndexElement(), NL3D::CParticleSystem::detach(), NL3D::CPSLocatedBindable::displayIcon2d(), NL3D::DuplicatePrimitiveBlock(), NL3D::CLinearEquation::Element::Element(), NL3D::CPSRadialEmitter::emit(), NL3D::CPSSphericalEmitter::emit(), NL3D::CPSEmitterConic::emit(), NL3D::CPSEmitterRectangle::emit(), NL3D::CPSEmitterDirectionnal::emit(), NL3D::CPSEmitterOmni::emit(), NLSOUND::IBuffer::encodeADPCM(), NLMISC::CEvalNumExpr::evalExpression(), NLGEORGES::CMyEvalNumExpr::evalValue(), NLPACS::CLocalRetriever::findBorderChains(), NL3D::CPSPlaneBasisFollowSpeed::get(), NL3D::CPSAttribMakerMemoryBase< sint32 >::get(), NL3D::CPSAttribMakerT< T, F >::get(), NL3D::CPSAttribMakerBinOp< T >::get(), NLMISC::CBigFile::CThreadFileArray::get(), NL3D::CZoneLighter::getAPatch(), NL3D::CTextureBlend::getBlendtexture(), NL3D::CPSLocated::getBoundObject(), NL3D::CTextContext::getComputedString(), NL3D::CPSFloatCurveFunctor::getControlPoint(), NL3D::CParticleSystem::getCurrentEditedElement(), NLGEORGES::CType::getDefinition(), NLMISC::CInputDeviceServer::getDevice(), NL3D::CRenderTrav::getDriverLight(), NLMISC::CEventEmitterMulti::getEmitter(), NL3D::CWaterShape::getEnvMap(), NL3D::CTextureMultiFile::getFileName(), NL3D::CParticleSystemInstanceUser::getID(), NL3D::CParticleSystem::getID(), NLAIC::CRegistry::getIdent(), NLAISCRIPT::CAgentClass::getInheritedStaticMemberIndex(), NL3D::CTextureFont::getLetterInfo(), NLMISC::CPolygon2D::getLineEquation(), NL3D::CParticleSystem::getLocatedBindableByExternID(), NL3D::CPSZoneRectangle::getMatrix(), NL3D::CPSZoneCylinder::getMatrix(), NL3D::CPSZoneDisc::getMatrix(), NL3D::CPSZoneSphere::getMatrix(), NL3D::CPSZonePlane::getMatrix(), NL3D::CPSCylindricVortex::getMatrix(), NL3D::CPSSphericalEmitter::getMatrix(), NL3D::CPSEmitterRectangle::getMatrix(), NLAIAGENT::CMessageScript::getMethode(), NLAIAGENT::CAgentScript::getMethode(), NLMISC::CFixedSizeAllocator::CChunk::getNode(), NLMISC::CPolygon2D::getNonNullSeg(), NL3D::CPSZoneDisc::getNormal(), NL3D::CPSZonePlane::getNormal(), NL3D::CPSCylindricVortex::getNormal(), NL3D::IPSMover::getNormal(), NL3D::CInstanceGroup::getPointLightNamed(), NL3D::CParticleSystem::getProcess(), NLLIGO::IPrimitive::getProperty(), NL3D::CFlareShape::getRelativePos(), NL3D::CPSZoneRectangle::getScale(), NL3D::CPSSphericalEmitter::getScale(), NL3D::CPSEmitterRectangle::getScale(), NL3D::IPSMover::getScale(), NLMISC::CPolygon2D::getSegRef0(), NLMISC::CPolygon2D::getSegRef1(), NL3D::CPSConstraintMesh::getShape(), NL3D::CFlareShape::getSize(), NL3D::CPSFloatCurveFunctor::getSlope(), NLSOUND::CComplexSound::getSound(), CVPInstruction::getSrc(), NLAIAGENT::CMessageScript::getStaticMember(), NLAISCRIPT::CAgentClass::getStaticMember(), NLAIAGENT::CAgentScript::getStaticMember(), NLGEORGES::CFormDfn::getSubDfn(), NL3D::CPSTargetLocatedBindable::getTarget(), NL3D::CTextureMultiFile::getTexIndex(), NL3D::CTextureMultiFile::getTexNameByIndex(), NL3D::CTextureGrouped::getTexture(), NL3D::CFlareShape::getTexture(), NL3D::CTileSet::getTile128(), NL3D::CTileSet::getTile256(), NL3D::CTileSet::getTransition(), NL3D::CParticleSystemInstanceUser::getUserParam(), NL3D::CTextureGrouped::getUV(), NL3D::CPSFloatCurveFunctor::getValue(), NL3D::CPSValueGradientFunc< sint32 >::getValue(), NL3D::CPSShockWave::getVBnPB(), NL3D::CMeshMRMSkinnedGeom::CPackedVertexBuffer::CPackedVertex::getWeight(), H_AUTO_DECL(), NL3D::CTransform::hrcGetChild(), NLSOUND::CContextSound::init(), NLLIGO::IPrimitive::insertChild(), NL3D::CPSBrownianForce::integrate(), NL3D::CPSBrownianForce::integrateSingle(), NLAISCRIPT::CLibTest::isMember(), NLAIAGENT::isTemplateMember(), NLGEORGES::CFormLoader::loadForm(), NLMISC::CIFile::loadIntoCache(), STRING_MANAGER::CMakeDiff< ItemType, Context, GetIdentifier, GetHashValue, TestItem >::makeDiff(), STRING_MANAGER::makeHashCode(), NL3D::CMRMBuilder::makeLODMesh(), NL3D::CPSSound::newElement(), NL3D::CPSRibbonBase::newElement(), NL3D_asmBlendLines(), NL3D_expandLightmap(), STRING_MANAGER::TGetHashValue< ItemType >::operator()(), STRING_MANAGER::TGetIdentifier< ItemType >::operator()(), STRING_MANAGER::TGetWorksheetHashValue::operator()(), STRING_MANAGER::TGetWorksheetIdentifier::operator()(), NL3D::CTextContext::operator[](), NL3D::CPSAttrib< sint32 >::operator[](), NL3D::CSnappedVector< T, snapPower >::operator[](), NLMISC::CObjectVector< sint8, false >::operator[](), NLAIAGENT::IListBasicManager::operator[](), NLAIAGENT::CVectorGroupType::operator[](), NLAIAGENT::CGroupType::operator[](), NLAILOGIC::CGoalStack::operator[](), STRING_MANAGER::TWorksheet::operator[](), CVPParser::parseConstantRegister(), CVPParser::parseInputRegister(), parseUInt(), CVPParser::parseVariableRegister(), NL3D::CTextContext::printAt(), NL3D::CTextContext::printClipAt(), NL3D::CTextContext::printClipAtUnProjected(), NL3D::CPSEmitter::processEmit(), NL3D::CPSEmitter::processEmitConsistent(), NLGEORGES::CForm::read(), NL3D::CTextureFont::rebuildLetter(), NL3D::CCoarseMeshBuild::remapCoordinates(), NL3D::CPSAttrib< T >::remove(), NL3D::CPSFloatCurveFunctor::removeCtrlPoint(), NLLIGO::IPrimitive::removeProperty(), NL3D::CTileSet::removeTile128(), NL3D::CTileSet::removeTile256(), NL3D::CTileBank::removeTileSet(), NL3D::CPSRibbonBase::resetSingleRibbon(), NL3D::CMeshMRMGeom::restoreOriginalSkinPart(), NLAIAGENT::CAgentScript::runAskGetValue(), NLAIAGENT::CAgentScript::runInitComponent(), NLAIAGENT::COperatorScript::runMethodBase(), NLAIAGENT::CAgentOperation::runMethodBase(), NLAILOGIC::CGoalPath::runMethodBase(), NLAIAGENT::CSeqFsmScript::runMethodBase(), NLAIAGENT::CFsmScript::runMethodBase(), NLAIAGENT::CAgentWatchTimer::runMethodBase(), NLAIAGENT::CAgentScript::runMethodBase(), NLAIAGENT::CActorScript::runMethodBase(), NLAISCRIPT::CLibTest::runMethodeMember(), NLAIAGENT::CPairType::runMethodeMember(), NLAIAGENT::CSetValueMsg::runMethodeMember(), NLAIAGENT::CCancelGoalMsg::runMethodeMember(), NLAIAGENT::CGoalMsg::runMethodeMember(), NLAIAGENT::CGetValueMsg::runMethodeMember(), NLAIAGENT::CFactMsg::runMethodeMember(), NLAIAGENT::CFailureMsg::runMethodeMember(), NLAIAGENT::CSuccessMsg::runMethodeMember(), NLAIAGENT::IMessageBase::runMethodeMember(), NLAIAGENT::CMessageScript::runMethodeMember(), NLAISCRIPT::CCallPrint::runMethodeMember(), NLAIAGENT::CVectorGroupType::runMethodeMember(), NLAIAGENT::IBaseGroupType::runMethodeMember(), NLAILOGIC::CGoalStack::runMethodeMember(), NLAILOGIC::CInternalGoal::runMethodeMember(), NLAILOGIC::CGoal::runMethodeMember(), NLAIFUZZY::IFuzzySet::runMethodeMember(), NLAILOGIC::CFact::runMethodeMember(), NLAIAGENT::IBasicAgent::runMethodeMember(), NLAIAGENT::CAgentWatchTimer::runMethodeMember(), NLAIAGENT::CLibTimerManager::runMethodeMember(), NLAIAGENT::CAgentScript::runMethodeMember(), NLAIAGENT::INombre< sint32 >::runMethodeMember(), NLAIAGENT::CAgentScript::runTellSetValue(), NL3D::CMRMBuilder::saveCoarserMesh(), NLPACS::CEdgeQuad::selectEdges(), NL3D::CTextureMultiFile::selectTexture(), NL3D::CTextureCube::selectTexture(), NL3D::ITexture::selectTexture(), NL3D::CMaterial::selectTextureSet(), NLAIAGENT::CVectorGroupType::set(), NLAIAGENT::CGroupType::set(), NLMISC::CConfigFile::CVar::setAsDouble(), NLMISC::CConfigFile::CVar::setAsFloat(), NLMISC::CConfigFile::CVar::setAsInt(), NLMISC::CConfigFile::CVar::setAsString(), NL3D::CShadowMapManager::setBlackQuad(), NL3D::CTextureBlend::setBlendTexture(), NL3D::CShadowMapManager::setBlurQuadFakeGaussian(), NL3D::CDriverGL::setConstant(), NL3D::CDriverGL::setConstantMatrix(), NLAISCRIPT::CAgentClass::setConstroctorMethod(), NL3D::CPSFloatCurveFunctor::setCtrlPoint(), NL3D::CParticleSystem::setCurrentEditedElement(), NL3D::CWaterShape::setEnvMap(), NL3D::CTextureMultiFile::setFileName(), NLAISCRIPT::CCodeBrancheRunDebug::setLineCode(), NL3D::CPSZoneRectangle::setMatrix(), NL3D::CPSZoneCylinder::setMatrix(), NL3D::CPSZoneDisc::setMatrix(), NL3D::CPSZoneSphere::setMatrix(), NL3D::CPSZonePlane::setMatrix(), NL3D::CPSCylindricVortex::setMatrix(), NL3D::CPSSphericalEmitter::setMatrix(), NL3D::CPSEmitterRectangle::setMatrix(), NL3D::CPSZoneDisc::setNormal(), NL3D::CPSZonePlane::setNormal(), NL3D::CPSCylindricVortex::setNormal(), NL3D::IPSMover::setNormal(), NL3D::CFlareShape::setRelativePos(), NLAISCRIPT::CAgentClass::setRunMethod(), NL3D::CPSZoneRectangle::setScale(), NL3D::CPSZoneCylinder::setScale(), NL3D::CPSSphericalEmitter::setScale(), NL3D::CPSEmitterRectangle::setScale(), NL3D::IPSMover::setScale(), NL3D::CPSConstraintMesh::setShape(), NL3D::CFlareShape::setSize(), NLAIAGENT::CMessageScript::setStaticMember(), NLAISCRIPT::CAgentClass::setStaticMember(), NLAIAGENT::CAgentScript::setStaticMember(), NL3D::CFlareShape::setTexture(), NL3D::CPSTexturedParticle::setTextureIndex(), NL3D::CPatch::setupColorsFromTileFlags(), NL3D::CDriverGL::setupEXTVertexShader(), NL3D::CPSTurbul::setupFunctor(), NL3D::CPSFluidFriction::setupFunctor(), NL3D::CIsotropicForceT< CPSFluidFrictionFunctor >::setupFunctor(), NL3D::CParticleSystemInstanceUser::setUserParam(), NL3D::CPSZoneRectangle::show(), NL3D::CPSZoneCylinder::show(), NL3D::CPSZoneDisc::show(), NL3D::CPSZoneSphere::show(), NL3D::CPSZonePlane::show(), NL3D::CPSLight::show(), NL3D::CPSCylindricVortex::show(), NL3D::CPSDirectionnalForce::show(), NL3D::CPSSphericalEmitter::showTool(), NL3D::CPSEmitterRectangle::showTool(), NL3D::CPSEmitter::showTool(), NL3D::CPSEmitter::singleEmit(), NL3D::CTextContext::textPush(), NL3D::CPSLocated::unbind(), NLLIGO::IPrimitive::updateChildId(), and NLAISCRIPT::CAgentClass::updateStaticMember().

+

+ + + + +
+ + +
typedef GLint GLenum internalformat +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1013 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLuint GLsizei len +
+
+ + + + + +
+   + + +

+ +

+Definition at line 235 of file driver_opengl_extension_def.h. +

+Referenced by NLPACS::CEdgeQuad::build(), NLPACS::CChainQuad::build(), NLNET::CUdpSimSock::dataAvailable(), NLAINIMAT::CMHiCSbase::dbgPrintClassifierPriorityInFile(), NLPACS::COrderedChain::distance(), NLMISC::CQuatT< T >::exp(), NLNET::CMessage::extractStreamFromPos(), NLMISC::CMemStream::fill(), NLMISC::CBitMemStream::fill(), NLNET::CBufSock::flush(), NLMISC::CHeapAllocator::getAllocatedSystemMemory(), NLMISC::CSystemInfo::getOS(), NLMISC::CBitMemStream::getSerialItem(), NLNET::CTcpSock::getWindowSize(), NLMISC::CMemStream::increaseBufferIfNecessary(), NL3D::CMRMBuilder::insertFaceIntoEdgeList(), NLNET::CMessageRecorder::loadNext(), NLMISC::CQuatT< T >::log(), NL3D_asmBlendLines(), NL3D_asmExpandLineColor565(), NL3D_asmExpandLineColor8888(), NL3D_asmModulateAndBlendLineColors(), NL3D_asmModulateLineColors(), NLMISC::CBitMemStream::readBits(), NLNET::CUdpSock::receive(), NLNET::CUdpSimSock::receive(), NLNET::CUdpSock::receivedFrom(), NLNET::CMessageRecorder::recordNext(), NLMISC::CMemStream::reserve(), NLNET::CUdpSimSock::send(), NLNET::CUdpSock::sendTo(), NLNET::CUdpSimSock::sendTo(), NLNET::CUdpSimSock::sendUDP(), NLNET::CUdpSimSock::sendUDPNow(), NLMISC::CStringStream::serial(), NLMISC::IStream::serial(), NL3D::CPSLocatedBindable::serial(), NL3D::CPSLocated::serial(), NL3D::CParticleSystem::serial(), NLMISC::CObjectVector< sint8, false >::serial(), NLNET::TMessageRecord::serial(), NLMISC::CMemStream::serial(), NLPACS::CEdgeQuad::serial(), NLPACS::CChainQuad::serial(), NLMISC::CBitMemStream::serial(), NLMISC::COXml::serialBuffer(), NLAIAGENT::CMsgOStream::serialBuffer(), NLAIAGENT::CMsgIStream::serialBuffer(), NLMISC::CMemStream::serialBuffer(), NLMISC::COFile::serialBuffer(), NLMISC::CIFile::serialBuffer(), NLMISC::CBitMemStream::serialBuffer(), NLMISC::IStream::serialBufferWithSize(), NLMISC::CStringStream::serialCont(), NLMISC::IStream::serialCont(), NLMISC::CBitMemStream::serialCont(), NLMISC::IStream::serialMap(), NLMISC::IStream::serialMemStream(), NLMISC::CBitMemStream::serialMemStream(), NLNET::CMessage::serialMessage(), NLMISC::IStream::serialMultimap(), NLMISC::CStringStream::serialSeparatedBufferIn(), NLMISC::CMemStream::serialSeparatedBufferIn(), NLMISC::CStringStream::serialSeparatedBufferOut(), NLMISC::CMemStream::serialSeparatedBufferOut(), NLMISC::IStream::serialSTLCont(), NLMISC::IStream::serialSTLContLen(), NLMISC::IStream::serialSTLContLenPolyPtr(), NLMISC::IStream::serialSTLContLenPtr(), NLMISC::IStream::serialSTLContPolyPtr(), NLMISC::IStream::serialSTLContPtr(), NLMISC::IStream::serialVector(), NLMISC::IStream::serialVectorPolyPtr(), NLMISC::IStream::serialVectorPtr(), NLNET::stringFromVectorPart(), and NLMISC::xmlOutputWriteCallbackForNeL().

+

+ + + + +
+ + +
typedef GLint level +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1013 of file driver_opengl_extension_def.h. +

+Referenced by NLPACS::CLocalRetriever::addSurface(), NL3D::CDriverGL::copyFrameBufferToTexture(), NLPACS::CQuadBranch::CQuadBranch(), NLPACS::CQuadLeaf::CQuadLeaf(), NL3D::CScene::findCameraClusterSystemFromRay(), NLMISC::CRandomGrid3D::getLevelPhase(), NLMISC::CRandomGrid3D::getLevelSize(), NL3D::CQuadGridClipClusterQTreeNode::init(), NLPACS::IQuadNode::IQuadNode(), NLMISC::CNoiseValue::noise(), and NL3D::CTextureFile::setMipMapSkipAtLoad().

+

+ + + + +
+ + +
typedef GLuint GLenum matrix +
+
+ + + + + +
+   + + +

+ +

+Definition at line 243 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CMeshMRMSkinnedGeom::build(), NL3D::CMeshMRMGeom::build(), NL3D::CMeshGeom::build(), NL3D::CMeshGeom::buildBoneUsageVer3(), NL3D::CMeshMRMSkinnedGeom::computeBonesId(), NL3D::CMeshMRMGeom::computeBonesId(), NL3D::CMeshGeom::computeBonesId(), NEL3DCalcBase(), NL3D::NEL3DCalcBase(), NL3D::CComputedString::render2D(), NL3D::CComputedString::render3D(), NL3D::CDriverGL::setConstantMatrix(), NL3D::CEvent3dMouseListener::setMatrix(), NL3D::CEvent3dMouseListener::setModelMatrix(), NL3D::CMeshMultiLodInstance::setPosCoarseMesh(), and NLMISC::CMatrix::setRot().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLALPHAFRAGMENTOP1ATIPROC)(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1213 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLALPHAFRAGMENTOP2ATIPROC)(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1215 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLALPHAFRAGMENTOP3ATIPROC)(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod, GLuint arg3, GLuint arg3Rep, GLuint arg3Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1218 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLBEGINFRAGMENTSHADERATIPROC)(GLvoid) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1197 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLBINDFRAGMENTSHADERATIPROC)(GLuint id) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1195 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLBINDPROGRAMARBPROC)(GLenum target, GLuint program) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1236 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLCOLORFRAGMENTOP1ATIPROC)(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1201 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLCOLORFRAGMENTOP2ATIPROC)(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1204 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLCOLORFRAGMENTOP3ATIPROC)(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod, GLuint arg3, GLuint arg3Rep, GLuint arg3Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1208 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLDELETEFRAGMENTSHADERATIPROC)(GLuint id) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1196 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLDELETEPROGRAMSARBPROC)(GLsizei n, const GLuint *programs) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1237 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLENDFRAGMENTSHADERATIPROC)(GLvoid) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1198 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLuint(APIENTRY * NEL_PFNGLGENFRAGMENTSHADERSATIPROC)(GLuint range) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1194 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLGENPROGRAMSARBPROC)(GLsizei n, GLuint *programs) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1238 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMENVPARAMETERDVARBPROC)(GLenum target, GLuint index, GLdouble *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1247 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMENVPARAMETERFVARBPROC)(GLenum target, GLuint index, GLfloat *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1248 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMIVARBPROC)(GLenum target, GLenum pname, int *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1251 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMLOCALPARAMETERDVARBPROC)(GLenum target, GLuint index, GLdouble *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1249 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMLOCALPARAMETERFVARBPROC)(GLenum target, GLuint index, GLfloat *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1250 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLGETPROGRAMSTRINGARBPROC)(GLenum target, GLenum pname, GLvoid *string) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1252 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLboolean(APIENTRY * NEL_PFNGLISPROGRAMARBPROC)(GLuint program) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1253 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef void*(APIENTRY * NEL_PFNGLMAPOBJECTBUFFERATIPROC)(GLuint buffer) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1228 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIMapObjectBuffer().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPASSTEXCOORDATIPROC)(GLuint dst, GLuint coord, GLenum swizzle) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1199 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMENVPARAMETER4DARBPROC)(GLenum target, GLuint index, GLdouble x, GLdouble y, GLdouble z, GLdouble w) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1239 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMENVPARAMETER4DVARBPROC)(GLenum target, GLuint index, const GLdouble *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1240 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMENVPARAMETER4FARBPROC)(GLenum target, GLuint index, GLfloat x, GLfloat y, GLfloat z, GLfloat w) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1241 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMENVPARAMETER4FVARBPROC)(GLenum target, GLuint index, const GLfloat *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1242 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMLOCALPARAMETER4DARBPROC)(GLenum target, GLuint index, GLdouble x, GLdouble y, GLdouble z, GLdouble w) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1243 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMLOCALPARAMETER4DVARBPROC)(GLenum target, GLuint index, const GLdouble *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1244 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMLOCALPARAMETER4FARBPROC)(GLenum target, GLuint index, GLfloat x, GLfloat y, GLfloat z, GLfloat w) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1245 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMLOCALPARAMETER4FVARBPROC)(GLenum target, GLuint index, const GLfloat *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1246 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLPROGRAMSTRINGARBPROC)(GLenum target, GLenum format, GLsizei len,const GLvoid *string) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1235 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupARBFragmentProgram().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLSAMPLEMAPATIPROC)(GLuint dst, GLuint interp, GLenum swizzle) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1200 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * NEL_PFNGLSETFRAGMENTSHADERCONSTANTATIPROC)(GLuint dst, const GLfloat *value) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1222 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIFragmentShader().

+

+ + + + +
+ + +
typedef void(APIENTRY * NEL_PFNGLUNMAPOBJECTBUFFERATIPROC)(GLuint buffer) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1229 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::setupATIMapObjectBuffer().

+

+ + + + +
+ + +
typedef GLuint GLuint num +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1124 of file driver_opengl_extension_def.h. +

+Referenced by NLSOUND::CEnvEffect::addEnvNum(), NLAIAGENT::IConnectIA::connectLoadStream(), NLPACS::CRational64::CRational64(), NL3D::CDriverUser::enableLight(), NL3D::CDriverGL::enableLight(), NL3D::FillQuadCoords(), NL3D::FillQuadCoordsLocalTime(), H_AUTO_DECL(), NL3D::CPSLocated::incrementNbDrawnParticles(), NLMISC::CFile::isDirectory(), NLMISC::CFile::isExists(), NLMISC::itoaInt64(), NLAIAGENT::CLocalMailBox::load(), NLAIAGENT::CIndexVariant< T, indexMax, maxT >::load(), NLAIAGENT::CLocalAgentMail::load(), NLSOUND::CBufferDSound::readWavBuffer(), NL3D::CCluster::recursTraverseClip(), NLPACS::CRetrieverBank::serial(), NL3D::CDriverGL::setConstant(), NL3D::CDriverUser::setLight(), NL3D::CDriverGL::setLight(), NL3D::CSceneUser::setShadowMapMaxCasterAround(), NL3D::CScene::setShadowMapMaxCasterAround(), NL3D::CSceneUser::setShadowMapMaxCasterInScreen(), NL3D::CScene::setShadowMapMaxCasterInScreen(), NL3D::CTransform::traverseClip(), NL3D::CRootModel::traverseClip(), NL3D::CTransform::traverseHrc(), NL3D::CRootModel::traverseHrc(), and NL3D::CAnimDetailTrav::traverseHrcRecurs().

+

+ + + + +
+ + +
typedef GLenum GLsizei GLuint GLuint offset +
+
+ + + + + +
+   + + +

+ +

+Definition at line 645 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::activeNVVertexProgram(), NLMISC::CRGBA::addColors(), NL3D::CFastHLSModifier::applyHLSMod(), NLGEORGES::buildError(), NL3D::CMaterial::decompUserTexMat(), NL3D::CWaterHeightMap::filter(), NLGEORGES::findSpecialCharacter(), NL3D::CWaterHeightMap::getHeight(), NL3D::CPSLocated::getLODVect(), NL3D::CParticleSystem::getLODVect(), NLGEORGES::getNextToken(), NL3D::getUnpackLumelBlock(), NLSOUND::CSourceDSound::lock(), NLMISC::CRGBA::modulateColors(), NLMISC::nlfseek64(), NL3D::CWaterHeightMap::propagate(), NLMISC::IStream::seek(), NLMISC::CMemStream::seek(), NLMISC::COFile::seek(), NLMISC::CIFile::seek(), NL3D::SetupWaterVertex(), and NLMISC::CRGBA::subtractColors().

+

+ + + + +
+ + +
typedef GLuint GLenum GLenum GLenum GLenum outW +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1122 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::doSwizzle(), and NL3D::doWriteMask().

+

+ + + + +
+ + +
typedef GLuint GLenum outX +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1122 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::doSwizzle(), and NL3D::doWriteMask().

+

+ + + + +
+ + +
typedef GLuint GLenum GLenum outY +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1122 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::doSwizzle(), and NL3D::doWriteMask().

+

+ + + + +
+ + +
typedef GLuint GLenum GLenum GLenum outZ +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1122 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::doSwizzle(), and NL3D::doWriteMask().

+

+ + + + +
+ + +
typedef GLfloat * param +
+
+ + + + + +
+   + + +

+ +

+Definition at line 683 of file driver_opengl_extension_def.h. +

+Referenced by NLAIAGENT::CAgentWatchTimer::addAttrib(), NLAISCRIPT::CAgentClass::addBrancheCode(), NLAILOGIC::CFirstOrderAssert::backward(), NLAISCRIPT::CConstraintFindRun::CConstraintFindRun(), NLAISCRIPT::CConstraintMethode::CConstraintMethode(), NLAISCRIPT::CFindRunMsg::CFindRunMsg(), NLAISCRIPT::CAgentClass::findMethod(), NLAISCRIPT::CCompilateur::findMethode(), NLAIAGENT::CComponentHandle::getComponent(), NLAISCRIPT::CMakeArgOpCode::getDebugResult(), NLAIAGENT::COperatorScript::getDebugString(), NLAIAGENT::CAgentScript::getDebugString(), NLAIAGENT::COperatorScript::getPrivateMember(), NLAISCRIPT::CAgentClass::getPrivateMember(), NLAIAGENT::CAgentScript::getPrivateMember(), NLAIAGENT::CActorScript::getPrivateMember(), NLAIAGENT::CAgentScript::isDeflautProccessMsg(), NLAILOGIC::IBaseVar::isMember(), NLAISCRIPT::CLibTest::isMember(), NLAIAGENT::CAgentOperation::isMember(), NLAIAGENT::CMessageScript::isMember(), NLAISCRIPT::CCallPrint::isMember(), NLAISCRIPT::CAgentClass::isMember(), NLAIAGENT::CVectorGroupType::isMember(), NLAIFUZZY::CFuzzyVar::isMember(), NLAIAGENT::CSeqFsmScript::isMember(), NLAIAGENT::CFsmScript::isMember(), NLAIAGENT::IObjectIA::isMember(), NLAIAGENT::CAgentWatchTimer::isMember(), NLAIAGENT::CLibTimerManager::isMember(), NLAIAGENT::CAgentScript::isMember(), NLAIAGENT::CProxyAgentMail::isMember(), NLAIAGENT::IVector::isMember(), NLAIAGENT::CActor::isMember(), NLAISCRIPT::CAgentClass::isMessageFunc(), NLAIAGENT::isTemplateMember(), NLAIAGENT::CActorScript::processFailure(), NLAIAGENT::CAgentScript::processMessages(), NLAIAGENT::CActorScript::processSuccess(), NLAISCRIPT::CConstraintMethode::run(), NLAIAGENT::CAgentOperation::runMethodBase(), NLAILOGIC::CGoalPath::runMethodBase(), NLAIAGENT::CSeqFsmScript::runMethodBase(), NLAIAGENT::CAgentWatchTimer::runMethodBase(), NLAIAGENT::CAgentScript::runMethodBase(), NLAILOGIC::IBaseVar::runMethodeMember(), NLAISCRIPT::CLibTest::runMethodeMember(), NLAIAGENT::CCancelGoalMsg::runMethodeMember(), NLAIAGENT::CGoalMsg::runMethodeMember(), NLAIAGENT::CGetValueMsg::runMethodeMember(), NLAIAGENT::CFactMsg::runMethodeMember(), NLAIAGENT::CFailureMsg::runMethodeMember(), NLAIAGENT::CSuccessMsg::runMethodeMember(), NLAISCRIPT::CCallPrint::runMethodeMember(), NLAIAGENT::CVectorGroupType::runMethodeMember(), NLAIAGENT::IBaseGroupType::runMethodeMember(), NLAILOGIC::CGoalStack::runMethodeMember(), NLAILOGIC::CInternalGoal::runMethodeMember(), NLAILOGIC::CGoal::runMethodeMember(), NLAILOGIC::CFact::runMethodeMember(), NLAIAGENT::IObjectIA::runMethodeMember(), NLAIAGENT::IBasicAgent::runMethodeMember(), NLAIAGENT::CLibTimerManager::runMethodeMember(), NLAIAGENT::INombre< sint32 >::runMethodeMember(), NLAIAGENT::IVector::runMethodeMember(), NLAISCRIPT::CLibHeapMemberMethod::runOpCode(), NLAISCRIPT::CLibStackNewMemberMethod::runOpCode(), NLAISCRIPT::CLibStackMemberMethod::runOpCode(), NLAISCRIPT::CLibCallMethodi::runOpCode(), NLAISCRIPT::CLibCallInheritedMethod::runOpCode(), NLAISCRIPT::CLibCallMethod::runOpCode(), NLAISCRIPT::CLibMemberMethodi::runOpCode(), NLAISCRIPT::CLibMemberInheritedMethod::runOpCode(), NLAISCRIPT::CLibMemberMethod::runOpCode(), NLAISCRIPT::CMakeArgOpCode::runOpCode(), NLAISCRIPT::CLdbNewOpCode::runOpCode(), NLAISCRIPT::CFindRunMsg::runOpCode(), NLAISCRIPT::CMarkMsg::runOpCode(), NLAISCRIPT::CMethodContextDebug::saveContext(), NLAISCRIPT::CMethodContext::saveContext(), NLAIAGENT::CAgentScript::sendMethod(), and NLAIAGENT::CAgentScript::sendMethodCompoment().

+

+ + + + +
+ + +
typedef GLenum GLint * params +
+
+ + + + + +
+   + + +

+ +

+Definition at line 223 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CMeshMRMSkinned::build(), NL3D::CMeshMRMSkinnedGeom::build(), NL3D::CMeshMRM::build(), NL3D::CMeshMRMGeom::build(), NL3D::CMRMBuilder::compileMRM(), NL3D::CWaterPoolManager::createWaterPool(), NLAILOGIC::CGoalPath::getPrivateMember(), NLAILOGIC::CFactPattern::init(), NLAILOGIC::CRule::init(), NLAIFUZZY::CFuzzyVar::init(), NLAIFUZZY::CTrapezeFuzzySet::init(), NLAIFUZZY::CLeftFuzzySet::init(), NLAIFUZZY::CTriangleFuzzySet::init(), NLAIFUZZY::CRightFuzzySet::init(), NLAIFUZZY::CFuzzyInterval::init(), NLAIFUZZY::CFuzzyRuleSet::init(), NLAIFUZZY::CSimpleFuzzyCond::init(), NLAILOGIC::CFirstOrderAssert::init(), NLAIAGENT::CSetValueMsg::isMember(), NLAIAGENT::CCancelGoalMsg::isMember(), NLAIAGENT::CGoalMsg::isMember(), NLAIAGENT::CGetValueMsg::isMember(), NLAIAGENT::CFactMsg::isMember(), NLAIAGENT::CFailureMsg::isMember(), NLAIAGENT::CSuccessMsg::isMember(), NLAILOGIC::CGoalStack::isMember(), NLAILOGIC::CInternalGoal::isMember(), NLAILOGIC::CGoal::isMember(), NLAIFUZZY::IFuzzySet::isMember(), NLAILOGIC::CFact::isMember(), NLAIAGENT::COperatorScript::runMethodBase(), NLAIAGENT::CSeqFsmScript::runMethodBase(), NLAIAGENT::CFsmScript::runMethodBase(), NLAIAGENT::CActorScript::runMethodBase(), NLAIFUZZY::CFuzzyVar::runMethodeMember(), NLAIAGENT::CActor::runMethodeMember(), and NL3D::CDriverGL::setDisplay().

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLALPHAFRAGMENTOP1ATIPROC)(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 822 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLALPHAFRAGMENTOP2ATIPROC)(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 824 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLALPHAFRAGMENTOP3ATIPROC)(GLenum op, GLuint dst, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod, GLuint arg3, GLuint arg3Rep, GLuint arg3Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 827 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLBEGINFRAGMENTSHADERATIPROC)(GLvoid) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 806 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLBINDFRAGMENTSHADERATIPROC)(GLuint id) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 804 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLBINDPROGRAMARBPROC)(GLenum target, GLuint program) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 941 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLCOLORFRAGMENTOP1ATIPROC)(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 810 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLCOLORFRAGMENTOP2ATIPROC)(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 813 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLCOLORFRAGMENTOP3ATIPROC)(GLenum op, GLuint dst, GLuint dstMask, GLuint dstMod, GLuint arg1, GLuint arg1Rep, GLuint arg1Mod, GLuint arg2, GLuint arg2Rep, GLuint arg2Mod, GLuint arg3, GLuint arg3Rep, GLuint arg3Mod) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 817 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLDELETEFRAGMENTSHADERATIPROC)(GLuint id) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 805 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLDELETEPROGRAMSARBPROC)(GLsizei n, const GLuint *programs) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 942 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLENDFRAGMENTSHADERATIPROC)(GLvoid) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 807 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLuint(APIENTRY * PFNGLGENFRAGMENTSHADERSATIPROC)(GLuint range) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 803 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLGENPROGRAMSARBPROC)(GLsizei n, GLuint *programs) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 943 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMENVPARAMETERDVARBPROC)(GLenum target, GLuint index, GLdouble *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 952 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMENVPARAMETERFVARBPROC)(GLenum target, GLuint index, GLfloat *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 953 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMIVARBPROC)(GLenum target, GLenum pname, int *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 956 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMLOCALPARAMETERDVARBPROC)(GLenum target, GLuint index, GLdouble *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 954 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMLOCALPARAMETERFVARBPROC)(GLenum target, GLuint index, GLfloat *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 955 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLGETPROGRAMSTRINGARBPROC)(GLenum target, GLenum pname, GLvoid *string) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 957 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLboolean(APIENTRY * PFNGLISPROGRAMARBPROC)(GLuint program) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 958 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef void*(APIENTRY * PFNGLMAPOBJECTBUFFERATIPROC)(GLuint buffer) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 843 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPASSTEXCOORDATIPROC)(GLuint dst, GLuint coord, GLenum swizzle) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 808 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPROGRAMENVPARAMETER4DARBPROC)(GLenum target, GLuint index, GLdouble x, GLdouble y, GLdouble z, GLdouble w) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 944 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPROGRAMENVPARAMETER4DVARBPROC)(GLenum target, GLuint index, const GLdouble *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 945 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPROGRAMENVPARAMETER4FARBPROC)(GLenum target, GLuint index, GLfloat x, GLfloat y, GLfloat z, GLfloat w) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 946 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPROGRAMENVPARAMETER4FVARBPROC)(GLenum target, GLuint index, const GLfloat *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 947 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPROGRAMLOCALPARAMETER4DARBPROC)(GLenum target, GLuint index, GLdouble x, GLdouble y, GLdouble z, GLdouble w) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 948 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPROGRAMLOCALPARAMETER4DVARBPROC)(GLenum target, GLuint index, const GLdouble *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 949 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPROGRAMLOCALPARAMETER4FARBPROC)(GLenum target, GLuint index, GLfloat x, GLfloat y, GLfloat z, GLfloat w) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 950 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPROGRAMLOCALPARAMETER4FVARBPROC)(GLenum target, GLuint index, const GLfloat *params) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 951 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLPROGRAMSTRINGARBPROC)(GLenum target, GLenum format, GLsizei len,const GLvoid *string) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 940 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLSAMPLEMAPATIPROC)(GLuint dst, GLuint interp, GLenum swizzle) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 809 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLvoid(APIENTRY * PFNGLSETFRAGMENTSHADERCONSTANTATIPROC)(GLuint dst, const GLfloat *value) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 831 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef void(APIENTRY * PFNGLUNMAPOBJECTBUFFERATIPROC)(GLuint buffer) +
+
+ + + + + +
+   + + +

+ +

+Definition at line 844 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLenum pname +
+
+ + + + + +
+   + + +

+ +

+Definition at line 225 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLuint GLsizei const GLvoid * pointer +
+
+ + + + + +
+   + + +

+ +

+Definition at line 233 of file driver_opengl_extension_def.h. +

+Referenced by NLMISC::NLMISC_DYNVARIABLE(), NLNET::NLMISC_DYNVARIABLE(), NLMISC::CTDS::setPointer(), and NLMEMORY::CMemoryTDS::setPointer().

+

+ + + + +
+ + +
typedef GLuint GLsizei const GLvoid GLenum preserve +
+
+ + + + + +
+   + + +

+ +

+Definition at line 645 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLuint GLsizei const GLubyte * program +
+
+ + + + + +
+   + + +

+ +

+Definition at line 228 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverGL::activeEXTVertexShader(), NL3D::CDriverGL::activeNVVertexProgram(), NL3D::CDriverGL::activeVertexProgram(), NL3D::CVertexProgram::CVertexProgram(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + +
typedef const GLuint * programs +
+
+ + + + + +
+   + + +

+ +

+Definition at line 220 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLshort GLshort GLshort GLshort q +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1001 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CDriverUser::drawQuads(), NLAISCRIPT::CCompilateur::findMethode(), NLAISCRIPT::CAgentClass::getPrivateMember(), NLMISC::CMatrix::getRot(), NLAISCRIPT::CAgentClass::isMember(), NLMISC::CQuad::operator=(), and NL3D::CInstanceGroupUser::setRotQuat().

+

+ + + + +
+ + +
typedef GLshort GLshort GLshort r +
+
+ + + + + +
+   + + +

+ +

+Definition at line 993 of file driver_opengl_extension_def.h. +

+Referenced by NLAIAGENT::CActorScript::activate(), NLAISCRIPT::COperatorClass::activatePostConditions(), NLMISC::CRGBA::add(), NLAIAGENT::CAgentWatchTimer::addAttrib(), NLAIAGENT::CAgentScript::addDynamicAgent(), NL3D::CPatchDLMContext::addPointLightInfluence(), NLMISC::CRGBA::addRGBOnly(), NLMISC::CTaskManager::addTask(), NL3D::CTextureFile::buildBitmapFromFile(), NLAILINK::buildScript(), NLMISC::CVectorD::cartesianToSpheric(), NLMISC::CVector::cartesianToSpheric(), NLMISC::CBGRA::CBGRA(), NLAIE::CExceptionIndexError::CExceptionIndexError(), NLAILOGIC::CFirstOrderAssert::CFirstOrderAssert(), NLAIC::CIdentType::CIdentType(), NLAIAGENT::CIdMethod::CIdMethod(), NL3D::CTessBlock::clipFar(), NLAISCRIPT::CLibTest::CMethodCall::CMethodCall(), NLAIAGENT::CAgentScript::CMethodCall::CMethodCall(), CTrackKeyFramerBezier< CKeyBezierQuat, CQuat >::compile(), NLAISCRIPT::CCompilateur::Compile(), NL3D::computeLodLighting(), NL3D::CPatch::computeNewFar(), NL3D::CShadowMapManager::computeShadowColors(), NL3D::CPSParticle::computeSrcStep(), NL3D::CSkeletonModel::computeWorldBBoxForShadow(), NLMISC::CRGBA::convertToHLS(), NLGEORGES::CFormElm::convertValue(), NL3D::convOutputRegisterToEXTVertexShader(), NLMISC::CRGBA::CRGBA(), NLPACS::UGlobalRetriever::deleteGlobalRetriever(), NLPACS::URetrieverBank::deleteRetrieverBank(), NLMISC::CTaskManager::deleteTask(), NLAIAGENT::CAgentWatchTimer::detach(), NLAISCRIPT::CLibTest::dRand(), NLAISCRIPT::CParam::eval(), NLAIAGENT::COperatorScript::execOnActivate(), NLAIAGENT::CActorScript::failure(), NLAISCRIPT::CCompilateur::findMethode(), NLAISCRIPT::CCallPrint::format(), NLMISC::CRandom::frand(), NLMISC::frand(), NLNET::CLoginCookie::generateKey(), NL3D::CFClampSquareDot3AddIterator< TBaseIter >::get(), NL3D::CFClampDot3AddIterator< TBaseIter >::get(), NL3D::CFSquareDot3AddIterator< TBaseIter >::get(), NL3D::CFDot3AddIterator< TBaseIter >::get(), NL3D::CPSAttribMakerT< T, F >::get(), NLSOUND::CContextSound::getContextSound(), NLAISCRIPT::CLdbMemberOpCode::getDebugResult(), NLAISCRIPT::CCallMethod::getDebugResult(), NLAIAGENT::CVolatilMemmory::getDebugString(), NLAIAGENT::COperatorScript::getDebugString(), NLAIAGENT::CAgentScript::getDebugString(), NLAIAGENT::CAgentScript::getDynamicAgent(), NLAIAGENT::CAgentScript::getDynamicName(), NL3D::CTextureFont::getLetterInfo(), NLAILOGIC::CGoalPath::getPrivateMember(), NLSOUND::CAmbiantSource::getRandomSound(), H_AUTO_DECL(), NL3D::SCloudTextureClamp::init(), NLAIAGENT::CAgentScript::isDeflautProccessMsg(), NLAISCRIPT::CLibTest::isMember(), NLAIAGENT::CAgentOperation::isMember(), NLAIAGENT::CSetValueMsg::isMember(), NLAIAGENT::CCancelGoalMsg::isMember(), NLAIAGENT::CGoalMsg::isMember(), NLAIAGENT::CGetValueMsg::isMember(), NLAIAGENT::CFactMsg::isMember(), NLAIAGENT::CFailureMsg::isMember(), NLAIAGENT::CSuccessMsg::isMember(), NLAIAGENT::CMessageScript::isMember(), NLAILOGIC::CGoalStack::isMember(), NLAILOGIC::CInternalGoal::isMember(), NLAILOGIC::CGoal::isMember(), NLAIFUZZY::IFuzzySet::isMember(), NLAILOGIC::CFact::isMember(), NLAIAGENT::IObjectIA::isMember(), NLAIAGENT::CAgentWatchTimer::isMember(), NLAIAGENT::CLibTimerManager::isMember(), NLAIAGENT::CAgentScript::isMember(), NLAIAGENT::CProxyAgentMail::isMember(), NLAIAGENT::isTemplateMember(), NLAISCRIPT::COperatorClass::isValidFonc(), NLAIAGENT::IMessageBase::load(), NL3D::CCloudScape::makeHalfCloud(), NL3D::CEvent3dMouseListener::operator()(), NLAIAGENT::CIndexVariant< T, indexMax, maxT >::operator<<=(), NLAIAGENT::CIndexVariant< T, indexMax, maxT >::operator>>=(), NLAIAGENT::CActorScript::pause(), NL3D::CPSZoneSphere::performMotion(), NLAISCRIPT::CCallPrint::printList(), NLAIAGENT::COperatorScript::propagate(), NLAILOGIC::CFirstOrderOperator::propagate(), NL3D::PSBinOpAdd(), NL3D::PSBinOpModulate(), NL3D::PSBinOpSubtract(), NLAISCRIPT::CLibTest::rand(), ReadColor(), NLMISC::CBitmap::readTGA(), NLAISCRIPT::CCompilateur::registerMethod(), NLAIAGENT::CAgentScript::removeDynamic(), NLAIAGENT::CActorScript::restart(), NLAIAGENT::CAgentScript::run(), NLAIAGENT::CActorScript::run(), NLAIAGENT::CAgentScript::runAskDebugString(), NLAIAGENT::CAgentScript::runAskGetValue(), NLAIAGENT::CAgentScript::runAskParentNotify(), NLAIAGENT::CAgentScript::runInitClass(), NLAIAGENT::CAgentScript::runInitComponent(), NLAIAGENT::COperatorScript::runMethodBase(), NLAIAGENT::CAgentOperation::runMethodBase(), NLAIAGENT::CSeqFsmScript::runMethodBase(), NLAIAGENT::CFsmScript::runMethodBase(), NLAIAGENT::CAgentWatchTimer::runMethodBase(), NLAIAGENT::CAgentScript::runMethodBase(), NLAIAGENT::CActorScript::runMethodBase(), NLAILOGIC::IBaseVar::runMethodeMember(), NLAISCRIPT::CLibTest::runMethodeMember(), NLAIAGENT::CMessageScript::runMethodeMember(), NLAISCRIPT::CCallPrint::runMethodeMember(), NLAIFUZZY::CFuzzyVar::runMethodeMember(), NLAIFUZZY::IFuzzySet::runMethodeMember(), NLAIAGENT::IObjectIA::runMethodeMember(), NLAIAGENT::CAgentScript::runMethodeMember(), NLAIAGENT::IVector::runMethodeMember(), NLAIAGENT::CActor::runMethodeMember(), NLAISCRIPT::CLibHeapMemberMethod::runOpCode(), NLAISCRIPT::CLibStackNewMemberMethod::runOpCode(), NLAISCRIPT::CLibStackMemberMethod::runOpCode(), NLAISCRIPT::CLibCallMethodi::runOpCode(), NLAISCRIPT::CLibCallInheritedMethod::runOpCode(), NLAISCRIPT::CLibCallMethod::runOpCode(), NLAISCRIPT::CLibMemberMethodi::runOpCode(), NLAISCRIPT::CLibMemberInheritedMethod::runOpCode(), NLAISCRIPT::CLibMemberMethod::runOpCode(), NLAIAGENT::CAgentScript::runTellComponent(), NLAIAGENT::CAgentScript::runTellParentNotify(), NLAIAGENT::CAgentScript::runTellSetValue(), NLAIAGENT::IMessageBase::save(), NLAIAGENT::IConnectIA::save(), NLAIAGENT::CLocalAgentMail::save(), NLMISC::ScanInnerEdge(), NLMISC::ScanOuterEdgeLeft(), NLMISC::ScanOuterEdgeRight(), NLAIAGENT::CVolatilMemmory::searchBest(), NLAIAGENT::CAgentScript::sendMessage(), NLAIAGENT::CProxyAgentMail::sendMessage(), NLAIAGENT::CAgentScript::sendMessageToDynmaicChild(), NLMISC::CRGBAF::set(), NLMISC::CBGRA::set(), NLMISC::CRGBA::set(), NLAIAGENT::IMessageBase::setContinuation(), NL3D::CPSEmitterConic::setRadius(), NLAIAGENT::IMessageBase::setReceiver(), NLAILOGIC::CInternalGoal::setReceiver(), NLAILOGIC::IGoal::setReceiver(), NL3D::ITexture::setReleasable(), NL3D::CLandscape::setupStaticLight(), NLMISC::CVectorD::sphericToCartesian(), NLMISC::CVector::sphericToCartesian(), NLMISC::CRGBA::sub(), NLMISC::CRGBA::subRGBOnly(), NLAIAGENT::CActorScript::success(), NLAIAGENT::CActorScript::unActivate(), NLMISC::CBitmap::uncompress(), NLMISC::CBitmap::writeTGA(), and NLAIAGENT::CAgentTimerHandle::~CAgentTimerHandle().

+

+ + + + +
+ + +
typedef GLenum GLenum range +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1126 of file driver_opengl_extension_def.h. +

+Referenced by NLNET::CUnifiedNetwork::addNamedCnx(), NLNET::CUnifiedNetwork::haveNamedCnx(), NLNET::CUnifiedNetwork::isServiceLocal(), NLSOUND::CAudioMixerUser::removeEvents(), NLNET::CUnifiedNetwork::removeNamedCnx(), NLNET::CUnifiedNetwork::send(), NL3D::CFlareShape::setAttenuationRange(), NL3D::CFlareShape::setDazzleAttenuationRange(), and NLSOUND::CAudioMixerUser::update().

+

+ + + + +
+ + +
typedef GLuint res +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1119 of file driver_opengl_extension_def.h. +

+Referenced by NLMISC::CBSphere::applyTransform(), NL3D::bilinearColorAndAdd(), NL3D::bilinearColorAndModulate(), NL3D::bilinearColorAndModulatex2(), NL3D::bilinearColorDiv2AndAdd(), NL3D::BuildTGSpaceVect(), NLMISC::bytesToHumanReadable(), NLMISC::CHeapAllocator::checkHeap(), NLMISC::CFileDisplayer::doDisplay(), NLPACS::CGlobalRetriever::doMove(), NL3D::doSwizzle(), NL3D::doWriteMask(), NLGEORGES::CMyEvalNumExpr::evalValue(), NLMISC::explode(), NLMISC::COXml::flush(), NLNET::CBufSock::flush(), NLMISC::CEntityIdTranslator::getByEntity(), NLMISC::CEntityIdTranslator::getByUser(), NLMISC::CBitmap::getColorInterp(), NLMISC::CFile::getFilename(), NLMISC::CFile::getFilenameWithoutExtension(), NL3D::CZoneLighter::getMaxPhi(), NL3D::CDriverUser::getModes(), NL3D::CVisualCollisionEntity::getPatchTriangleUnderUs(), NLMISC::getPowerOf2(), NLNET::IService::getServiceUnifiedName(), NL3D::CVisualCollisionEntity::getStaticLightSetup(), NL3D::CVisualCollisionEntity::getSurfaceInfo(), CVarPath::getToken(), NL3D::H_AUTO_DECL(), NLMISC::humanReadableToBytes(), NLNET::CNamingClient::info(), NLSOUND::CSoundDriverDSound::init(), NLNET::internalIPAddressToString(), NL3D::ITrack::interpolate(), NLAISCRIPT::COperatorClass::isValid(), NLAILOGIC::CFirstOrderOperator::isValid(), NLMISC::killProgram(), NLMISC::launchProgram(), loadForm(), NLMISC::CWordsDictionary::makeResult(), NLMISC::NLMISC_COMMAND(), NL3D::CAdvance1616Iterator< T, PT >::operator+(), NLNET::CBufSock::pushBuffer(), NLMISC::raiseToNextPowerOf2(), NLPACS::CGlobalRetriever::retrievePosition(), NLNET::CServerReceiveTask::run(), NLNET::CListenTask::run(), NLMISC::secondsToHumanReadable(), NL3D::CVisualCollisionManager::CStaticGrid::select(), NLNET::sendEMailCommand(), NL3D::CDriverGL::setDisplay(), NLSOUND::CSourceDSound::setEAXProperty(), NLSOUND::CListenerDSound::setEAXProperty(), NLSOUND::CListenerDSound::setEnvironment(), NLMISC::CFile::setRWAccess(), NL3D::CVisualCollisionEntity::snapToGround(), NLMISC::strlwr(), NLMISC::strupr(), NLPACS::testCirclePoint(), ucstring::toUtf8(), and NLMISC::IStream::xmlPush().

+

+ + + + +
+ + +
typedef const GLuint GLboolean * residences +
+
+ + + + + +
+   + + +

+ +

+Definition at line 220 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLshort s +
+
+ + + + + +
+   + + +

+ +

+Definition at line 977 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CChannelMixer::addChannel(), NLAIAGENT::CMainAgentScript::addDynamicAgent(), NLAIAGENT::CAgentScript::addDynamicAgent(), NLAIAGENT::CAgentScript::addSet(), NLAIAGENT::IVarName::addString(), NLAILOGIC::CInternalGoal::addSuccessor(), NLAILOGIC::CGoal::addSuccessor(), NL3D::CPatch::addTileLightmapPixelWithTLI(), NL3D::CZoneSymmetrisation::build(), NLMISC::CRGBA::buildFromHLS(), NLAISCRIPT::CCompilateur::buildObject(), NL3D::BuildTangentSpace(), NL3D::CPatchQuadBlock::buildTileTriangles(), NL3D::CZoneLighter::buildZoneInformation(), NL3D::CZoneLighter::calcSkyContribution(), NLAISCRIPT::CCompilateur::callFunction(), NLMISC::CBufFIFO::canFit(), NLAISCRIPT::CCancelGoalMsgClass::CCancelGoalMsgClass(), NLAISCRIPT::CConstraintStackComp::CConstraintStackComp(), NLAISCRIPT::CFactMsgClass::CFactMsgClass(), NLAISCRIPT::CFailureMsgClass::CFailureMsgClass(), NL3D::CFastHLSModifier::CFastHLSModifier(), NL3D::CFillStackNode::CFillStackNode(), NLAISCRIPT::CGetValueMsgClass::CGetValueMsgClass(), NLAISCRIPT::CGoalMsgClass::CGoalMsgClass(), NLPACS::CVector2s::checkCastSint16(), NLMISC::CFile::checkFileChange(), NLAIAGENT::CIdent::CIdent(), NLAIAGENT::CKeyAgent::CKeyAgent(), NLAIAGENT::CKeyObject::CKeyObject(), NL3D::CChannelMixer::cleanAll(), NLMISC::CPlane::clipPolygonBack(), NLMISC::CPlane::clipPolygonFront(), NLAISCRIPT::CMsgNotifyParentClass::CMsgNotifyParentClass(), CTCBTools< CKeyTCBQuat, NLMISC::CAngleAxis, std::map< TAnimationTime, CKeyTCBQuat > >::compileTCBEase(), NLMISC::computeBilinear(), NL3D::CPatch::computeContinousVertex(), NL3D::CPatch::computeDisplaceCornerSmooth(), NL3D::CPatch::computeDisplaceEdgeSmooth(), NL3D::CPatch::computeDisplaceInteriorSmooth(), NL3D::CPatch::computeDisplaceRaw(), NL3D::CPatch::computeDisplaceRawCoordinates(), NL3D::CPatch::computeDisplaceRawOnNeighbor(), NL3D::CPatch::computeNoise(), NL3D::CPatch::computeNormalCornerSmooth(), NL3D::CPatch::computeNormalEdgeSmooth(), NL3D::CPatch::computeNormalOnNeighbor(), NL3D::CTextContext::computeString(), NL3D::CFontManager::computeString(), NL3D::CTextContext::computeStringInfo(), NL3D::CFontManager::computeStringInfo(), NL3D::CPatch::computeTileLightmapPixel(), NL3D::CPatch::computeTileLightmapPixelAutomatic(), NL3D::CPatch::computeTileLightmapPixelPrecomputed(), NL3D::CPatch::computeVertex(), NL3D::CPatch::computeVertexButCorner(), NL3D::CTileBank::computeXRef(), NLAISCRIPT::COnChangeMsgClass::COnChangeMsgClass(), NLMISC::CRGBA::convertToHLS(), NL3D::CParamCoord::CParamCoord(), NL3D::CPSAttribMakerMemoryBase< sint32 >::CPSAttribMakerMemoryBase(), NLNET::CNamingClient::CServiceEntry::CServiceEntry(), NLAISCRIPT::CSetValueMsgClass::CSetValueMsgClass(), NLMISC::CSString::CSString(), NLAIAGENT::CStringVarName::CStringVarName(), NLAISCRIPT::CSuccessMsgClass::CSuccessMsgClass(), NL3D::CTextureFile::CTextureFile(), NL3D::CTextureFileUser::CTextureFileUser(), NL3D::CChannelMixer::dirtAll(), NL3D::CCloud::disp(), NLMISC::CBufFIFO::display(), NL3D::CInstanceGroup::displayDebugClusters(), NL3D::CVisualCollisionEntity::displayDebugGrid(), NLMISC::CBitMemStream::displayStream(), NLNET::CNetDisplayer::doDisplay(), NLMISC::CStdDisplayer::doDisplay(), NL3D::CPSShockWaveHelper::drawShockWave(), NLNET::EAccessDenied::EAccessDenied(), NLNET::EServiceNotFound::EServiceNotFound(), NLNET::ESocketConnectionFailed::ESocketConnectionFailed(), NL3D::CLandscapeVegetableBlockCreateContext::eval(), NL3D::CChannelMixer::eval(), NL3D::CChannelMixer::evalChannels(), CTrackKeyFramerBezier< CKeyT, T >::evalKey(), NLMISC::explode(), NLMISC::CMatrix::fastInvert33(), NLAISCRIPT::CCallPrint::format(), NLMISC::CBufFIFO::front(), NLMISC::CBufFIFO::frontLast(), NL3D::CPatchDLMContext::generate(), NLAIAGENT::CVolatilMemmory::getDebugString(), NLAIAGENT::CAgentOperation::getDebugString(), NLAIAGENT::CIndexVariant< T, indexMax, maxT >::getDebugString(), NLAIAGENT::CAgentWatchTimer::getDebugString(), NLAIAGENT::CPairType::getDebugString(), NLAIAGENT::CAgentScript::getDynamicAgent(), NLAIAGENT::CAgentScript::getDynamicName(), NLAIC::IBasicType::getInfo(), NL3D::CZoneLighter::getMaxPhi(), NLAIPYSERVER::CPyExport::getPathSeparator(), NLMISC::CMatrix::getRot(), NLMISC::CBitMemStream::getSerialItem(), NLNET::CUnifiedNetwork::getServiceName(), NLNET::CUnifiedNetwork::getServiceUnifiedName(), NL3D::CZoneLighter::getSkyContribution(), NLSOUND::CAudioMixerUser::getSourcesStats(), NLNET::_CUniTime::getStringUniTime(), NL3D::CLandscape::getTileLightMapUvInfo(), NL3D::CPatch::getTileLumelmapPixelPrecomputed(), NLAICHARACTER::IZone::haveCharacter(), NLAICHARACTER::CCharacterNoeud::haveCharacter(), NLAICHARACTER::CCharacterChild::haveCharacter(), NLMISC::CBSphere::include(), NL3D::CLandscapeVegetableBlock::init(), NLMISC::CBSphere::intersect(), NLMISC::CAABBox::intersect(), NLAIAGENT::CAgentScript::isa(), NL3D::CZoneLighter::isLumelOnEdgeMustBeOversample(), NLAIAGENT::IBaseGroupType::isMember(), NLAIAGENT::CIdent::load(), NLSOUND::CEnvEffect::load(), NLAISCRIPT::CCodeBrancheRun::load(), NLPACS::CRetrieverBank::loadRetriever(), NL3D::CPatch::modulateTileLightmapPixelWithTileColors(), NLMISC::CObjectVector< sint8, false >::myRealloc(), NLAISCRIPT::CCompilateur::nameMethodeProcessing(), NLMISC::CBigFile::CBNPFileComp::operator()(), ucstring::operator+=(), NLAIAGENT::CStringVarName::operator+=(), NLAIAGENT::CIndexedVarName::operator+=(), NLAIAGENT::CStringVarName::operator-=(), NLAIAGENT::CIndexedVarName::operator-=(), NLAIAGENT::CIndexedVarName::operator=(), NLAIAGENT::IListBasicManager::operator[](), NL3D::CHeatHaze::performHeatHaze(), NLMISC::CBufFIFO::pop(), NL3D::CZoneLighter::processZonePointLightRT(), NL3D::CZoneSymmetrisation::propagateTileState(), NLMISC::CBufFIFO::push(), NL3D::CTextureFar::rebuildPatch(), NLNET::CUdpSimSock::receive(), NL3D::CChannelMixer::refreshList(), NLAIAGENT::CAgentScript::removeDynamic(), NL3D::CCloudScape::render(), NL3D::CChannelMixer::resetSlots(), NLMISC::CObjectVector< sint8, false >::resize(), NLMISC::CBufFIFO::resize(), NLAISCRIPT::CStackPointer::restoreShift(), NLAIAGENT::CAgentOperation::runMethodBase(), NLAIAGENT::CAgentScript::runMethodBase(), NLAIAGENT::CActorScript::runMethodBase(), NLPACS::CVector2s::safeCastSint16(), NLSOUND::CSoundAnimation::save(), NLAISCRIPT::CAffOpCodeDebug::save(), NLSOUND::CEnvEffect::save(), NLAIAGENT::CIndexedVarName::saveClass(), NLLIGO::CZoneTemplate::serial(), NLLIGO::CZoneEdge::serial(), NLSOUND::UAudioMixer::TBackgroundFlags::serial(), NLLIGO::CTransition::serial(), NLMISC::CSString::serial(), NLSOUND::CSoundSerializer::serial(), NLSOUND::CSound::serial(), NLSOUND::CSimpleSound::serial(), NLPACS::CPrimitiveBlock::serial(), NLPACS::CPrimitiveDesc::serial(), NLAIAGENT::CMsgOStream::serial(), NLAIAGENT::CMsgIStream::serial(), NLNET::CLoginCookie::serial(), NLLIGO::CMaterial::serial(), NLNET::CInetAddress::serial(), NLAIC::CIdentType::serial(), NLSOUND::CEnvEffect::serial(), NLSOUND::TEnvEffectRoom::serial(), NLMISC::CEntityIdTranslator::CEntity::serial(), NLSOUND::CContextSound::serial(), NLSOUND::CComplexSound::serial(), NLSOUND::CSoundGroupSerializer::serial(), NL3D::CCameraInfo::serial(), NLSOUND::CBackgroundSoundManager::TFxZone::serial(), NLSOUND::CBackgroundSoundManager::TSoundData::serial(), NLSOUND::CBackgroundSoundManager::TBanksData::serial(), NLSOUND::CBackgroundSound::TSoundInfo::serial(), NLSOUND::CBackgroundSound::serial(), NLSOUND::CAudioMixerUser::TSampleBankHeader::serial(), NLSOUND::CAudioMixerUser::CControledSources::serial(), NLSOUND::CUserVarSerializer::serial(), NLSOUND::CEnvEffect::serialFileHeader(), NLMISC::CBitSet::setAll(), NL3D::CTextureFileUser::setFileName(), NL3D::CTextureFile::setFileName(), NL3D::CParticleSystem::setName(), NL3D::CAnimatedLightmap::setName(), NLAISCRIPT::CCompilateur::setParamVarName(), NL3D::CPSZoneRectangle::setScale(), NL3D::CPSZoneCylinder::setScale(), NL3D::CPSEmitterRectangle::setScale(), NL3D::IPSMover::setScale(), NLAIAGENT::IMessageBase::setSender(), NLAILOGIC::CInternalGoal::setSender(), NLAILOGIC::IGoal::setSender(), NLAISCRIPT::CStackPointer::setShift(), NLMISC::CAABBoxExt::setSize(), NLMISC::CAABBox::setSize(), NL3D::CParamCoord::setST(), NLAIAGENT::CVolatilMemmory::setState(), NLAIAGENT::CHashTimerManager::setState(), NLAIAGENT::IAgentInput::setState(), NL3D::CPatch::setupColorsFromTileFlags(), NL3D::CAnimationPlaylist::setupMixer(), NLMISC::CMatrix::slowInvert33(), NLMISC::CMatrix::slowInvert44(), NLMISC::CSString::splitFrom(), NLMISC::CSString::splitTo(), NLMISC::CQuatT< T >::squadrev(), NL3D::st2uv(), NLAIC::stringBuild(), NLMISC::stringFromVector(), NLNET::stringFromVectorPart(), NLNET::StringToEvent(), NL3D::CBezierPatch::subdivideS(), NLAIAGENT::IVarName::subString(), NLMISC::CBitSet::toString(), NL3D::CClipTrav::traverse(), NLPACS::CVector2s::unpack(), NLNET::uuencode(), NL3D::uv2st(), and NL3D::CAnimationSet::~CAnimationSet().

+

+ + + + +
+ + +
yy_size_t size +
+
+ + + + + +
+   + + +

+ +

+Definition at line 645 of file driver_opengl_extension_def.h. +

+Referenced by __declspec(), NLMEMORY::__declspec(), NLMISC::CBMSDbgInfo::addPoke(), NLMISC::CBMSDbgInfo::addSerial(), NLSOUND::CSourceDSound::advanceFill(), NLMISC::CObjectArenaAllocator::alloc(), NLMISC::CHeapMemory::allocate(), NLMISC::CHeapAllocator::allocate(), NL3D::CVertexArrayRangeMapObjectATI::allocate(), NL3D::CVertexArrayRangeATI::allocate(), NL3D::CVertexArrayRangeNVidia::allocate(), NLMISC::CHeapAllocator::allocateBlock(), NL3D::CVertexArrayRangeATI::allocateVB(), NL3D::CVertexArrayRangeNVidia::allocateVB(), NLPACS::CCollisionSurfaceTemp::allocEdgeCollideNode(), NL3D::CMeshGeom::applySkin(), NLNET::CCallbackNetBase::baseUpdate(), NL3D::BlurBytesTab(), NL3D::CHLSColorTexture::buildColorVersion(), NL3D::BuildCubeMapTex(), NL3D::BuildCubeMapTexLuminance(), NLNET::cbnbMessageAskAssociations(), NLNET::cbnbMessageRecvAssociations(), NLNET::cbRegisterBroadcast(), NLAISCRIPT::CCodeBrancheRun::CCodeBrancheRun(), NLAISCRIPT::CCompilateur::CCompilateur(), NLAILOGIC::CFact::CFact(), NLAIAGENT::CMsgIStream::CMsgIStream(), NL3D::CZoneLighter::compilePointLightRT(), NL3D::CInstanceLighter::compilePointLightRT(), NL3D::CHLSColorTexture::compressBlockRGB(), NL3D::CPSFaceLookAtHelper::computeOrientationVectors(), NL3D::ComputeRibbonSlice(), NL3D::ComputeTexturedRibbonMesh(), NL3D::ComputeUntexturedRibbonMesh(), NLMISC::CFile::copyFile(), NLAISCRIPT::CParam::CParam(), NLMISC::CPolygon2D::CPolygon2D(), NL3D::CQuadTree< T >::create(), NLPACS::CQuadGrid< T >::create(), NL3D::CQuadGrid< T >::create(), NLMISC::CSharedMemory::createSharedMemory(), NL3D::CVertexArrayRangeMapObjectATI::createVBHardGL(), NL3D::CVertexArrayRangeATI::createVBHardGL(), NL3D::CVertexArrayRangeNVidia::createVBHardGL(), NL3D::CTextureNear::CTextureNear(), NLAILOGIC::CValueSet::CValueSet(), NLMEMORY::CHeapAllocator::debugGetAllocatedMemoryByCategory(), NLMISC::CHeapAllocator::debugStatisticsReport(), NL3D::CPSRibbonBase::deleteElement(), NL3D::CPSUtil::displayArrow(), NL3D::CPSUtil::displayBasis(), NL3D::CPSLocatedBindable::displayIcon2d(), NL3D::CRadixSort< T >::doSort(), NL3D::CPSFaceHelper::drawFaces(), NL3D::CPSFanLightHelper::drawFanLight(), NL3D::CPSFaceLookAtHelper::drawLookAt(), NL3D::CPSFaceLookAtHelper::drawLookAtAlignOnMotion(), NL3D::CPSConstraintMeshHelper::drawMeshs(), NL3D::CPSConstraintMeshHelper::drawPrerotatedMeshs(), NL3D::CPSShockWaveHelper::drawShockWave(), NL3D::CPSRibbonBase::dupRibbon(), NLSOUND::ILoader::fillBuffer(), NLSOUND::ILoader::fillBufferPart(), NLSOUND::CSourceDSound::fillData(), NLSOUND::CSourceDSound::fillSilence(), NLNET::CBufSock::flush(), NLMISC::COXml::flushContentString(), NLMISC::CObjectArenaAllocator::free(), NLMISC::CHeapMemory::free(), NLMISC::CHeapAllocator::free(), NLMISC::CBufFIFO::frontLast(), NLGEORGES::CFormElmArray::getArraySize(), NLGEORGES::CFormElm::getArraySize(), NL3D::CFontGenerator::getBitmap(), NLMEMORY::CHeapAllocator::getBlockAllocationMode(), NLMEMORY::CHeapAllocator::getBlockSize(), NLAIAGENT::CAgentScript::getDynamicAgent(), NLMEMORY::CHeapAllocator::getMainBlockCount(), NL3D::CPatchDLMContext::getMemorySize(), NL3D::CAsyncTextureManager::getNextTextureToUpLoad(), NLMISC::CEvalNumExpr::getNextToken(), getSHA1(), NLSOUND::CSampleBank::getSize(), NL3D::CFontGenerator::getSizes(), NLAISCRIPT::CScriptDebugSourceFile::getSourceBuffer(), NLGEORGES::CFormElmStruct::getStructSize(), NLGEORGES::CFormElm::getStructSize(), NLGEORGES::CFormDfn::getSubDfn(), NL3D::CPSFanLight::getVBnIB(), NL3D::CPSShockWave::getVBnPB(), H_AUTO_DECL(), NLSOUND::CComplexSound::importForm(), NLSOUND::CBackgroundSound::importForm(), NLSOUND::CSampleBank::init(), NLSOUND::CAudioMixerUser::init(), NLMISC::CHeapMemory::initHeap(), NLPACS::CGlobalRetriever::initRetrieveTable(), NLAISCRIPT::CCompilateur::InitStream(), NL3D::CCluster::isIn(), NLAISCRIPT::yyFlexLexer::LexerOutput(), NL3D::CZoneLighter::light(), NLAIAGENT::CAgentScript::load(), NLMISC::CBitmap::loadSize(), NLSOUND::CSoundDriverAL::loadWavFile(), NLSOUND::CSourceDSound::lock(), NL3D::CQuadEffect::makeRasters(), NLMISC::CFile::moveFile(), NL3D::NormalizeDsDt(), NL3D::NormalizeDsDtAsRGBA(), NL3D::CMatrix3x4SSEArray::operator=(), NL3D::CPSBrownianForce::performDynamic(), NL3D::CPSCylindricVortex::performDynamic(), NL3D::CPSSpring::performDynamic(), NL3D::CPSCentralGravity::performDynamic(), NL3D::CPSUtil::print(), NLAISCRIPT::CCodeBrancheRunDebug::printSourceCodeLine(), NL3D::CPSEmitter::processRegularEmission(), NL3D::CPSEmitter::processRegularEmissionConsistent(), NL3D::CPSEmitter::processRegularEmissionConsistentWithNoLOD(), NL3D::CPSEmitter::processRegularEmissionWithNoLOD(), NLNET::CBufNetBase::pushMessageIntoReceiveQueue(), NLMISC::CBitmap::readDDS(), NLSOUND::CSoundGroupSerializer::readGeorges(), NLSOUND::CUserVarSerializer::readGeorges(), NLMISC::CI18N::readTextBuffer(), NLMISC::CBitmap::readTGA(), NLSOUND::CBufferDSound::readWavBuffer(), NL3D::CPSSound::removeAllSources(), NL3D::CPatch::resetCompressedLumels(), NLMISC::CStringIdArray::resize(), NL3D::CPSZoneRectangle::resize(), NL3D::CPSZoneCylinder::resize(), NL3D::CPSZoneDisc::resize(), NL3D::CPSZoneSphere::resize(), NL3D::CPSZonePlane::resize(), NL3D::CPSTailDot::resize(), NL3D::CPSSound::resize(), NL3D::CPSRibbonLookAt::resize(), NL3D::CPSRibbonBase::resize(), NL3D::CPSRibbon::resize(), NL3D::CPSQuad::resize(), NL3D::CPSConstraintMesh::resize(), NL3D::CPSMesh::resize(), NL3D::CPSLight::resize(), NL3D::CPSTurbul::resize(), NL3D::CPSBrownianForce::resize(), NL3D::CPSFluidFriction::resize(), NL3D::CIsotropicForceT< CPSFluidFrictionFunctor >::resize(), NL3D::CPSForceIntensityHelper::resize(), NL3D::CPSCylindricVortex::resize(), NL3D::CPSFanLight::resize(), NL3D::CPSFace::resize(), NL3D::CPSSphericalEmitter::resize(), NL3D::CPSEmitterRectangle::resize(), NL3D::CPSEmitter::resize(), NL3D::CPSDot::resize(), NL3D::CSnappedVector< T, snapPower >::resize(), NLMISC::CMemStream::resize(), NL3D::CPSRotated2DParticle::resizeAngle2D(), NL3D::CPSColoredParticle::resizeColor(), NL3D::CPSForceIntensity::resizeForceIntensity(), NL3D::CPSRotated3DPlaneParticle::resizePlaneBasis(), NL3D::CPSSizedParticle::resizeSize(), NL3D::CPSTexturedParticle::resizeTextureIndex(), NL3D::CRadixSort< T >::reverse_sort(), NL3D::CTileBorder::rotate(), NLSOUND::CAsyncFileManagerSound::CLoadWavFile::run(), NLAILOGIC::CVarSet::save(), NLAILOGIC::CValueSet::save(), NLAILOGIC::IBaseOperator::save(), NLAIAGENT::CLocalMailBox::save(), NLAISCRIPT::CAgentClass::save(), NLAIAGENT::CVectorGroupType::save(), NLAIAGENT::CGroupType::save(), NLAIFUZZY::CFuzzyVar::save(), NLAIFUZZY::CFuzzyRule::save(), NLAILOGIC::CFactBase::save(), NLAILOGIC::CBoolOperator::save(), NLAIAGENT::IAgentComposite::save(), NLAIAGENT::IConnectIA::save(), NLAIAGENT::CStringVarName::save(), NLAIAGENT::CAgentScript::save(), NLMISC::searchLowerBound(), NLNET::CCallbackServer::sendAllMyAssociations(), NLNET::sendEmail(), NLNET::sendEMailCommand(), NLNET::CUdpSock::sendTo(), NL3D::CWaterPoolManager::serial(), NL3D::CTileFarBank::CTileFar::serial(), NL3D::CPSLocated::serial(), NL3D::CPSAttrib< T >::serial(), NL3D::CSnappedVector< T, snapPower >::serial(), NL3D::CPatch::serial(), NLMISC::COXml::serial(), NLSOUND::CSoundGroupSerializer::serial(), NLSOUND::CAudioMixerUser::CControledSources::serial(), NLMISC::COXml::serialSeparatedBufferOut(), NLSOUND::CListenerDSound::setEnvironment(), NLSOUND::CListenerAL::setEnvironment(), NLGEORGES::CFormDfn::setNumEntry(), NLGEORGES::CFormDfn::setNumParent(), NLMEMORY::CHeapAllocator::setOutOfMemoryMode(), NL3D::CTileFarBank::CTileFar::setPixels(), NL3D::CShadowMapManager::setQuadGridSize(), NL3D::CSceneUser::setShadowMapTextureSize(), NL3D::CScene::setShadowMapTextureSize(), NL3D::CWaterHeightMap::setSize(), NLAILOGIC::CValueSet::setSize(), NL3D::CPSSizedParticle::setSize(), NL3D::CFlareShape::setSize(), NLSOUND::CBufferAL::setSize(), NLSOUND::IBuffer::setSize(), NLNET::CBufSock::setSizeFlushTrigger(), NLNET::CBufServer::setSizeFlushTrigger(), NLNET::CBufClient::setSizeFlushTrigger(), NL3D::CPSSizedParticle::setSizeScheme(), NL3D::CDriverGL::setupTextureEx(), NL3D::CPSZoneRectangle::show(), NL3D::CPSEmitterRectangle::showTool(), NL3D::CPSEmitter::showTool(), NL3D::CRadixSort< T >::sort(), NLSOUND::CBackgroundSoundManager::split(), NL3D::CPSSound::step(), NL3D::CPSEmitter::step(), NLMISC::stringFromVector(), NLSOUND::TEnvEffectRoom::TEnvEffectRoom(), ucstring::toString(), NL3D::CFlareModel::traverseRender(), NL3D::CVertexBufferHardGLATI::unlock(), NLSOUND::CClusteredSound::update(), NL3D::CPSRibbonBase::updateGlobals(), NL3D::CPSLocated::updateLife(), NL3D::CPSMesh::updatePos(), NL3D::CPSShockWave::updateVbColNUVForRender(), NL3D::CPSQuad::updateVbColNUVForRender(), and NLAISCRIPT::yyFlexLexer::yy_create_buffer().

+

+ + + + +
+ + +
typedef GLuint src +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1124 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CHLSColorTexture::addMask(), NL3D::CMeshMRMSkinnedGeom::applyArrayShadowSkin(), NL3D::CMeshMRMGeom::applyArrayShadowSkin(), NL3D::applyArraySkinNormalT(), NL3D::CDriverGLStates::blendFunc(), NL3D::CPatchDLMContext::blendTileToTexture(), NLMISC::CBitmap::blit(), NL3D::BlurBytesTab(), NL3D::CLodCharacterTmpBitmap::build(), NL3D::BuildDsDt(), NL3D::BuildDsDtAsRGBA(), NL3D::CHLSColorTexture::compressBlockRGB(), NL3D::CPatch::computeNearBlockLightmap(), NL3D::CPatchDLMContext::computeTextureFar(), NL3D::CPatch::computeTileLightmapEdgePrecomputed(), NL3D::CFastHLSModifier::convertDDSBitmap(), NL3D::CFastHLSModifier::convertDDSBitmapDXTC1Or1A(), NL3D::CFastHLSModifier::convertDDSBitmapDXTC3Or5(), NL3D::CFastHLSModifier::convertRGBABitmap(), NLMISC::CFile::copyFile(), NL3D::CTextureDLM::copyRect(), NL3D::CPatch::copyTileFlagsFromPatch(), NLMISC::CPolygon2D::CPolygon2D(), NL3D::CPSAttribMakerMemoryBase< sint32 >::CPSAttribMakerMemoryBase(), NLPACS::UPrimitiveBlock::createPrimitiveBlock(), NLSOUND::CSoundDriverDSound::createSource(), NL3D::CTextureGrouped::CTextureGrouped(), NL3D::CTileNoise::CTileNoise(), NLMISC::CBitmap::decompressDXT1(), NLMISC::CBitmap::decompressDXT3(), NLMISC::CBitmap::decompressDXT5(), NL3D::CTextureEmboss::doGenerate(), NL3D::CTextureFont::dumpTextureFont(), NL3D::CTextureGrouped::duplicate(), NL3D::CPSRibbonBase::dupRibbon(), NLMISC::ERenameError::ERenameError(), NLMISC::explode(), NLSOUND::CBufferDSound::fillBuffer(), NLSOUND::CBufferAL::fillBuffer(), NL3D::CVegetableVBAllocator::flushVertex(), NL3D::CMeshMRMSkinnedGeom::CPackedVertexBuffer::getPos(), getStringUntilCR(), NL3D::getUnpackLumelBlock(), NL3D::CPSValueGradientFunc< sint32 >::getValues(), NL3D::CPSForce::integrate(), NL3D::CPSBrownianForce::integrate(), NL3D::CPSGravity::integrate(), NL3D::CPSBrownianForce::integrateSingle(), NL3D::CPSGravity::integrateSingle(), CVPParser::isInputUsed(), NL3D::CWaterHeightMap::makeCpy(), NL3D::MakeProj(), NLMISC::CFastMem::memcpySSE(), NL3D::mulAdd(), NL3D::mulAddD(), NL3D_asmExpandLineColor565(), NL3D_asmExpandLineColor8888(), NL3D::NormalizeDsDt(), NL3D::NormalizeDsDtAsRGBA(), NL3D::CTileNoise::operator=(), NL3D::CTextureGrouped::operator=(), CVPParser::parse(), parseUInt(), NLMISC::CFastMem::precache(), NLMISC::CFastMem::precacheMMX(), NLMISC::CFastMem::precacheSSE(), NLMISC::CI18N::readTextBuffer(), NL3D::CMeshMRMSkinnedGeom::renderShadowSkinPrimitives(), NL3D::CMeshMRMGeom::renderShadowSkinPrimitives(), NL3D::CSnappedVector< T, snapPower >::reserve(), NLSOUND::CAudioMixerUser::reset(), NLMISC::rotateCCW(), NL3D::CMaterialUser::setBlendFunc(), NL3D::CInstanceMaterialUser::setBlendFunc(), NL3D::CMaterial::setBlendFunc(), NL3D::CDriverGL::setConstant(), NL3D::CMeshMRMSkinnedGeom::CPackedVertexBuffer::CPackedVertex::setNormal(), NLSOUND::CTrack::setSource(), NL3D::CMaterialUser::texEnvArg0Alpha(), NL3D::CMaterial::texEnvArg0Alpha(), NL3D::CMaterialUser::texEnvArg0RGB(), NL3D::CMaterial::texEnvArg0RGB(), NL3D::CMaterialUser::texEnvArg1Alpha(), NL3D::CMaterial::texEnvArg1Alpha(), NL3D::CMaterialUser::texEnvArg1RGB(), NL3D::CMaterial::texEnvArg1RGB(), NL3D::CPatch::unpackLumelBlock(), and NLSOUND::CSourceDSound::xfade().

+

+ + + + +
+ + +
typedef GLenum storagetype +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1126 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLenum GLsizei stride +
+
+ + + + + +
+   + + +

+ +

+Definition at line 244 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CPatch::addTileLightmapEdgeWithTLI(), NL3D::CPatch::addTileLightmapWithTLI(), NLLIGO::CZoneRegion::basicSet(), NL3D::CPSRibbonBase::computeHermitteCstSizeRibbon(), NL3D::CPSRibbonBase::computeHermitteRibbon(), NL3D::CPSRibbonBase::computeLinearCstSizeRibbon(), NL3D::CPSRibbonBase::computeLinearRibbon(), NL3D::CPatch::computeNearBlockLightmap(), NL3D::CPSRibbonBase::computeRibbon(), NL3D::CPatch::computeTileLightmap(), NL3D::CPatch::computeTileLightmapAutomatic(), NL3D::CPatch::computeTileLightmapEdge(), NL3D::CPatch::computeTileLightmapEdgeAutomatic(), NL3D::CPatch::computeTileLightmapEdgePrecomputed(), NL3D::CPatch::computeTileLightmapPrecomputed(), NL3D::DrawDot(), NL3D::CPSFaceHelper::drawFaces(), NL3D::CPSFanLightHelper::drawFanLight(), NL3D::CPSFaceLookAtHelper::drawLookAt(), NL3D::CPSFaceLookAtHelper::drawLookAtAlignOnMotion(), NL3D::FillBufUsingSubdiv(), NL3D::FillQuadCoords(), NL3D::FillQuadCoordsLocalTime(), NL3D::CSegRemanence::CRibbon::fillVB(), NL3D::CPatch::getTileLumelmapPrecomputed(), NL3D::CPSLocated::integrateSingle(), NL3D::CPSBrownianForce::integrateSingle(), NL3D::CPSGravity::integrateSingle(), NL3D::CPSPlaneBasisFollowSpeed::make(), NL3D::CPSAttribMakerMemoryBase< sint32 >::make(), NL3D::CPSAttribMakerT< uint32, CPSValueBlendFunc< uint32 > >::make(), NL3D::CPSAttribMakerBinOp< T >::make(), NL3D::CPSPlaneBasisFollowSpeed::make4(), NL3D::CPSAttribMakerMemoryBase< sint32 >::make4(), NL3D::CPSAttribMakerT< uint32, CPSValueBlendFunc< uint32 > >::make4(), NL3D::CPSAttribMakerBinOp< T >::make4(), NL3D::CPSAttribMakerT< uint32, CPSValueBlendFunc< uint32 > >::make4ByIterator(), NL3D::CPSAttribMakerBinOp< T >::make4Private(), NL3D::Make4Private(), NL3D::CPSAttribMakerT< uint32, CPSValueBlendFunc< uint32 > >::makeByIterator(), NL3D::CWaterHeightMap::makeCpy(), NL3D::CPSPlaneBasisFollowSpeed::makeN(), NL3D::CPSAttribMakerMemoryBase< sint32 >::makeN(), NL3D::CPSAttribMakerT< uint32, CPSValueBlendFunc< uint32 > >::makeN(), NL3D::CPSAttribMakerBinOp< T >::makeN(), NL3D::CPSAttribMakerT< uint32, CPSValueBlendFunc< uint32 > >::makeNByIterator(), NL3D::CPSAttribMakerBinOp< T >::makeNPrivate(), NL3D::MakeNPrivate(), NL3D::CPSAttribMakerBinOp< T >::makePrivate(), NL3D::MakePrivate(), NL3D::CPatch::modulateTileLightmapEdgeWithTileColors(), NL3D::CPatch::modulateTileLightmapWithTileColors(), NL3D::SetupWaterVertex(), NL3D::CPSShockWave::updateVbColNUVForRender(), and NL3D::CPSQuad::updateVbColNUVForRender().

+

+ + + + +
+ + +
typedef GLshort GLshort t +
+
+ + + + + +
+   + + +

+ +

+Definition at line 985 of file driver_opengl_extension_def.h. +

+Referenced by NLAIAGENT::CAgentWatchTimer::addAttrib(), NLAIAGENT::CMainAgentScript::addDynamicAgent(), NLAIAGENT::CAgentScript::addDynamicAgent(), NLGEORGES::CFileHeader::addLog(), NLMISC::CStopWatch::addMeasurement(), NLAIC::CIdentType::addObjectType(), NL3D::CPatch::addTileLightmapPixelWithTLI(), NLMISC::CStopWatch::addTime(), NL3D::CAnimation::allTrackLoop(), NLAIAGENT::CAgentWatchTimer::attach(), NL3D::CZoneSymmetrisation::build(), NL3D::CPatchQuadBlock::buildTileTriangles(), NLAISCRIPT::CAgentClass::buildVMethode(), NL3D::CZoneLighter::buildZoneInformation(), NLAIAGENT::CAgentClockTimer::CAgentClockTimer(), NLAIAGENT::CAgentManagerTimer::CAgentManagerTimer(), NLAIAGENT::CAgentNumber::CAgentNumber(), NLAIAGENT::CAgentScript::CAgentScript(), NLAIAGENT::CAgentTimerHandle::CAgentTimerHandle(), NLAIAGENT::CAgentWatchTimer::CAgentWatchTimer(), NL3D::CZoneLighter::calcSkyContribution(), NLAISCRIPT::CCompilateur::castVariable(), NL3D::CFillStackNode::CFillStackNode(), NLPACS::CMoveSurfaceDesc::CMoveSurfaceDesc(), NLMISC::computeBilinear(), NL3D::CPatch::computeContinousVertex(), NL3D::CPatch::computeDisplaceCornerSmooth(), NL3D::CPatch::computeDisplaceEdgeSmooth(), NL3D::CPatch::computeDisplaceInteriorSmooth(), NL3D::CPatch::computeDisplaceRaw(), NL3D::CPatch::computeDisplaceRawCoordinates(), NL3D::CPatch::computeDisplaceRawOnNeighbor(), NL3D::CPatch::computeNoise(), NL3D::CPatch::computeNormalCornerSmooth(), NL3D::CPatch::computeNormalEdgeSmooth(), NL3D::CPatch::computeNormalOnNeighbor(), NL3D::CPatch::computeTileLightmapPixel(), NL3D::CPatch::computeTileLightmapPixelAutomatic(), NL3D::CPatch::computeTileLightmapPixelPrecomputed(), NL3D::CPatch::computeVertex(), NL3D::CPatch::computeVertexButCorner(), NL3D::CTileBank::computeXRef(), NL3D::CParamCoord::CParamCoord(), NLAIAGENT::CGroupType::cpy(), NLAIAGENT::CAgentScript::createComponents(), NLMISC::CSerialCommand::CSerialCommand(), NLAIAGENT::CAgentWatchTimer::detach(), NL3D::CVisualCollisionEntity::displayDebugGrid(), NLPACS::CGlobalRetriever::doMove(), NLMISC::EAllocationFailure::EAllocationFailure(), NL3D::EDruOpenglDriverCantCreateDriver::EDruOpenglDriverCantCreateDriver(), NL3D::EDruOpenglDriverCorrupted::EDruOpenglDriverCorrupted(), NLMISC::EReallocationFailed::EReallocationFailed(), NLSOUND::ESoundDriverCantCreateDriver::ESoundDriverCantCreateDriver(), NLSOUND::ESoundDriverCorrupted::ESoundDriverCorrupted(), NL3D::CLandscapeVegetableBlockCreateContext::eval(), NL3D::CTrackSampledCommon::evalTime(), NL3D::CPatchDLMContext::generate(), NLNET::CLoginCookie::generateKey(), NL3D::CAnimation::getBeginTime(), NLAIAGENT::CHashTimerManager::getDebugString(), NLAIAGENT::CVolatilMemmory::getDebugString(), NLAISCRIPT::CLibTest::getDebugString(), NLAIC::CBinaryType::getDebugString(), NLAIAGENT::COperatorScript::getDebugString(), NLAIAGENT::CAgentOperation::getDebugString(), NLAIAGENT::CSetValueMsg::getDebugString(), NLAIAGENT::COnChangeMsg::getDebugString(), NLAIAGENT::CNotifyParentScript::getDebugString(), NLAIAGENT::CMessageGroup::getDebugString(), NLAIAGENT::CCancelGoalMsg::getDebugString(), NLAIAGENT::CGoalMsg::getDebugString(), NLAIAGENT::CGetValueMsg::getDebugString(), NLAIAGENT::CFactMsg::getDebugString(), NLAIAGENT::CFailureMsg::getDebugString(), NLAIAGENT::CSuccessMsg::getDebugString(), NLAIAGENT::IMessageBase::getDebugString(), NLAINIMAT::CMHiCSagent::getDebugString(), NLAINIMAT::CMHiCSbase::getDebugString(), NLAINIMAT::CMotivationEnergy::getDebugString(), NLAIAGENT::CMessageScript::getDebugString(), NLAIAGENT::CLocalMailBox::getDebugString(), NLAIAGENT::IListBasicManager::getDebugString(), NLAISCRIPT::CCallPrint::getDebugString(), NLAISCRIPT::COperatorClass::getDebugString(), NLAISCRIPT::CMessageClass::getDebugString(), NLAISCRIPT::CManagerClass::getDebugString(), NLAISCRIPT::CAgentClass::getDebugString(), NLAISCRIPT::CMethodeName::getDebugString(), NLAISCRIPT::CParam::getDebugString(), NLAISCRIPT::CSeqFsmClass::getDebugString(), NLAISCRIPT::CFsmClass::getDebugString(), NLAISCRIPT::CActorClass::getDebugString(), NLAIAGENT::CLocWordNumRef::getDebugString(), NLAILOGIC::CGoalStack::getDebugString(), NLAIAGENT::CSeqFsmScript::getDebugString(), NLAIAGENT::CFsmScript::getDebugString(), NLAISCRIPT::CCodeContext::getDebugString(), NLAISCRIPT::CCodeBrancheRun::getDebugString(), NLAINIMAT::CActionClassifiers::getDebugString(), NLAINIMAT::CClassifierSystem::getDebugString(), NLAILINK::IOTrace::getDebugString(), NLAIAGENT::IAgent::getDebugString(), NLAIAGENT::CLibTimerManager::getDebugString(), NLAIAGENT::CAgentTimerHandle::getDebugString(), NLAIAGENT::CAgentWatchTimer::getDebugString(), NLAIAGENT::CAgentManagerTimer::getDebugString(), NLAIAGENT::CAgentScript::getDebugString(), NLAIAGENT::CProxyAgentMail::getDebugString(), NLAIAGENT::CLocalAgentMail::getDebugString(), NLAIAGENT::CActorScript::getDebugString(), NLAIAGENT::CActor::getDebugString(), NLAIC::IPointerGestion::getDebugString(), NL3D::CAnimation::getEndTime(), NLAIC::CRegistry::getFactory(), NL3D::CZoneLighter::getMaxPhi(), NLAIC::CRegistry::getNumIdent(), NLAISCRIPT::CAgentClass::getPrivateMember(), NLLIGO::CPrimZone::getSegmentDist(), NL3D::CZoneLighter::getSkyContribution(), NL3D::CLandscape::getTileLightMapUvInfo(), NL3D::CPatch::getTileLumelmapPixelPrecomputed(), NLAIAGENT::CVolatilMemmory::init(), NL3D::CLandscapeVegetableBlock::init(), NL3D::CPSAttrib< T >::insert(), NLAISCRIPT::CVarPStackParam::isEqual(), NLAISCRIPT::CVarPStack::isEqual(), NLAIAGENT::CObjectIdent::isEqual(), NLAIAGENT::CPairType::isEqual(), NLAIAGENT::CStringType::isEqual(), NL3D::CZoneLighter::isLumelOnEdgeMustBeOversample(), NLAIAGENT::CMessageScript::isMember(), NLAISCRIPT::CCallPrint::isMember(), NLAIAGENT::IVector::isMember(), NLAIAGENT::IMessageBase::load(), NL3D::CPatch::modulateTileLightmapPixelWithTileColors(), NL3D::CHLSTextureBank::CTextureInstanceHandle::operator<(), NL3D::CHLSTextureBank::CTextureInstance::operator<(), NL3D::CHLSTextureBank::CTextureInstanceHandle::operator<=(), NL3D::CHLSTextureBank::CTextureInstance::operator<=(), NL3D::CAnimationOptimizer::optimizeQuatTrack(), NL3D::CAnimationOptimizer::optimizeVectorTrack(), NL3D::CZoneLighter::processZonePointLightRT(), NL3D::CZoneSymmetrisation::propagateTileState(), NL3D::CSnappedVector< T, snapPower >::push_back(), NL3D::CTextureFar::rebuildPatch(), NLAIC::CRegistry::registerClass(), NLAIAGENT::CAgentManagerTimer::CRunTimer::run(), NLAIAGENT::CVolatilMemmory::runMessage(), NLAIAGENT::IMessageBase::runMethodeMember(), NLAIAGENT::IBasicAgent::runMethodeMember(), NLAISCRIPT::CLdbMemberOpCode::runOpCode(), NLAIAGENT::CAgentScript::runTellParentNotify(), NL3D::CAnimationOptimizer::sampleQuatTrack(), NL3D::CAnimationOptimizer::sampleVectorTrack(), NLAIAGENT::IMessageBase::save(), NLAIAGENT::IRefrence::save(), NLNET::sendAdminEmail(), NLAIAGENT::CAgentScript::sendMessage(), NLNET::CUdpSimSock::sendUDP(), NL3D::CPSLocated::serial(), NLAIAGENT::CAgentScript::setAgentManager(), NLAISCRIPT::CCompilateur::setParamVarName(), NLNET::CPacsClient::setPrimitiveType(), NLNET::CPacsClient::setReactionType(), NL3D::CParamCoord::setST(), NLAIAGENT::CAgentScript::setStaticMember(), NL3D::CCloud::setTex3DTemp(), NL3D::CCloud::setTexClamp(), NL3D::CTextureCube::setTexture(), NLNET::CPacsClient::setTriggerType(), NLAIAGENT::CAgentNumber::setTypeAt(), NLAIAGENT::CLocWordNumRef::setTypeAt(), NLAIAGENT::CNumericIndex::setTypeAt(), NLAIAGENT::IRefrence::setTypeAt(), NL3D::CPatch::setupColorsFromTileFlags(), SHA1ProcessMessageBlock(), NLMISC::CQuatT< T >::slerp(), NLMISC::CQuatT< T >::squad(), NLMISC::CQuatT< T >::squadrev(), NL3D::st2uv(), NL3D::CBezierPatch::CBezierCurve::subdivide(), NL3D::CBezierPatch::subdivideT(), NLPACS::CEdgeCollide::testCircleMove(), NLPACS::CGlobalRetriever::testCollisionWithCollisionChains(), NLPACS::CGlobalRetriever::testMovementWithCollisionChains(), NL3D::CPointLightModel::traverseLight(), NL3D::CWaterModel::traverseRender(), NL3D::uv2st(), and NLAIAGENT::CAgentTimerHandle::~CAgentTimerHandle().

+

+ + + + +
+ + +
typedef GLuint GLenum GLenum transform +
+
+ + + + + +
+   + + +

+ +

+Definition at line 243 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CPSConstraintMesh::serial(), and NL3D::CDriverGL::setConstantMatrix().

+

+ + + + +
+ + +
typedef GLenum type +
+
+ + + + + +
+   + + +

+ +

+Definition at line 244 of file driver_opengl_extension_def.h. +

+Referenced by NLAIAGENT::CAgentScript::addDynamicAgent(), NLMISC::CBMSDbgInfo::addPoke(), NLMISC::CBMSDbgInfo::addSerial(), NL3D::CVertexBuffer::addValueEx(), NL3D::CPatch::appendFarVertexToRenderList(), NLGEORGES::CFormElm::arrayDeleteNodeByName(), NLGEORGES::CFormElm::arrayInsertNodeByName(), NLMISC::CSheetId::build(), NLMISC::CSheetId::buildIdVector(), NLMISC::CEntityId::CEntityId(), NLGEORGES::CFormElmArray::CFormElmArray(), NL3D::CTileSet::checkTile128(), NL3D::CTileSet::checkTile256(), NL3D::CTileSet::checkTileTransition(), NL3D::CLandscapeVBAllocator::CLandscapeVBAllocator(), NL3D::CTile::clearTile(), NL3D::CTileSet::clearTile128(), NL3D::CTileSet::clearTile256(), NL3D::CTileSet::clearTransition(), NLGEORGES::CMyEvalNumExpr::CMyEvalNumExpr(), NLAIAGENT::CObjectType::CObjectType(), NLMISC::CBitmap::convertToType(), NLNET::createMessage(), NLGEORGES::CFormElm::createNodeByName(), NL3D::CTileBank::CTileXRef::CTileXRef(), NL3D::CTileSet::deleteBordersIfLast(), NLGEORGES::CFormElm::deleteNodeByName(), NLMISC::CSheetId::display(), NL3D::CTileFarBank::CTileFar::erasePixels(), NLAISCRIPT::IOpType::evalParam(), NLGEORGES::CMyEvalNumExpr::evalValue(), NLMISC::CSheetId::fileExtensionFromType(), NLMISC::CEntityId::fromString(), NLGEORGES::CFormDfn::getEntryType(), NL3D::CTileSet::getExistingTransitionTile(), NLGEORGES::CFormElm::getIternalNodeByName(), NLMISC::CEntityId::getNewEntityId(), NLGEORGES::CFormElm::getNodeByName(), NL3D::CPatch::getNumTessBlock(), NL3D::CTileFarBank::CTileFar::getPixels(), NL3D::CTileFarBank::CTileFar::getSize(), NL3D::CVisualCollisionEntity::getSurfaceInfo(), NL3D::CPatchInfo::getTileSymmetryRotate(), NL3D::CPatch::getTileUvInfo(), NL3D::CTileBank::getTileXRef(), NLGEORGES::CType::getUIName(), NLGEORGES::CFormElm::getValueByName(), H_AUTO_DECL(), NL3D::CVegetableVBAllocator::init(), NL3D::CTileFarBank::CTileFar::isFill(), NLAISCRIPT::CCompilateur::isValidateVarName(), NLMISC::CSheetId::loadSheetId(), NLGEORGES::CFormLoader::loadType(), NLPACS::CPrimitiveWorldImage::precalcBB(), NLPACS::CPrimitiveWorldImage::precalcPos(), NLAISCRIPT::CCompilateur::processingVar(), NL3D::CZoneSymmetrisation::propagateTileState(), NLPACS::CPrimitiveWorldImage::reaction(), NLGEORGES::CType::read(), NLLIGO::CPrimitiveClass::read(), NLLIGO::IPrimitive::read(), NLGEORGES::CFormElmAtom::read(), NLGEORGES::CFormDfn::read(), NLAISCRIPT::reinitClass(), NL3D::CPatch::removeFarVertexFromRenderList(), NLMISC::CBitmap::reset(), NLAISCRIPT::CConstraintMethode::run(), NLPACS::CGlobalRetriever::selectInstances(), NL3D::CTileBank::serial(), NLSOUND::CSoundSerializer::serial(), NL3D::CTileSet::setBorder(), NLPACS::CPrimitiveWorldImage::setGlobalPosition(), NLAISCRIPT::CConstraintMethode::setOpCode(), NL3D::CZoneSymmetrisation::setOrientedTileState(), NL3D::CTileFarBank::CTileFar::setPixels(), NLNET::CPacsClient::setPrimitiveType(), NLPACS::CMovePrimitive::setPrimitiveType(), NLNET::CPacsClient::setReactionType(), NLPACS::CMovePrimitive::setReactionType(), NLAISCRIPT::CCompilateur::setStackVar(), NL3D::CPSConstraintMesh::setTexAnimType(), NL3D::CTileSet::setTile128(), NL3D::CTileSet::setTile256(), NL3D::CZoneSymmetrisation::setTileState(), NL3D::CTileSet::setTileTransition(), NLNET::CPacsClient::setTriggerType(), NLPACS::CMovePrimitive::setTriggerType(), NL3D::CPointLight::setType(), NLPACS::CLocalRetriever::setType(), NLMISC::CEntityId::setType(), NLAIAGENT::CAgentNumber::setTypeAt(), NL3D::CDriverGL::setupGlArraysForEXTVertexShader(), NL3D::CDriverGL::setupGlArraysForNVVertexProgram(), NLGEORGES::CFormElm::setValueByName(), NL3D::CDriverUser::systemMessageBox(), NL3D::IDriver::systemMessageBox(), NLMISC::TBMSSerialInfo::TBMSSerialInfo(), NLMISC::toString(), NL3D::CPatchInfo::transformTile(), NLNET::typeToString(), and NLGEORGES::CType::uiCompatible().

+

+ + + + +
+ + +
typedef const GLvoid GLenum usage +
+
+ + + + + +
+   + + +

+ +

+Definition at line 643 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLsizei const GLubyte * v +
+
+ + + + + +
+   + + +

+ +

+Definition at line 237 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CLodCharacterShape::addAnim(), NL3D::CVegetableManager::addInstance(), NL3D::CLoadBalancingGroup::addNbFacesPass0(), NLAILOGIC::CBoolOperator::addPostcondition(), NLAILOGIC::CBoolOperator::addPrecondition(), NL3D::CShadowPolyReceiver::addTriangle(), NL3D::CZoneLighter::addTriangles(), NLPACS::IQuadNode::addVertex(), NLPACS::CQuadBranch::addVertex(), NLPACS::CSurfaceQuadTree::addVertex(), NL3D::CShadowPolyReceiver::allocateVertex(), NL3D::CFastHLSModifier::applyHLSMod(), NL3D::BilinFilter(), NL3D::CCoarseMeshBuild::buildBitmap(), NL3D::CHeightMap::buildFromBitmap(), NLMISC::CRGBA::buildFromHLS(), NL3D::CIGSurfaceLightBuild::buildPLDebugMesh(), NL3D::CPSConstraintMesh::CMeshDisplayShare::buildVB(), NLAIAGENT::CAgentClockTimer::CAgentClockTimer(), NLAIAGENT::CAgentManagerTimer::CAgentManagerTimer(), NLAIAGENT::CAgentWatchTimer::CAgentWatchTimer(), NL3D::CCloud::calcBill(), NLMISC::CVectorD::cartesianToSpheric(), NLMISC::CVector::cartesianToSpheric(), NLAISCRIPT::CCompilateur::castVariable(), NLAILOGIC::CFact::CFact(), NLAISCRIPT::CFactorType::CFactorType(), NL3D::CZoneManager::checkZonesAround(), NLMISC::clamp(), NLAIAGENT::CMainAgentScript::CMainAgentScript(), NL3D::CLodCharacterShapeBuild::compile(), NL3D::CHLSColorTexture::compressBlockRGB(), NL3D::CPSLocated::computeBBox(), NL3D::CMeshMRMSkinnedGeom::computeBonesId(), NL3D::CMeshMRMGeom::computeBonesId(), NL3D::CPatch::computeDisplaceRawCoordinates(), NL3D::CHLSColorTexture::computeMinMax(), NL3D::CLightingManager::computeModelLightContributions(), NL3D::CPatch::computeNearBlockLightmap(), NLPACS::computeSurfaceCenter(), NLPACS::computeSurfaceQuadTree(), NL3D::CPatch::computeTileLightmapPixelAroundCorner(), NL3D::CPatch::computeTileLightmapPixelAutomatic(), NLLIGO::CPrimZone::contains(), NL3D::copyToValue(), NL3D::COrderFace::countCacheMiss(), NLMISC::CPlane::CPlane(), NLLIGO::CPrimVector::CPrimVector(), NLMISC::CRandomGrid3D::CRandomGrid3D(), NLNET::createMessage(), NLMISC::CRefPtr< T >::CRefPtr(), NLMISC::CSTLBlockList< CNode * >::CSTLBlockList(), NL3D::CZoneLighter::CTriangle::CTriangle(), NLMISC::CUV::CUV(), NLMISC::CUVW::CUVW(), NLAISCRIPT::CVarPStack::CVarPStack(), NLAISCRIPT::CVarPStackParam::CVarPStackParam(), NLMISC::CVector::CVector(), NLMISC::CVector2d::CVector2d(), NLMISC::CVector2f::CVector2f(), NLPACS::CVector2s::CVector2s(), NLMISC::CVectorD::CVectorD(), NLMISC::CVectorH::CVectorH(), NL3D::CShadowPolyReceiver::CVectorId::CVectorId(), NLAIAGENT::CVolatilMemmory::CVolatilMemmory(), NL3D::CLandscape::deleteTessFarVertex(), NL3D::CLandscape::deleteTessNearVertex(), NL3D::CLandscape::deleteTessVertex(), NL3D::CPSUtil::displayArrow(), NLMISC::CPlane::distance(), NL3D::CDeform2d::doDeform(), NL3D::CPSEmitterOmni::emit(), NL3D::CPatch::evalLumelBlock(), NLMISC::CAABBox::extend(), NLMISC::fastClamp8(), NLMISC::CVariable< std::string >::fromString(), NLMISC::fromString(), NL3D::CPSAttribMakerT< T, F >::get(), NLSOUND::CSourceDSound::getDirection(), NLSOUND::CSourceAL::getDirection(), NLPACS::CLocalRetriever::getHeight(), NLPACS::CSurfaceQuadTree::getInterpZ(), NLPACS::CSurfaceQuadTree::getLeaf(), NL3D::CPSLocated::getLODVect(), NL3D::CParticleSystem::getLODVect(), NLSOUND::CListenerAL::getOrientation(), NLMISC::CMatrix::getPos(), NLMISC::getPowerOf2(), NLLIGO::CPrimZone::getSegmentDist(), NLAIAGENT::getValue(), NLSOUND::CSourceDSound::getVelocity(), NLSOUND::CSourceAL::getVelocity(), NLSOUND::CListenerDSound::getVelocity(), NL3D::CTessFace::hasVertex(), NL3D::CPSConstraintMesh::hintRotateTheSame(), NL3D::CPSFace::hintRotateTheSame(), NLAIAGENT::IMainAgent::IMainAgent(), NLMISC::CWordsDictionary::init(), NL3D::CTessFace::initTileUvRGBA(), NL3D::COrderFace::insertInPB(), NLMISC::CBitMemStream::internalSerial(), NL3D::CPortal::isInFront(), NLMISC::isPowerOf2(), NLMISC::isValidDouble(), NLAIAGENT::IVector::IVector(), NLPACS::linkExteriorToInterior(), NLNET::IService::main(), NLMISC::CPlane::make(), NL3D::MakeRandomUnitVect(), NLMISC::CMatrix::movePos(), NLMISC::CMatrix::mulPoint(), NLMISC::CMatrix::mulVector(), NL3D_expandLightmap(), NLPACS::CVector2s::normed(), NLMISC::CVector2f::normed(), NLMISC::CVector2d::normed(), NLMISC::CVectorD::operator *(), NLMISC::CVector::operator *(), NLPACS::CVector2s::operator *(), NLMISC::CVector2f::operator *(), NLMISC::operator *(), NLMISC::CVector2d::operator *(), NLMISC::CMatrix::operator *(), NLAIAGENT::INombre< sint32 >::operator *=(), NLMISC::CVectorD::operator!=(), NLMISC::CVector::operator!=(), NLMISC::CVectorH::operator!=(), NLPACS::CVector2s::operator!=(), NLMISC::CVector2f::operator!=(), NLMISC::CVector2d::operator!=(), NLAIAGENT::INombre< sint32 >::operator!=(), NLAIAGENT::IVector::operator!=(), NL3D::CSpecCubeMapFunctor::operator()(), NLMISC::CVectorD::operator+(), NLMISC::CVector::operator+(), NLPACS::CVector2s::operator+(), NLMISC::CVector2f::operator+(), NLMISC::CVector2d::operator+(), NLMISC::CUVW::operator+(), NLMISC::CUV::operator+(), NLMISC::CVectorD::operator+=(), NLMISC::CVector::operator+=(), NLPACS::CVector2s::operator+=(), NLMISC::CVector2f::operator+=(), NLMISC::CVector2d::operator+=(), NLMISC::CUVW::operator+=(), NLMISC::CUV::operator+=(), NLAIAGENT::INombre< sint32 >::operator+=(), NLAIAGENT::IVector::operator+=(), NLMISC::CVectorD::operator-(), NLMISC::CVector::operator-(), NLPACS::CVector2s::operator-(), NLMISC::CVector2f::operator-(), NLMISC::CVector2d::operator-(), NLMISC::CUVW::operator-(), NLMISC::CUV::operator-(), NLMISC::CVectorD::operator-=(), NLMISC::CVector::operator-=(), NLPACS::CVector2s::operator-=(), NLMISC::CVector2f::operator-=(), NLMISC::CVector2d::operator-=(), NLMISC::CUVW::operator-=(), NLMISC::CUV::operator-=(), NLAIAGENT::INombre< sint32 >::operator-=(), NLAIAGENT::IVector::operator-=(), NLAIAGENT::INombre< sint32 >::operator/=(), NLMISC::CVector::operator<(), NLMISC::CVectorH::operator<(), NL3D::CMeshMRMSkinnedGeom::CShadowVertex::operator<(), NL3D::CMeshMRMGeom::CShadowVertex::operator<(), NLAIAGENT::IVarName::operator<(), NLAIAGENT::INombre< sint32 >::operator<(), NLAIAGENT::INombre< sint32 >::operator<=(), NLMISC::CVectorD::operator=(), NLMISC::CVectorSString::operator=(), NLMISC::CRefPtr< T >::operator=(), NLAIAGENT::CStringVarName::operator=(), NLAIAGENT::INombre< sint32 >::operator=(), NLAIAGENT::IVector::operator=(), NLMISC::CVectorD::operator==(), NLMISC::CVector::operator==(), NLMISC::CVectorH::operator==(), NLPACS::CVector2s::operator==(), NLMISC::CVector2f::operator==(), NLMISC::CVector2d::operator==(), CHashKey::operator==(), NL3D::CMeshMRMSkinnedGeom::CShadowVertex::operator==(), NL3D::CMeshMRMGeom::CShadowVertex::operator==(), NLAIAGENT::IVarName::operator==(), NLAIAGENT::INombre< sint32 >::operator==(), NLAIAGENT::IVector::operator==(), NLAIAGENT::IVarName::operator>(), NLAIAGENT::INombre< sint32 >::operator>(), NLAIAGENT::INombre< sint32 >::operator>=(), NLMISC::CVectorD::operator^(), NLMISC::CVector::operator^(), NL3D::CStripifier::optimizeTriangles(), NLPACS::CVector2s::pack(), NL3D::CVector3s::pack(), NL3D::CPatch::packShadowMap(), NL3D::CWaterHeightMap::perturbate(), NLMISC::raiseToNextPowerOf2(), NLLOGIC::CLogicStateMachine::read(), NLLOGIC::CLogicState::read(), NLLOGIC::CLogicCondition::read(), NLLOGIC::CLogicConditionNode::read(), NLMISC::CBitMemStream::readBits(), NL3D::CParticleSystemModel::refreshRscDeletion(), NL3D::CLandscape::render(), NL3D::CCloudScape::render(), RenderTriangle(), NLMISC::CBitMemStream::reserveBits(), NLMISC::CMatrix::rotate(), NLAIFUZZY::FuzzyType::save(), NLAIAGENT::INombre< sint32 >::save(), NLMISC::CMatrix::scale(), NL3D::CCubeGrid< TCell >::select(), NLMISC::IStream::serial(), NLMISC::COFile::serialBit(), NLMISC::CIFile::serialBit(), NLMISC::CBitMemStream::serialBuffer(), NLMISC::CStringStream::serialCont(), NLMISC::CBitMemStream::serialCont(), NLMISC::IStream::serialMultimap(), NLMISC::CBitMemStream::serialPoke(), NLMISC::IStream::serialSTLContLen(), NLMISC::IStream::serialSTLContLenPolyPtr(), NLMISC::IStream::serialSTLContLenPtr(), NLMISC::IStream::serialVersion(), NLMISC::CUV::set(), NLAISCRIPT::CFactorType::set(), NLMISC::CQuatT< T >::setAngleAxis(), NLAIAGENT::IMessageBase::setContinuation(), NL3D::CPSEmitterRectangle::setDir(), NL3D::CPSEmitterDirectionnal::setDir(), NL3D::CPSEmitterConic::setDir(), NL3D::UParticleSystemInstance::setGlobalVectorValue(), NL3D::CLandscape::setHeightField(), NL3D::CVertexBuffer::setNormalCoord(), NL3D::CPSValueGradientFunc< sint32 >::setNumStages(), NL3D::CTransformUser::setOpacity(), NL3D::CTransform::setOpacity(), NLSOUND::CListenerAL::setOrientation(), NLMISC::CMatrix::setPos(), NL3D::CPointLight::setPosition(), NL3D::CPSCylindricVortex::setRadialViscosity(), NLAIAGENT::IMessageBase::setReceiver(), NLMISC::CMatrix::setRot(), NLMISC::CMatrix::setScale(), NLAIAGENT::IMessageBase::setSender(), NLSOUND::CSoundPattern::setSpawn(), NLPACS::CChain::setStartVector(), NLPACS::CChain::setStopVector(), NL3D::CPSCylindricVortex::setTangentialViscosity(), NL3D::CVertexBuffer::setTexCoord(), NL3D::CTransformUser::setTransparency(), NL3D::CTransform::setTransparency(), NL3D::CMeshMRMSkinnedGeom::CPackedVertexBuffer::CPackedVertex::setUV(), NL3D::CVertexBuffer::setVertexCoord(), NLPACS::CLocalRetriever::snapToInteriorGround(), NLPACS::CRetrieverInstance::snapVector(), NLMISC::sqr(), NLMISC::CQuatT< T >::squadrev(), NLMISC::stringFromVector(), NLNET::stringFromVectorPart(), NL3D::CZoneLighter::CPointLightRT::testRaytrace(), NL3D::CInstanceLighter::CPointLightRT::testRaytrace(), NL3D::CPatchInfo::transform(), NLMISC::CMatrix::translate(), NL3D::CFlareModel::traverseRender(), NL3D::CEvent3dMouseListener::truncateVect(), NL3D::CVector3s::unpack(), NL3D::CPatch::unpackShadowMap(), NLAIAGENT::VectorType::VectorType(), and NLAIAGENT::IVector::y().

+

+ + + + +
+ + +
typedef GLenum value +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1132 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CChannelMixer::addChannel(), NLAIFUZZY::IFuzzySet::addFact(), NLAIAGENT::INombre< sint32 >::addValue(), NL3D::CAnimatedValueNotBlendable< bool >::affect(), NL3D::CAnimatedValueBlendable< NLMISC::CRGBA >::affect(), NL3D::CAnimatedValueBlendable< NLMISC::CQuat >::affect(), NL3D::CAnimatedValueBlendable< CVector >::affect(), NLLOGIC::CLogicVariable::applyModification(), NLLIGO::CPrimitiveConfigurations::belong(), NLNET::CUdpSock::bind(), NL3D::CAnimatedValueNotBlendable< bool >::blend(), NL3D::CAnimatedValueBlendable< NLMISC::CRGBA >::blend(), NL3D::CAnimatedValueBlendable< NLMISC::CQuat >::blend(), NL3D::CAnimatedValueBlendable< CVector >::blend(), NLAIAGENT::BorneDDigitalType::BorneDDigitalType(), NLAIAGENT::BorneDigitalType::BorneDigitalType(), NL3D::CZoneLighter::buildZoneInformation(), NLAIAGENT::COperatorScript::calcPriority(), NLAILOGIC::CBoolType::CBoolType(), NLAINIMAT::CClassifierSystem::CClassifierConditionCell::CClassifierConditionCell(), NL3D::CPSFloatCurveFunctor::CCtrlPoint::CCtrlPoint(), NLAIFUZZY::CFuzzyFact::CFuzzyFact(), NLAIFUZZY::CFuzzyVar::CFuzzyVar(), NLMISC::CGDAxisMoved::CGDAxisMoved(), NLAIAGENT::CharType::CharType(), NLMISC::CWindowDisplayer::CLabelEntry::CLabelEntry(), NLGEORGES::CFormElm::convertValue(), NL3D::copyToValue(), NLMISC::CWindowDisplayer::createLabel(), NLNET::createMessage(), NLAILOGIC::CVar::CVar(), NLMISC::CVariable< std::string >::CVariable(), NLMISC::CVariablePtr< T >::CVariablePtr(), NLAIAGENT::DDigitalType::DDigitalType(), NLAIAGENT::DigitalType::DigitalType(), NLAIAGENT::INombre< sint32 >::divValue(), NLMISC::CEvalNumExpr::evalExpression(), NLGEORGES::CMyEvalNumExpr::evalValue(), NLMISC::CEvalNumExpr::evalValue(), NLMISC::CMemStream::fastRead(), NLMISC::CMemStream::fastWrite(), NLMISC::CObjectVector< sint8, false >::fill(), NL3D::FillBufUsingSubdiv(), NL3D::CTextureDLM::fillRect(), NLMISC::fprintf_int(), NL3D::CVertexBufferHardGLMapObjectATI::getATIValueOffset(), NL3D::CVertexBufferHardGLATI::getATIValueOffset(), NLMISC::IProgressCallback::getCropedValue(), NLGEORGES::CType::getDefinition(), NL3D::CVertexBufferHardGLNVidia::getNVidiaValueEx(), NLMISC::CSystemInfo::getProc(), NLSOUND::CBufferAL::getSize(), NLLIGO::CZoneTemplate::getSnappedIndex(), NLGEORGES::CFormElmAtom::getValue(), NLGEORGES::CFormElm::getValueByName(), NL3D::IVertexBufferHard::getValueOff(), NL3D::IVertexBufferHard::getValueType(), NL3D::CVertexBuffer::getValueType(), NL3D::H_AUTO_DECL(), NLAIAGENT::IBornNombre< float >::IBornNombre(), NLAIAGENT::IDigital< sint32 >::IDigital(), NLNET::CListenSock::init(), NL3D::CVertexBuffer::initEx(), NL3D::IVertexBufferHard::initFormat(), NLAIAGENT::INombre< sint32 >::INombre(), NLAIAGENT::INombreDefine::INombreDefine(), NL3D::CTessFacePriorityList::insert(), NLMISC::CStringConversion< DestType, Pred >::insert(), NLPACS::CFaceGrid::CFaceGridBuild::insert(), STRING_MANAGER::TWorksheet::insert(), NL3D::CTessFacePriorityList::CRollingTable::insertInRollTable(), NLAIAGENT::IntegerType::IntegerType(), NLMISC::CBitMemStream::internalSerial(), NL3D::ITrack::interpolate(), NLLIGO::CZoneTemplate::isSnapedOnGrid(), NLAIAGENT::IVector::IVector(), NL3D::CPSAttribMakerT< uint32, CPSValueBlendFunc< uint32 > >::make4ByIterator(), NL3D::CPSAttribMakerT< uint32, CPSValueBlendFunc< uint32 > >::makeByIterator(), NL3D::CPSAttribMakerT< uint32, CPSValueBlendFunc< uint32 > >::makeNByIterator(), NLLOGIC::CLogicStateMachine::modifyVariable(), NLAIAGENT::INombre< sint32 >::mulValue(), NLSOUND::TFindId::operator()(), NL3D::CVertexBuffer::operator=(), NLMISC::CDbgPtr< T >::operator=(), NL3D::CPatch::packLumelBlock(), NLMISC::CMemStream::poke(), NLMISC::CBitMemStream::poke(), NLGEORGES::CType::read(), NLLIGO::CPrimitiveClass::read(), NLGEORGES::CFileHeader::read(), NLGEORGES::CFormElmAtom::read(), NLGEORGES::CFormDfn::read(), ReadChild(), NLMISC::CEvalNumExpr::readDecimal(), ReadFloat(), NLLIGO::ReadFloat(), ReadInt(), NLMISC::CEvalNumExpr::readIntegerNumberDecimal(), NLMISC::CBitSet::resizeNoReset(), NLAIAGENT::IAgentInput::run(), NLAIAGENT::CAgentScript::runMethodBase(), NLMISC::CBitMemStream::serial(), NLMISC::IStream::serialCheck(), NLMISC::CBitMemStream::serialPoke(), NLMISC::COXml::serialSeparatedBufferOut(), NL3D::CVertexBuffer::serialSubset(), NLNET::serviceGetView(), NL3D::CParticleSystem::CGlobalVectorValueHandle::set(), NLMISC::CBitSet::set(), NL3D::UWaterHeightMapManager::setBlendFactor(), NL3D::CDriverGL::setConstant(), NL3D::CSegRemanenceShape::setCorner(), STRING_MANAGER::TWorksheet::setData(), NLSOUND::CSourceDSound::setEAXProperty(), NLSOUND::CSourceAL::setEAXProperty(), NLSOUND::CListenerDSound::setEAXProperty(), NLSOUND::CListenerAL::setEAXProperty(), NL3D::CParticleSystemModel::setEllapsedTimeRatio(), NL3D::UParticleSystemInstance::setGlobalUserParamValue(), NL3D::CParticleSystem::setGlobalValue(), NL3D::CParticleSystem::setGlobalVectorValue(), NL3D::CPSBrownianForce::setIntensity(), NL3D::CPSGravity::setIntensity(), NL3D::CPSForceIntensity::setIntensity(), NLMISC::CWindowDisplayer::setLabel(), NLSOUND::CAudioMixerUser::setLowWaterMark(), NL3D::CDriverGL::setMonitorColorProperties(), NL3D::CPSConstraintMesh::setMorphValue(), NLAINIMAT::CMHiCSagent::setMotivationValue(), NLAINIMAT::CMotivationEnergy::setMotivationValue(), NLNET::CTcpSock::setNoDelay(), NLNET::CDummyTcpSock::setNoDelay(), NL3D::CPSShockWave::setUFactor(), NL3D::CDriverGL::setupGlArraysForEXTVertexShader(), NL3D::CDriverGL::setupGlArraysForNVVertexProgram(), NL3D::CParticleSystemInstanceUser::setUserParam(), NL3D::CParticleSystem::setUserParam(), NLSOUND::CAudioMixerUser::setUserVar(), NLLOGIC::CLogicVariable::setValue(), NLAIFUZZY::CFuzzyVar::setValue(), NLGEORGES::CFormElmAtom::setValue(), NLAIAGENT::INombre< sint32 >::setValue(), NLAIAGENT::IVector::setValue(), NLGEORGES::CFormElm::setValueByName(), NL3D::CVertexBuffer::setValueDouble1Ex(), NL3D::CVertexBuffer::setValueFloat1Ex(), NL3D::CVertexBuffer::setValueShort1Ex(), NL3D::CPSTailDot::setZBias(), NL3D::CPSShockWave::setZBias(), NL3D::CPSRibbonLookAt::setZBias(), NL3D::CPSRibbon::setZBias(), NL3D::CPSQuad::setZBias(), NL3D::CPSMaterial::setZBias(), NL3D::CPSConstraintMesh::setZBias(), NL3D::CPSMesh::setZBias(), NL3D::CPSLocatedBindable::setZBias(), NL3D::CPSLocated::setZBias(), NL3D::CPSFanLight::setZBias(), NL3D::CPSDot::setZBias(), NL3D::CParticleSystemModel::setZBias(), NL3D::CParticleSystemInstanceUser::setZBias(), NL3D::CParticleSystem::setZBias(), NLAIAGENT::ShortIntegerType::ShortIntegerType(), NLLIGO::CZoneTemplate::snap(), NLLIGO::CZoneTemplate::snapOnGrid(), NL3D::CZoneSymmetrisation::snapOnGrid(), NLAIAGENT::INombre< sint32 >::subValue(), NL3D::CDriverGL::toggleGlArraysForEXTVertexShader(), NL3D::CDriverGL::toggleGlArraysForNVVertexProgram(), NLAIAGENT::UInt16Type::UInt16Type(), NLAIAGENT::UInt32Type::UInt32Type(), NLAIAGENT::UInt64Type::UInt64Type(), NLAIAGENT::UInt8Type::UInt8Type(), NL3D::CTileLumel::unpack(), and NLLIGO::WriteFloat().

+

+ + + + +
+ + +
typedef GLshort GLshort GLshort GLshort w +
+
+ + + + + +
+   + + +

+ +

+Definition at line 236 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CHLSColorTexture::addMask(), NL3D::CPatch::appendTileLightInfluences(), NL3D::CVegetableShape::build(), NL3D::CHLSColorTexture::buildColorVersion(), NL3D::CHeightMap::buildFromBitmap(), NLMISC::CBitmap::buildMipMaps(), NL3D::CTextureDLM::canCreateLightMap(), NLAIAGENT::CIdMethod::CIdMethod(), NL3D::UDriver::CMode::CMode(), NLMEMORY::CHeapAllocator::computeCRC32(), NL3D::CDriverGL::computeMipMapMemoryUsage(), NLMISC::CQuatT< float >::conjugate(), NL3D::UTextContext::CStringInfo::convertTo01Size(), NL3D::UTextContext::CStringInfo::convertToPixelSize(), NL3D::CTextureDLM::copyRect(), NLMISC::CQuatD::CQuatD(), NLMISC::CQuatT< float >::CQuatT(), NLMISC::CWindowDisplayer::create(), NL3D::CTextureDLM::createLightMap(), NL3D::UTextContext::CStringInfo::CStringInfo(), NLMISC::CUpdateThread::CUpdateThread(), NLMISC::CUVW::CUVW(), NLMISC::CVectorH::CVectorH(), NL3D::CCloud::disp(), NL3D::CTileBorder::doubleSize(), NL3D::CMRMBuilder::edgeContinue(), NLMISC::CQuatT< T >::equal(), NLMISC::CHeapAllocator::erase(), NL3D::CShadowMapManager::fillBlackBorder(), NL3D::CTextureDLM::fillRect(), NL3D::CMRMMeshFinal::findInsertWedge(), NL3D::CTileBorder::get(), NLMISC::CQuatT< float >::getAngle(), NLMISC::CBitmap::getDXTC1Texel(), NLMISC::CBitmap::getDXTC3Texel(), NLMISC::CBitmap::getDXTC5Texel(), NLMEMORY::CHeapAllocator::getFirstNode(), NLMEMORY::CHeapAllocator::getFreeNode(), NLMISC::CBitmap::getHeight(), NL3D::CPatch::getLumel(), NLMEMORY::CHeapAllocator::getNextNode(), NLMISC::CBitmap::getRGBAPixel(), NLMISC::CBitmap::getWidth(), NLMISC::CWindowDisplayer::getWindowPos(), NL3D::GfxMode::GfxMode(), NLMISC::CQuatT< float >::identity(), NL3D::CNoise3d::init(), NL3D::CNELU::init(), NLAIAGENT::CAgentTimerHandle::initClass(), NL3D::CNELU::initDriver(), NL3D::CFrustum::initPerspective(), NLMISC::CQuatT< float >::isIdentity(), NLPACS::linkExteriorToInterior(), NLMISC::CQuatT< T >::log(), NLNET::IService::main(), NL3D::CTextureDLM::modulateAndfillRect565(), NL3D::CTextureDLM::modulateAndfillRect8888(), NL3D::CTextureDLM::modulateConstantAndfillRect(), NLNET::NLMISC_COMMAND(), NLMISC::CQuatT< T >::operator *(), NLMISC::CQuatT< float >::operator *(), NLMISC::CQuatT< float >::operator *=(), NLMISC::CQuatD::operator CQuat(), NLMISC::CQuatT< float >::operator+(), NLMISC::CQuatT< float >::operator+=(), NLMISC::CQuatT< float >::operator-(), NLMISC::CQuatT< float >::operator-=(), NLMISC::CQuatT< float >::operator/(), NLMISC::CQuatT< float >::operator/=(), NLMISC::CVectorH::operator<(), NLMISC::CQuatD::operator=(), NLMISC::CQuat::operator=(), NLMISC::CVectorH::operator==(), NL3D::CTrackSampledQuat::CQuatPack::operator==(), NLMISC::CQuatT< float >::operator==(), NL3D::CZoneLighter::processZonePointLightRT(), NL3D::CFrustum::project(), NL3D::CFrustum::projectZ(), NLMISC::CBitmap::readDDS(), NL3D::CNoise3d::renderGrid(), NL3D::CNoise3d::renderGrid2passes(), NL3D::CHeightMap::resize(), NLLIGO::SPiece::rotFlip(), NL3D::CTrackSampledQuat::CQuatPack::serial(), NLMISC::CQuatT< float >::serial(), NL3D::CVertexBuffer::serialOldV1Minus(), NLMISC::CVectorH::set(), NL3D::CTileBorder::set(), NLMISC::CQuatT< float >::set(), NLMISC::CQuatT< T >::setAngleAxis(), NL3D::CShadowMapManager::setBlackQuad(), NL3D::CShadowMapManager::setBlurQuadFakeGaussian(), NL3D::CLandscape::setHeightField(), NL3D::CDriverGL::setupTextureEx(), NL3D::CWaterShape::setupVertexBuffer(), NL3D::CVertexBuffer::setValueDouble4Ex(), NL3D::CVertexBuffer::setValueFloat4Ex(), NL3D::CVertexBuffer::setValueShort4Ex(), NL3D::CVertexBuffer::setWeight(), NLMISC::CQuatT< float >::sqrnorm(), NL3D::CFrustum::unProject(), NL3D::CFrustum::unProjectZ(), NL3D::CShadowMapManager::updateBlurTexture(), NL3D::CDriverGL::uploadTexture(), NL3D::CMRMBuilder::vertexHasOneWedge(), and NLAIAGENT::IVector::z().

+

+ + + + +
+ + +
typedef GLint GLint GLsizei width +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1013 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CTextureFar::allocatePatch(), NLMISC::CBitmap::blit(), NL3D::CLodCharacterTmpBitmap::build(), NL3D::CCoarseMeshBuild::buildBitmap(), NL3D::BuildDsDt(), NL3D::BuildDsDtAsRGBA(), NL3D::CWaterHeightMap::clearArea(), NL3D::CWaterHeightMap::clearZone(), NL3D::CDriverGL::clipRect(), NL3D::CFontManager::computeString(), NL3D::CFontManager::computeStringInfo(), NL3D::CDriverGL::copyFrameBufferToTexture(), NLMISC::CRect::CRect(), NL3D::CScissor::CScissor(), NL3D::CTextureDLM::CTextureDLM(), NL3D::CTextureMem::CTextureMem(), NLMISC::CBitmap::decompressDXT1(), NLMISC::CBitmap::decompressDXT3(), NLMISC::CBitmap::decompressDXT5(), NL3D::CTextureGrouped::doGenerate(), NL3D::CTextureEmboss::doGenerate(), NL3D::CTextureBump::doGenerate(), draw2dLine(), NL3D::CDRU::drawBitmap(), NL3D::CDriverUser::drawBitmap(), NL3D::CPatch::evalLumelBlock(), NL3D::CCoarseMeshBuild::expand(), NL3D::CLandscape::freeFarRenderPass(), NL3D::CTileBorder::get(), NL3D::CFontGenerator::getBitmap(), NL3D::CLandscape::getFarRenderPass(), NL3D::CTextureFar::getFreeListId(), NL3D::CTextureFont::getLetterInfo(), NLLIGO::CZoneTemplate::getMask(), NL3D::CFontGenerator::getSizes(), NL3D::GetTextureSize(), NL3D::CTextureDLM::getTypeForSize(), NL3D::CTextureFar::getUpperSize(), NL3D::CPSFloatCurveFunctor::getValue(), NL3D::CViewport::getValues(), NL3D::CDriverUser::getWindowHeight(), NL3D::CDriverUser::getWindowSize(), NL3D::CDriverGL::getWindowSize(), NL3D::CDriverUser::getWindowWidth(), H_AUTO_DECL(), NL3D::CViewport::init(), NL3D::CScissor::init(), NL3D::CFrustum::init(), NLPACS::CFaceGrid::CFaceGridBuild::init(), NL3D::CZoneLighter::lightWater(), NLMISC::CBitmap::load(), NLMISC::CBitmap::loadSize(), NL3D::CWaterHeightMap::makeCpy(), NL3D::CZoneLighter::makeQuadGridFromWaterShapes(), NL3D::NormalizeDsDt(), NL3D::NormalizeDsDtAsRGBA(), NL3D::CHeatHaze::performHeatHaze(), NL3D::CMotionBlur::performMotionBlur(), NLMISC::CBitmap::readTGA(), NL3D::CTextureFar::removePatch(), RenderTriangle(), NL3D::CTileBorder::set(), NL3D::CHLSColorTexture::setBitmap(), NL3D::CDriverGL::setDisplay(), NL3D::CTravCameraScene::setFrustum(), NL3D::CCameraUser::setFrustum(), NL3D::CCamera::setFrustum(), NL3D::CTextureMem::setPointer(), NLNET::CPacsClient::setSize(), NLPACS::CMovePrimitive::setSize(), NL3D::CDeform2d::setupBuffer(), NL3D::CDriverGL::setupScissor(), NL3D::CDriverGL::setupViewport(), NLMISC::CRect::setWH(), NL3D::CMotionBlur::startMotionBlur(), NL3D::CTextureFar::touchPatchULAndNext(), NL3D::CFlareModel::traverseRender(), NL3D::CTextureFar::tryAllocatePatch(), and NLMISC::CBitmap::writeTGA().

+

+ + + + +
+ + +
typedef GLshort x +
+
+ + + + + +
+   + + +

+ +

+Definition at line 236 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CVisualCollisionManager::CStaticGrid::add(), NLAISCRIPT::IBlock::addCode(), NL3D::CIGSurfaceLightBuild::addDebugMeshFaces(), NLAILOGIC::CFactBase::addFact(), NL3D::CHLSColorTexture::addMask(), NLPACS::CPrimitiveWorldImage::addMoveElement(), NLAISCRIPT::CCompilateur::addOpCode(), NL3D::CPatchDLMContext::addPointLightInfluence(), NL3D::CLandscapeCollisionGrid::addQuadToGrid(), NL3D::CLodCharacterManager::addTextureCompute(), NL3D::CPatch::addTileLightmapEdgeWithTLI(), NL3D::CPatch::addTileLightmapWithTLI(), NLAISCRIPT::CCompilateur::allocExpression(), NL3D::CPatch::appendTileLightInfluences(), NLMISC::CVectorD::asVector(), NLMISC::CVector2f::asVector(), NL3D::CZoneLighter::attenuation(), NLLIGO::CZoneRegion::basicSet(), NL3D::bilinearColor(), NL3D::bilinearColorAndAdd(), NL3D::bilinearColorAndModulate(), NL3D::bilinearColorAndModulatex2(), NL3D::bilinearColorDiv2AndAdd(), NLMISC::CBitmap::blit(), NLLIGO::CZoneTemplate::build(), NLLIGO::CZoneEdge::build(), NL3D::CStaticQuadGrid< T >::build(), NL3D::CLandscapeCollisionGrid::build(), NLPACS::CEdgeQuad::build(), NLPACS::CChainQuad::build(), NLAISCRIPT::CAgentClass::buildChildsMessageMap(), NL3D::CLandscape::buildCollideFaces(), NL3D::BuildCubeMapTex(), NL3D::BuildCubeMapTexLuminance(), NL3D::BuildDsDt(), NL3D::BuildDsDtAsRGBA(), NL3D::CHeightMap::buildFromBitmap(), NLAISCRIPT::COnChangeMsgClass::buildNewInstance(), NLAISCRIPT::CFactMsgClass::buildNewInstance(), NLAISCRIPT::CCancelGoalMsgClass::buildNewInstance(), NLAISCRIPT::CGoalMsgClass::buildNewInstance(), NLAISCRIPT::CSetValueMsgClass::buildNewInstance(), NLAISCRIPT::CGetValueMsgClass::buildNewInstance(), NLAISCRIPT::CFailureMsgClass::buildNewInstance(), NLAISCRIPT::CSuccessMsgClass::buildNewInstance(), NL3D::CIGSurfaceLightBuild::buildPLDebugMesh(), NL3D::CIGSurfaceLightBuild::buildSunDebugMesh(), NL3D::CLandscape::buildZoneName(), NLAIAGENT::CCancelGoalMsg::CCancelGoalMsg(), NLMISC::CEventMouse::CEventMouse(), NLMISC::CEventMouseDblClk::CEventMouseDblClk(), NLMISC::CEventMouseDown::CEventMouseDown(), NLMISC::CEventMouseMove::CEventMouseMove(), NLMISC::CEventMouseUp::CEventMouseUp(), NLMISC::CEventMouseWheel::CEventMouseWheel(), NLAIAGENT::CFactMsg::CFactMsg(), NLAIAGENT::CFailureMsg::CFailureMsg(), NLMISC::CGDMouseMove::CGDMouseMove(), NLAIAGENT::CGetValueMsg::CGetValueMsg(), NLAIAGENT::CGoalMsg::CGoalMsg(), NL3D::CZoneManager::checkZonesAround(), NL3D::CWaterHeightMap::clearArea(), NL3D::CWaterHeightMap::clearZone(), NLAIAGENT::CVolatilMemmory::clone(), NLAIAGENT::CHashTimerManager::clone(), NLAISCRIPT::CVarPStackParam::clone(), NLAISCRIPT::CVarPStack::clone(), NLAILOGIC::CVarMem::clone(), NLAISCRIPT::COperandListType::clone(), NLAISCRIPT::COperationTypeGD::clone(), NLAISCRIPT::COperationType::clone(), NLAISCRIPT::COperandUnknown::clone(), NLAISCRIPT::COperandSimpleListOr::clone(), NLAISCRIPT::COperandSimple::clone(), NLAISCRIPT::COperandAnyObject::clone(), NLAISCRIPT::COperandVoid::clone(), NLAISCRIPT::CLibTest::clone(), NLAISCRIPT::CScriptDebugSourceMemory::clone(), NLAISCRIPT::CScriptDebugSourceFile::clone(), NLAIC::CTypeOfOperator::clone(), NLAIC::CTypeOfObject::clone(), NLAISCRIPT::CLdbRefOpCode::clone(), NLAISCRIPT::CLdbHeapMemberiOpCode::clone(), NLAISCRIPT::CLdbStackMemberiOpCode::clone(), NLAISCRIPT::CLdbMemberiOpCode::clone(), NLAISCRIPT::CLdbMemberOpCode::clone(), NLAISCRIPT::CLdbOpCode::clone(), NLAISCRIPT::CCallMethodi::clone(), NLAISCRIPT::CCallStackNewMethodi::clone(), NLAISCRIPT::CCallStackMethodi::clone(), NLAISCRIPT::CCallHeapMethodi::clone(), NLAISCRIPT::CCallMethod::clone(), NLAISCRIPT::CLibHeapMemberMethod::clone(), NLAISCRIPT::CLibStackNewMemberMethod::clone(), NLAISCRIPT::CLibStackMemberMethod::clone(), NLAISCRIPT::CLibCallMethodi::clone(), NLAISCRIPT::CLibCallInheritedMethod::clone(), NLAISCRIPT::CLibCallMethod::clone(), NLAISCRIPT::CLibMemberMethodi::clone(), NLAISCRIPT::CLibMemberInheritedMethod::clone(), NLAISCRIPT::CLibMemberMethod::clone(), NLAISCRIPT::CTellOpCode::clone(), NLAISCRIPT::CNopOpCode::clone(), NLAISCRIPT::CHaltOpCode::clone(), NLAISCRIPT::CFreeAlloc::clone(), NLAISCRIPT::CMarkAlloc::clone(), NLAISCRIPT::CLocAlloc::clone(), NLAISCRIPT::CAffMemberOpCode::clone(), NLAISCRIPT::CAffMemberiOpCode::clone(), NLAISCRIPT::CAffHeapMemberiOpCode::clone(), NLAISCRIPT::CAffOpCode::clone(), NLAISCRIPT::CJmpOpCode::clone(), NLAISCRIPT::CJFalseOpCode::clone(), NLAISCRIPT::CNotOpCode::clone(), NLAISCRIPT::CDiffOpCode::clone(), NLAISCRIPT::CInfEqOpCode::clone(), NLAISCRIPT::CSupEqOpCode::clone(), NLAISCRIPT::CEqOpCode::clone(), NLAISCRIPT::CInfOpCode::clone(), NLAISCRIPT::CSupOpCode::clone(), NLAISCRIPT::CMulOpCode::clone(), NLAISCRIPT::CDivOpCode::clone(), NLAISCRIPT::CSubOpCode::clone(), NLAISCRIPT::CAddOpCode::clone(), NLAISCRIPT::CNegOpCode::clone(), NLAISCRIPT::CLdbNewOpCode::clone(), NLAISCRIPT::CAddParamNameDebug::clone(), NLAISCRIPT::CFreeAllocDebug::clone(), NLAISCRIPT::CAffOpCodeDebug::clone(), NLAISCRIPT::CLocAllocDebug::clone(), NLAISCRIPT::CLoadHeapObject::clone(), NLAISCRIPT::CLoadStackObject::clone(), NLAISCRIPT::CLoadSelfObject::clone(), NLAIAGENT::CSetValueMsg::clone(), NLAIAGENT::COnChangeMsg::clone(), NLAIAGENT::CCancelGoalMsg::clone(), NLAIAGENT::CGoalMsg::clone(), NLAIAGENT::CGetValueMsg::clone(), NLAIAGENT::CFactMsg::clone(), NLAIAGENT::CFailureMsg::clone(), NLAIAGENT::CSuccessMsg::clone(), NLAIAGENT::CMessageGroup::clone(), NLAISCRIPT::IBlock::clone(), NLAIAGENT::CMainAgentScript::clone(), NLAIAGENT::CVectorGroupManager::clone(), NLAISCRIPT::CCallPrint::clone(), NLAISCRIPT::CAgentClass::clone(), NLAISCRIPT::CClassInterpretFactory::clone(), NLAISCRIPT::CContextDebug::clone(), NLAISCRIPT::CConstraintChkMethodeType::clone(), NLAISCRIPT::CConstraintStackComp::clone(), NLAISCRIPT::CConstraintFindRun::clone(), NLAISCRIPT::CConstraintDebug::clone(), NLAISCRIPT::CConstraintMethode::clone(), NLAISCRIPT::CCodeBrancheRunDebug::clone(), NLAISCRIPT::CCodeBrancheRun::clone(), NLAISCRIPT::CCodeContext::clone(), NLAIAGENT::CLibTimerManager::clone(), NLAIAGENT::CIndexedVarName::clone(), NLAIAGENT::CLocalAgentMail::clone(), NLAIC::CSelfClassFactory::clone(), NLAIAGENT::CMessageList::CMessageList(), NLAIAGENT::CMessageScript::CMessageScript(), NLAIAGENT::CMessageVector::CMessageVector(), NL3D::CVisualCollisionManager::CStaticGrid::compile(), NL3D::CLodCharacterShapeBuild::compile(), NLMEMORY::CHeapAllocator::computeCRC32(), NL3D::CPatch::computeCurrentTLILightmapDiv2(), NL3D::computePerturbation(), NL3D::CPatchDLMContext::computeTextureFar(), NL3D::CPatch::computeTileLightmapAutomatic(), NL3D::CPatch::computeTileLightmapEdgeAutomatic(), NL3D::CPatch::computeTileLightmapEdgePrecomputed(), NL3D::CPatch::computeTileLightmapPrecomputed(), NLAIAGENT::COnChangeMsg::COnChangeMsg(), NLMISC::CQuatT< float >::conjugate(), NL3D::CQuadTree< T >::const_iterator::const_iterator(), NLPACS::CQuadGrid< T >::const_iterator::const_iterator(), NL3D::CQuadGrid< T >::const_iterator::const_iterator(), NL3D::CDriverGL::copyFrameBufferToTexture(), NL3D::CTextureDLM::copyRect(), NLMISC::CVectorD::copyTo(), NL3D::CPlaneBasis::CPlaneBasis(), NLMISC::CPolygon2D::CPolygon2D(), NLMISC::CQuatD::CQuatD(), NLMISC::CQuatT< float >::CQuatT(), NLMISC::CRandomGrid3D::CRandomGrid3D(), NLMISC::CWindowDisplayer::create(), NL3D::CTextureDLM::createLightMap(), NLMISC::CRect::CRect(), NL3D::CScissor::CScissor(), NLAIAGENT::CSuccessMsg::CSuccessMsg(), NLMISC::CUpdateThread::CUpdateThread(), NLMISC::CVector::CVector(), NLMISC::CVector2d::CVector2d(), NLMISC::CVector2f::CVector2f(), NLPACS::CVector2s::CVector2s(), NL3D::CTextureFar::CVector2s::CVector2s(), NLMISC::CVectorD::CVectorD(), NLMISC::CVectorH::CVectorH(), NLMISC::CBitmap::decompressDXT1(), NLMISC::CBitmap::decompressDXT3(), NLMISC::CBitmap::decompressDXT5(), NL3D::CQuadGridClipManager::deleteCaseModels(), NL3D::CPSUtil::displaySphere(), NL3D::CTextureFont::doGenerate(), NL3D::CTextureEmboss::doGenerate(), NLPACS::CGlobalRetriever::doMove(), draw2dLine(), NL3D::CDRU::drawBitmap(), NL3D::CDriverUser::drawBitmap(), NL3D::CVegetable::easeInEaseOut(), NL3D::easeInEaseOut(), NLMISC::CRandomGrid3D::easeInEaseOut(), easineasout(), easineasoutC2(), NL3D::CLodCharacterManager::endTextureCompute(), NLMISC::CQuatT< T >::equal(), NLPACS::CQuadGrid< T >::erase(), NL3D::CQuadGrid< T >::erase(), NLMISC::CHeapAllocator::erase(), NLAISCRIPT::COperandSimpleListOr::eval(), NLAISCRIPT::IOpType::eval(), NL3D::CLandscapeVegetableBlockCreateContext::eval(), NLMISC::CRandomGrid3D::evalBiLinear(), NLMISC::CRandomGrid3D::evalNearest(), NLMISC::CQuatT< T >::exp(), NLMISC::CRect::extend(), NL3D::fastClamp01(), NL3D::fastFloor(), NL3D::CTextureDLM::fillRect(), NL3D::FillWaterVB(), NL3D::CWaterHeightMap::filter(), FilterZBuffer(), NL3D::CPatchDLMContext::generate(), NL3D::CVegetable::generateGroupBiLinear(), NL3D::CPatch::generateTileVegetable(), NLMISC::CQuatT< float >::getAxis(), NLAISCRIPT::CCompilateur::getCode(), NLAISCRIPT::IBlock::getCode(), NLAISCRIPT::IBlock::getCodeDebug(), NLMISC::CBitmap::getColor(), NLMISC::CBitmap::getColorInterp(), NL3D::CPatch::getCurrentTileTLIColors(), NLLIGO::CZoneRegion::getCutEdge(), NLLIGO::CZoneRegion::getDate(), NLMISC::CEntityId::getDebugString(), NLAIAGENT::VectorType::getDebugString(), NLMISC::CBitmap::getDXTC1Texel(), NLMISC::CBitmap::getDXTC3Texel(), NLMISC::CBitmap::getDXTC5Texel(), NLMISC::CBitmap::getDXTCColorFromBlock(), NLAIAGENT::CAgentScript::getDynamicAgent(), NLMEMORY::CHeapAllocator::getFirstNode(), NLLIGO::CZoneRegion::getFlip(), NLMEMORY::CHeapAllocator::getFreeNode(), NL3D::CLandscapeUser::getHeightFieldDeltaZ(), NL3D::CLandscape::getHeightFieldDeltaZ(), NL3D::CPSUtil::getInterpolatedNoise(), NL3D::CTextureFont::getLetterInfo(), NL3D::CZoneSearch::getListZoneId(), NL3D::CZoneSearch::getListZoneName(), NLLIGO::CZoneTemplate::getMask(), NLLIGO::CZoneRegion::getName(), NLMEMORY::CHeapAllocator::getNextNode(), NLMISC::CTime::getPerformanceTime(), NL3D::CPSUtil::getPerlinNoise(), NL3D::CTextureUser::getPixelColor(), NLMISC::CBitmap::getPixelColor(), NLLIGO::CZoneRegion::getPosX(), NLLIGO::CZoneRegion::getPosY(), NL3D::CViewport::getRayWithPoint(), NLMISC::CBitmap::getRGBAPixel(), NLLIGO::CZoneRegion::getRot(), NLLIGO::CZoneRegion::getSharingCutEdges(), NLLIGO::CZoneRegion::getSharingMatNames(), NL3D::CSurfaceLightGrid::getStaticLightSetup(), NL3D::CPatch::getTileLumelmapPrecomputed(), NLAIAGENT::CHashTimerManager::getTimer(), NL3D::CWaterHeightMap::getUserPos(), NL3D::CViewport::getValues(), NL3D::CAnimationPlaylist::getWeightValue(), NLMISC::CWindowDisplayer::getWindowPos(), NL3D::CDriverUser::getWindowPos(), NL3D::CDriverGL::getWindowPos(), NL3D::CHeightMap::getZ(), NL3D::CZoneSearch::getZoneId(), NL3D::CZoneSearch::getZoneName(), NL3D::CZoneSearch::getZoneNameFromId(), NL3D::CZoneSearch::getZonePos(), H_AUTO_DECL(), NLMISC::CQuatT< float >::identity(), NLSOUND::CSound::importForm(), NL3D::CViewport::init(), NL3D::CScissor::init(), NL3D::SCloudTextureClamp::init(), NLPACS::CQuadGrid< T >::insert(), NL3D::CQuadGrid< T >::insert(), NLMISC::CHeapAllocator::insert(), NLPACS::CFaceGrid::CFaceGridBuild::insert(), NLMISC::CPolygon2D::isConvex(), NLMISC::CQuatT< float >::isIdentity(), NLMEMORY::CHeapAllocator::isNodeBlack(), NLMEMORY::CHeapAllocator::isNodeSmall(), NLPACS::CVector2s::isNull(), NLMISC::CVector2f::isNull(), NLMISC::CVector2d::isNull(), NLMISC::itoaInt64(), NLAIAGENT::IVector::IVector(), NL3D::CZoneLighter::light(), NL3D::CZoneLighter::lightWater(), NLPACS::linkExteriorToInterior(), NL3D::CQuadGridClipManager::linkModel(), NLAISCRIPT::IOpType::loadIOpType(), NLMISC::CQuatT< T >::log(), NLNET::IService::main(), NL3D::CCloudScape::makeHalfCloud(), NLMISC::CVector::maxof(), NLPACS::CVector2s::maxof(), NLMISC::CVector2f::maxof(), NLMISC::CVector2d::maxof(), NLMISC::CVector::minof(), NLPACS::CVector2s::minof(), NLMISC::CVector2f::minof(), NLMISC::CVector2d::minof(), NL3D::CTextureDLM::modulateAndfillRect565(), NL3D::CTextureDLM::modulateAndfillRect8888(), NL3D::CTextureDLM::modulateConstantAndfillRect(), NL3D::CPatch::modulateTileLightmapEdgeWithTileColors(), NL3D::CPatch::modulateTileLightmapWithTileColors(), NLAIAGENT::CVolatilMemmory::newInstance(), NLAIAGENT::CHashTimerManager::newInstance(), NLAISCRIPT::CVarPStackParam::newInstance(), NLAILOGIC::CVarMem::newInstance(), NLAISCRIPT::CScriptDebugSourceMemory::newInstance(), NLAISCRIPT::CScriptDebugSourceFile::newInstance(), NLAIC::CTypeOfOperator::newInstance(), NLAIC::CTypeOfObject::newInstance(), NLAISCRIPT::CLoadHeapObject::newInstance(), NLAISCRIPT::CLoadStackObject::newInstance(), NLAISCRIPT::CLoadSelfObject::newInstance(), NLAIAGENT::CMessageGroup::newInstance(), NLAIAGENT::CMainAgentScript::newInstance(), NLAISCRIPT::CAgentClass::newInstance(), NLAIFUZZY::CFuzzyVar::newInstance(), NLAISCRIPT::CCodeBrancheRunDebug::newInstance(), NLAISCRIPT::CCodeBrancheRun::newInstance(), NLAILOGIC::CBoolAssert::newInstance(), NLAIAGENT::CIndexedVarName::newInstance(), NLAIAGENT::CProxyAgentMail::newInstance(), NLAIAGENT::CLocalAgentMail::newInstance(), NL3D_drawFarTileInFarTexture(), NL3D_drawFarTileInFarTextureAdditive(), NL3D_drawFarTileInFarTextureAdditiveAlpha(), NL3D_drawFarTileInFarTextureAlpha(), NLNET::NLMISC_COMMAND(), NLMISC::CVectorD::norm(), NLMISC::CVector::norm(), NLMISC::CVectorD::operator *(), NLMISC::CVector::operator *(), NLPACS::CVector2s::operator *(), NLMISC::CVector2f::operator *(), NLMISC::CVector2d::operator *(), NLMISC::CQuatT< T >::operator *(), NLMISC::CQuatT< float >::operator *(), NLMISC::CVectorD::operator *=(), NLMISC::CVector::operator *=(), NLPACS::CVector2s::operator *=(), NLMISC::CVector2f::operator *=(), NLMISC::CVector2d::operator *=(), NLMISC::CQuatT< float >::operator *=(), NLMISC::CQuatD::operator CQuat(), NLMISC::CVectorD::operator CVector(), NLMISC::CVectorH::operator CVector(), NLAIAGENT::INombre< sint32 >::operator!(), NL3D::CQuadTree< T >::CIterator::operator!=(), NL3D::CQuadTree< T >::const_iterator::operator!=(), NLPACS::CQuadGrid< T >::CIterator::operator!=(), NLPACS::CQuadGrid< T >::const_iterator::operator!=(), NL3D::CQuadGrid< T >::CIterator::operator!=(), NL3D::CQuadGrid< T >::const_iterator::operator!=(), NLAIAGENT::CStringType::operator!=(), NLAIAGENT::INombre< sint32 >::operator!=(), NLAIAGENT::IVector::operator!=(), NLMISC::CStringMapper::CCharComp::operator()(), CUnsensitiveSStringLessPred::operator()(), NLMISC::CSheetId::CCharComp::operator()(), NL3D::CMeshGeom::CCornerPred::operator()(), NLAILOGIC::CGoalStack::greater::operator()(), NLMISC::CHashFunctionUInt64::operator()(), NLMISC::CVectorD::operator+(), NLMISC::CVector::operator+(), NLPACS::CVector2s::operator+(), NLMISC::CVector2f::operator+(), NLMISC::CVector2d::operator+(), NLMISC::CQuatT< float >::operator+(), NLMISC::CVectorD::operator+=(), NLMISC::CVector::operator+=(), NLPACS::CVector2s::operator+=(), NLMISC::CVector2f::operator+=(), NLMISC::CVector2d::operator+=(), NLMISC::CQuatT< float >::operator+=(), NLMISC::CVectorD::operator-(), NLMISC::CVector::operator-(), NLPACS::CVector2s::operator-(), NLMISC::CVector2f::operator-(), NLMISC::CVector2d::operator-(), NLMISC::CQuatT< float >::operator-(), NLMISC::CVectorD::operator-=(), NLMISC::CVector::operator-=(), NLPACS::CVector2s::operator-=(), NLMISC::CVector2f::operator-=(), NLMISC::CVector2d::operator-=(), NLMISC::CQuatT< float >::operator-=(), NLPACS::CVector2s::operator/(), NLMISC::CVector2f::operator/(), NLMISC::CVector2d::operator/(), NLMISC::CQuatT< float >::operator/(), NLPACS::CVector2s::operator/=(), NLMISC::CVector2f::operator/=(), NLMISC::CVector2d::operator/=(), NLMISC::CQuatT< float >::operator/=(), NLMISC::CVector::operator<(), NLMISC::CVectorH::operator<(), NL3D::CTextureFar::CVector2s::operator<(), NLAINIMAT::CClassifierPriority::operator<(), NLAIAGENT::CStringType::operator<(), NLAIAGENT::INombre< sint32 >::operator<(), NLAIAGENT::CStringType::operator<=(), NLAIAGENT::INombre< sint32 >::operator<=(), NLMISC::CVectorD::operator=(), NLMISC::CQuatD::operator=(), NLMISC::CQuat::operator=(), NLMISC::CVectorD::operator==(), NLMISC::CVector::operator==(), NLMISC::CVectorH::operator==(), NLPACS::CVector2s::operator==(), NLMISC::CVector2f::operator==(), NLMISC::CVector2d::operator==(), NL3D::CTrackSampledQuat::CQuatPack::operator==(), NLMISC::CQuatT< float >::operator==(), NL3D::CQuadTree< T >::CIterator::operator==(), NL3D::CQuadTree< T >::const_iterator::operator==(), NLPACS::CQuadGrid< T >::CIterator::operator==(), NLPACS::CQuadGrid< T >::const_iterator::operator==(), NL3D::CQuadGrid< T >::CIterator::operator==(), NL3D::CQuadGrid< T >::const_iterator::operator==(), NLAIFUZZY::CFuzzyRule::operator==(), NLAIAGENT::CStringType::operator==(), NLAIAGENT::INombre< sint32 >::operator==(), NLAIAGENT::IVector::operator==(), NLAIAGENT::CStringType::operator>(), NLAIAGENT::INombre< sint32 >::operator>(), NLAIAGENT::CStringType::operator>=(), NLAIAGENT::INombre< sint32 >::operator>=(), NLMISC::CVectorD::operator^(), NLMISC::CVector::operator^(), NLMISC::OptFastFloor(), NLMISC::OptFastFloor24(), NLMISC::OptFastFractionnalPart(), NLPACS::CVector2s::pack(), NL3D::CVector3s::pack(), NL3D::CWaterHeightMap::perturbate(), NL3D::CWaterHeightMap::perturbatePoint(), NL3D::CSinWave::perturbUV(), NL3D::CTextContextUser::printAt(), NL3D::CTextContext::printAt(), NL3D::CTextContextUser::printClipAt(), NL3D::CTextContext::printClipAt(), NL3D::CTextContextUser::printClipAtOld(), NL3D::CTextContextUser::printClipAtUnProjected(), NL3D::CTextContext::printClipAtUnProjected(), NL3D::CTextContextUser::printfAt(), NL3D::CTextContext::printfAt(), NL3D::CZoneLighter::processZonePointLightRT(), NL3D::CQuadGridClipManager::profile(), NL3D::CWaterHeightMap::propagate(), NLMISC::CBitmap::readTGA(), NL3D::CTextureFont::rebuildLetter(), NL3D::CTextureFar::rebuildPatch(), NLAISCRIPT::CCompilateur::RegisterClass(), NLAISCRIPT::CCompilateur::registerMethod(), NL3D::CTextureDLM::releaseLightMap(), NL3D::CComputedString::render2D(), NL3D::CComputedString::render2DClip(), NL3D::CComputedString::render2DUnProjected(), RenderTriangle(), NL3D::CQuadGridClipManager::reset(), NLMISC::rotateCCW(), NLMEMORY::CHeapAllocator::rotateLeft(), NLAISCRIPT::CConstraintStackComp::run(), NLAISCRIPT::CConstraintFindRun::run(), NLAISCRIPT::CConstraintMethode::run(), NLAIAGENT::CVolatilMemmory::runMessage(), NLAILOGIC::IBaseVar::runMethodeMember(), NLAIFUZZY::CFuzzyVar::runMethodeMember(), NLAISCRIPT::CCodeBrancheRun::save(), NLAIAGENT::CStringVarName::save(), NLAIAGENT::CVolatilMemmory::searchBest(), NL3D::CVisualCollisionManager::CStaticGrid::select(), NL3D::CStaticQuadGrid< T >::select(), NLPACS::CQuadGrid< T >::select(), NL3D::CQuadGrid< T >::select(), NL3D::CLandscapeCollisionGrid::select(), NLPACS::CFaceGrid::select(), NLPACS::CEdgeQuad::selectEdges(), NLPACS::CChainQuad::selectEdges(), NLMISC::CVectorD::serial(), NLMISC::CVector::serial(), NLPACS::CVector2s::serial(), NLMISC::CVector2f::serial(), NLMISC::CVector2d::serial(), NL3D::CTrackSampledQuat::CQuatPack::serial(), NLMISC::CQuatT< float >::serial(), NL3D::CVector3s::serial(), NL3D::CLodCharacterShape::CVector3s::serial(), NLAIC::CIdentType::serial(), NLMISC::CVectorD::set(), NLMISC::CVector::set(), NLMISC::CVectorH::set(), NLPACS::CVector2s::set(), NLMISC::CVector2f::set(), NLMISC::CVector2d::set(), NLMISC::CQuatT< float >::set(), NLMISC::CQuatT< T >::setAngleAxis(), NL3D::CShadowMapManager::setBlackQuad(), NL3D::CShadowMapManager::setBlurQuadFakeGaussian(), NLLIGO::CZoneRegion::setFlip(), NL3D::CWaterShape::setGridBorderSize(), NL3D::CLandscape::setHeightField(), NL3D::CDriverUser::setMousePos(), NL3D::CDriverGL::setMousePos(), NLLIGO::CZoneRegion::setName(), NLMEMORY::CHeapAllocator::setNodeColor(), NLMEMORY::CHeapAllocator::setNodeFree(), NLMEMORY::CHeapAllocator::setNodeLast(), NLMEMORY::CHeapAllocator::setNodeRed(), NLMEMORY::CHeapAllocator::setNodeSize(), NLAISCRIPT::CConstraintFindRun::setOpCode(), NLAISCRIPT::CConstraintMethode::setOpCode(), NL3D::ITransformable::setPivot(), NL3D::ITransformable::setPos(), NLLIGO::CZoneRegion::setPosX(), NLLIGO::CZoneRegion::setPosY(), NLLIGO::CZoneRegion::setRot(), NL3D::CWaterShape::setScreenGridSize(), NLLIGO::CZoneRegion::setSharingCutEdges(), NLLIGO::CZoneRegion::setSharingMatNames(), NL3D::CCloud::setSizeX(), NL3D::CCamera::setTargetPos(), NL3D::CDriverGL::setupScissor(), NL3D::CWaterShape::setupVertexBuffer(), NL3D::CDriverGL::setupViewport(), NL3D::CWaterHeightMap::setUserPos(), NL3D::CVertexBuffer::setValueDouble2Ex(), NL3D::CVertexBuffer::setValueDouble3Ex(), NL3D::CVertexBuffer::setValueDouble4Ex(), NL3D::CVertexBuffer::setValueFloat2Ex(), NL3D::CVertexBuffer::setValueFloat3Ex(), NL3D::CVertexBuffer::setValueFloat4Ex(), NL3D::CVertexBuffer::setValueShort2Ex(), NL3D::CVertexBuffer::setValueShort3Ex(), NL3D::CVertexBuffer::setValueShort4Ex(), NL3D::CVertexBuffer::setVertexCoord(), NLMISC::CRect::setWH(), NL3D::CCloud::setX(), NLPACS::CLocalRetriever::snapToInteriorGround(), NLMISC::CVectorD::sphericToCartesian(), NLMISC::CVector::sphericToCartesian(), NLMISC::CVectorD::sqrnorm(), NLMISC::CVector::sqrnorm(), NLPACS::CVector2s::sqrnorm(), NLMISC::CVector2f::sqrnorm(), NLMISC::CVector2d::sqrnorm(), NLMISC::CQuatT< float >::sqrnorm(), NL3D::CMotionBlur::startMotionBlur(), NL3D::CLodCharacterManager::startTextureCompute(), NL3D::CPSLocated::step(), NLPACS::CGlobalRetriever::testBBoxMove(), NLPACS::CGlobalRetriever::testBBoxRot(), NLAIAGENT::CVolatilMemmory::testIfBest(), testZPercentageCloserFilter(), NLMISC::CVector::toString(), NL3D::CTextureFar::touchPatchULAndNext(), NLPACS::CVector2s::unpack(), NL3D::CVector3s::unpack(), NLPACS::CVector2s::unpack3f(), NL3D::CQuadGridClipManager::updateClustersFromCamera(), NL3D::CWaterHeightMap::updateUserPos(), NLAIAGENT::VectorType::VectorType(), NL3D::EBadBind::what(), and NLMISC::CBitmap::writeTGA().

+

+ + + + +
+ + +
typedef GLint GLint xoffset +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1016 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLshort GLshort y +
+
+ + + + + +
+   + + +

+ +

+Definition at line 236 of file driver_opengl_extension_def.h. +

+Referenced by NL3D::CVisualCollisionManager::CStaticGrid::add(), NL3D::CIGSurfaceLightBuild::addDebugMeshFaces(), NL3D::CHLSColorTexture::addMask(), NLPACS::CPrimitiveWorldImage::addMoveElement(), NL3D::CPatchDLMContext::addPointLightInfluence(), NL3D::CLandscapeCollisionGrid::addQuadToGrid(), NL3D::CLodCharacterManager::addTextureCompute(), NL3D::CPatch::addTileLightmapEdgeWithTLI(), NL3D::CPatch::addTileLightmapWithTLI(), NL3D::CPatch::appendTileLightInfluences(), NLMISC::CVectorD::asVector(), NLMISC::CVector2f::asVector(), NL3D::CZoneLighter::attenuation(), NLLIGO::CZoneRegion::basicSet(), NL3D::bilinearColor(), NL3D::bilinearColorAndAdd(), NL3D::bilinearColorAndModulate(), NL3D::bilinearColorAndModulatex2(), NL3D::bilinearColorDiv2AndAdd(), NLMISC::CBitmap::blit(), NLLIGO::CZoneTemplate::build(), NLLIGO::CZoneEdge::build(), NL3D::CStaticQuadGrid< T >::build(), NL3D::CLandscapeCollisionGrid::build(), NLPACS::CEdgeQuad::build(), NLPACS::CChainQuad::build(), NL3D::CLandscape::buildCollideFaces(), NL3D::BuildCubeMapTex(), NL3D::BuildCubeMapTexLuminance(), NL3D::BuildDsDt(), NL3D::BuildDsDtAsRGBA(), NL3D::CHeightMap::buildFromBitmap(), NL3D::CIGSurfaceLightBuild::buildPLDebugMesh(), NL3D::CIGSurfaceLightBuild::buildSunDebugMesh(), NL3D::CLandscape::buildZoneName(), NLMISC::CEventMouse::CEventMouse(), NLMISC::CEventMouseDblClk::CEventMouseDblClk(), NLMISC::CEventMouseDown::CEventMouseDown(), NLMISC::CEventMouseMove::CEventMouseMove(), NLMISC::CEventMouseUp::CEventMouseUp(), NLMISC::CEventMouseWheel::CEventMouseWheel(), NLMISC::CGDMouseMove::CGDMouseMove(), NL3D::CZoneManager::checkZonesAround(), NL3D::CWaterHeightMap::clearArea(), NL3D::CWaterHeightMap::clearZone(), NL3D::CVisualCollisionManager::CStaticGrid::compile(), NL3D::CLodCharacterShapeBuild::compile(), NL3D::CPatch::computeCurrentTLILightmapDiv2(), NL3D::computePerturbation(), NL3D::CPatchDLMContext::computeTextureFar(), NL3D::CPatch::computeTileLightmapAutomatic(), NL3D::CPatch::computeTileLightmapEdgeAutomatic(), NL3D::CPatch::computeTileLightmapPrecomputed(), NLMISC::CQuatT< float >::conjugate(), NL3D::CDriverGL::copyFrameBufferToTexture(), NL3D::CTextureDLM::copyRect(), NLMISC::CVectorD::copyTo(), NL3D::CPlaneBasis::CPlaneBasis(), NLMISC::CPolygon2D::CPolygon2D(), NLMISC::CQuatD::CQuatD(), NLMISC::CQuatT< float >::CQuatT(), NLMISC::CRandomGrid3D::CRandomGrid3D(), NLMISC::CWindowDisplayer::create(), NL3D::CTextureDLM::createLightMap(), NLMISC::CRect::CRect(), NL3D::CScissor::CScissor(), NLMISC::CUpdateThread::CUpdateThread(), NLMISC::CVector::CVector(), NLMISC::CVector2d::CVector2d(), NLMISC::CVector2f::CVector2f(), NLPACS::CVector2s::CVector2s(), NL3D::CTextureFar::CVector2s::CVector2s(), NLMISC::CVectorD::CVectorD(), NLMISC::CVectorH::CVectorH(), NLMISC::CBitmap::decompressDXT1(), NLMISC::CBitmap::decompressDXT3(), NLMISC::CBitmap::decompressDXT5(), NL3D::CQuadGridClipManager::deleteCaseModels(), NL3D::CPSUtil::displaySphere(), NL3D::CTextureFont::doGenerate(), NL3D::CTextureEmboss::doGenerate(), NLPACS::CGlobalRetriever::doMove(), draw2dLine(), NL3D::CDRU::drawBitmap(), NL3D::CDriverUser::drawBitmap(), NL3D::CVegetable::easeInEaseOut(), NL3D::easeInEaseOut(), NLMISC::CRandomGrid3D::easeInEaseOut(), easineasout(), easineasoutC2(), NL3D::CLodCharacterManager::endTextureCompute(), NLMISC::CQuatT< T >::equal(), NLPACS::CQuadGrid< T >::erase(), NL3D::CQuadGrid< T >::erase(), NLMISC::CHeapAllocator::erase(), NL3D::CLandscapeVegetableBlockCreateContext::eval(), NLMISC::CRandomGrid3D::evalBiLinear(), NLMISC::CRandomGrid3D::evalNearest(), NLMISC::CQuatT< T >::exp(), NLMISC::CRect::extend(), NL3D::CTextureDLM::fillRect(), NL3D::FillWaterVB(), NL3D::CWaterHeightMap::filter(), FilterZBuffer(), NLMEMORY::CHeapAllocator::find(), NL3D::CPatchDLMContext::generate(), NL3D::CVegetable::generateGroupBiLinear(), NL3D::CPatch::generateTileVegetable(), NLMISC::CQuatT< float >::getAxis(), NLMISC::CBitmap::getColor(), NLMISC::CBitmap::getColorInterp(), NL3D::CPatch::getCurrentTileTLIColors(), NLLIGO::CZoneRegion::getCutEdge(), NLLIGO::CZoneRegion::getDate(), NLAIAGENT::VectorType::getDebugString(), NLMISC::CBitmap::getDXTC1Texel(), NLMISC::CBitmap::getDXTC3Texel(), NLMISC::CBitmap::getDXTC5Texel(), NLMISC::CBitmap::getDXTCColorFromBlock(), NLLIGO::CZoneRegion::getFlip(), NL3D::CLandscapeUser::getHeightFieldDeltaZ(), NL3D::CLandscape::getHeightFieldDeltaZ(), NL3D::CPSUtil::getInterpolatedNoise(), NL3D::CTextureFont::getLetterInfo(), NL3D::CZoneSearch::getListZoneId(), NL3D::CZoneSearch::getListZoneName(), NLLIGO::CZoneTemplate::getMask(), NLLIGO::CZoneRegion::getName(), NL3D::CPSUtil::getPerlinNoise(), NL3D::CTextureUser::getPixelColor(), NLMISC::CBitmap::getPixelColor(), NLLIGO::CZoneRegion::getPosX(), NLLIGO::CZoneRegion::getPosY(), NL3D::CViewport::getRayWithPoint(), NLMISC::CBitmap::getRGBAPixel(), NLLIGO::CZoneRegion::getRot(), NLLIGO::CZoneRegion::getSharingCutEdges(), NLLIGO::CZoneRegion::getSharingMatNames(), NL3D::CSurfaceLightGrid::getStaticLightSetup(), NL3D::CPatch::getTileLumelmapPrecomputed(), NL3D::CWaterHeightMap::getUserPos(), NL3D::CViewport::getValues(), NLMISC::CWindowDisplayer::getWindowPos(), NL3D::CDriverUser::getWindowPos(), NL3D::CDriverGL::getWindowPos(), NL3D::CHeightMap::getZ(), NL3D::CZoneSearch::getZoneId(), NL3D::CZoneSearch::getZoneName(), NL3D::CZoneSearch::getZoneNameFromId(), NL3D::CZoneSearch::getZonePos(), H_AUTO_DECL(), NLMISC::CQuatT< float >::identity(), NLSOUND::CSound::importForm(), NL3D::CViewport::init(), NL3D::CScissor::init(), NL3D::SCloudTextureClamp::init(), NLPACS::CQuadGrid< T >::insert(), NL3D::CQuadGrid< T >::insert(), NLMISC::CHeapAllocator::insert(), NLPACS::CFaceGrid::CFaceGridBuild::insert(), NLMISC::CPolygon2D::isConvex(), NLMISC::CQuatT< float >::isIdentity(), NLPACS::CVector2s::isNull(), NLMISC::CVector2f::isNull(), NLMISC::CVector2d::isNull(), NLAIAGENT::IVector::IVector(), NL3D::CZoneLighter::light(), NL3D::CZoneLighter::lightWater(), NLPACS::linkExteriorToInterior(), NL3D::CQuadGridClipManager::linkModel(), NLMISC::CQuatT< T >::log(), NLNET::IService::main(), NLMISC::CVector::maxof(), NLPACS::CVector2s::maxof(), NLMISC::CVector2f::maxof(), NLMISC::CVector2d::maxof(), NLMISC::CVector::minof(), NLPACS::CVector2s::minof(), NLMISC::CVector2f::minof(), NLMISC::CVector2d::minof(), NL3D::CTextureDLM::modulateAndfillRect565(), NL3D::CTextureDLM::modulateAndfillRect8888(), NL3D::CTextureDLM::modulateConstantAndfillRect(), NL3D::CPatch::modulateTileLightmapEdgeWithTileColors(), NL3D::CPatch::modulateTileLightmapWithTileColors(), NL3D_drawFarTileInFarTexture(), NL3D_drawFarTileInFarTextureAdditive(), NL3D_drawFarTileInFarTextureAdditiveAlpha(), NL3D_drawFarTileInFarTextureAlpha(), NLNET::NLMISC_COMMAND(), NLMISC::CVectorD::norm(), NLMISC::CVector::norm(), NLMISC::CVectorD::operator *(), NLMISC::CVector::operator *(), NLPACS::CVector2s::operator *(), NLMISC::CVector2f::operator *(), NLMISC::CVector2d::operator *(), NLMISC::CQuatT< T >::operator *(), NLMISC::CQuatT< float >::operator *(), NLMISC::CVectorD::operator *=(), NLMISC::CVector::operator *=(), NLPACS::CVector2s::operator *=(), NLMISC::CVector2f::operator *=(), NLMISC::CVector2d::operator *=(), NLMISC::CQuatT< float >::operator *=(), NLMISC::CQuatD::operator CQuat(), NLMISC::CVectorD::operator CVector(), NLMISC::CVectorH::operator CVector(), NLMISC::CStringMapper::CCharComp::operator()(), CUnsensitiveSStringLessPred::operator()(), NLMISC::CSheetId::CCharComp::operator()(), NL3D::CMeshGeom::CCornerPred::operator()(), NLAILOGIC::CGoalStack::greater::operator()(), NLMISC::CVectorD::operator+(), NLMISC::CVector::operator+(), NLPACS::CVector2s::operator+(), NLMISC::CVector2f::operator+(), NLMISC::CVector2d::operator+(), NLMISC::CQuatT< float >::operator+(), NLMISC::CVectorD::operator+=(), NLMISC::CVector::operator+=(), NLPACS::CVector2s::operator+=(), NLMISC::CVector2f::operator+=(), NLMISC::CVector2d::operator+=(), NLMISC::CQuatT< float >::operator+=(), NLMISC::CVectorD::operator-(), NLMISC::CVector::operator-(), NLPACS::CVector2s::operator-(), NLMISC::CVector2f::operator-(), NLMISC::CVector2d::operator-(), NLMISC::CQuatT< float >::operator-(), NLMISC::CVectorD::operator-=(), NLMISC::CVector::operator-=(), NLPACS::CVector2s::operator-=(), NLMISC::CVector2f::operator-=(), NLMISC::CVector2d::operator-=(), NLMISC::CQuatT< float >::operator-=(), NLPACS::CVector2s::operator/(), NLMISC::CVector2f::operator/(), NLMISC::CVector2d::operator/(), NLMISC::CQuatT< float >::operator/(), NLPACS::CVector2s::operator/=(), NLMISC::CVector2f::operator/=(), NLMISC::CVector2d::operator/=(), NLMISC::CQuatT< float >::operator/=(), NLMISC::CVector::operator<(), NLMISC::CVectorH::operator<(), NL3D::CTextureFar::CVector2s::operator<(), NLMISC::CVectorD::operator=(), NLMISC::CQuatD::operator=(), NLMISC::CQuat::operator=(), NLMISC::CVectorD::operator==(), NLMISC::CVector::operator==(), NLMISC::CVectorH::operator==(), NLPACS::CVector2s::operator==(), NLMISC::CVector2f::operator==(), NLMISC::CVector2d::operator==(), NL3D::CTrackSampledQuat::CQuatPack::operator==(), NLMISC::CQuatT< float >::operator==(), NLMISC::CVectorD::operator^(), NLMISC::CVector::operator^(), NLPACS::CVector2s::pack(), NL3D::CVector3s::pack(), NL3D::CWaterHeightMap::perturbate(), NL3D::CWaterHeightMap::perturbatePoint(), NL3D::CSinWave::perturbUV(), NL3D::CTextContextUser::printAt(), NL3D::CTextContextUser::printClipAt(), NL3D::CTextContextUser::printClipAtOld(), NL3D::CTextContextUser::printClipAtUnProjected(), NL3D::CTextContext::printClipAtUnProjected(), NL3D::CTextContextUser::printfAt(), NL3D::CZoneLighter::processZonePointLightRT(), NL3D::CQuadGridClipManager::profile(), NL3D::CWaterHeightMap::propagate(), NLMISC::CBitmap::readTGA(), NL3D::CTextureFont::rebuildLetter(), NL3D::CTextureFar::rebuildPatch(), NL3D::CTextureDLM::releaseLightMap(), RenderTriangle(), NL3D::CQuadGridClipManager::reset(), NLMISC::rotateCCW(), NLMEMORY::CHeapAllocator::rotateRight(), NL3D::CVisualCollisionManager::CStaticGrid::select(), NL3D::CStaticQuadGrid< T >::select(), NLPACS::CQuadGrid< T >::select(), NL3D::CQuadGrid< T >::select(), NL3D::CLandscapeCollisionGrid::select(), NLPACS::CFaceGrid::select(), NLPACS::CEdgeQuad::selectEdges(), NLPACS::CChainQuad::selectEdges(), NLMISC::CVectorD::serial(), NLMISC::CVector::serial(), NLPACS::CVector2s::serial(), NLMISC::CVector2f::serial(), NLMISC::CVector2d::serial(), NL3D::CTrackSampledQuat::CQuatPack::serial(), NLMISC::CQuatT< float >::serial(), NL3D::CVector3s::serial(), NL3D::CLodCharacterShape::CVector3s::serial(), NLNET::serviceGetView(), NLMISC::CVectorD::set(), NLMISC::CVector::set(), NLMISC::CVectorH::set(), NLPACS::CVector2s::set(), NLMISC::CVector2f::set(), NLMISC::CVector2d::set(), NLMISC::CQuatT< float >::set(), NLMISC::CQuatT< T >::setAngleAxis(), NL3D::CShadowMapManager::setBlackQuad(), NL3D::CShadowMapManager::setBlurQuadFakeGaussian(), NLLIGO::CZoneRegion::setFlip(), NL3D::CWaterShape::setGridBorderSize(), NL3D::CLandscape::setHeightField(), NL3D::CDriverUser::setMousePos(), NL3D::CDriverGL::setMousePos(), NLLIGO::CZoneRegion::setName(), NLMEMORY::CHeapAllocator::setNodeLast(), NL3D::ITransformable::setPivot(), NL3D::ITransformable::setPos(), NLLIGO::CZoneRegion::setPosX(), NLLIGO::CZoneRegion::setPosY(), NLLIGO::CZoneRegion::setRot(), NL3D::CWaterShape::setScreenGridSize(), NLLIGO::CZoneRegion::setSharingCutEdges(), NLLIGO::CZoneRegion::setSharingMatNames(), NL3D::CCloud::setSizeY(), NL3D::CCamera::setTargetPos(), NL3D::CDriverGL::setupScissor(), NL3D::CDriverGL::setupViewport(), NL3D::CWaterHeightMap::setUserPos(), NL3D::CVertexBuffer::setValueDouble2Ex(), NL3D::CVertexBuffer::setValueDouble3Ex(), NL3D::CVertexBuffer::setValueDouble4Ex(), NL3D::CVertexBuffer::setValueFloat2Ex(), NL3D::CVertexBuffer::setValueFloat3Ex(), NL3D::CVertexBuffer::setValueFloat4Ex(), NL3D::CVertexBuffer::setValueShort2Ex(), NL3D::CVertexBuffer::setValueShort3Ex(), NL3D::CVertexBuffer::setValueShort4Ex(), NL3D::CVertexBuffer::setVertexCoord(), NLMISC::CRect::setWH(), NL3D::CCloud::setY(), NLPACS::CLocalRetriever::snapToInteriorGround(), NLMISC::CVectorD::sphericToCartesian(), NLMISC::CVector::sphericToCartesian(), NLMISC::CVectorD::sqrnorm(), NLMISC::CVector::sqrnorm(), NLPACS::CVector2s::sqrnorm(), NLMISC::CVector2f::sqrnorm(), NLMISC::CVector2d::sqrnorm(), NLMISC::CQuatT< float >::sqrnorm(), NL3D::CMotionBlur::startMotionBlur(), NL3D::CLodCharacterManager::startTextureCompute(), NLPACS::CGlobalRetriever::testBBoxMove(), NLPACS::CGlobalRetriever::testBBoxRot(), testZPercentageCloserFilter(), NLMISC::CVector::toString(), NL3D::CTextureFar::touchPatchULAndNext(), NLAILOGIC::CVar::unify(), NLPACS::CVector2s::unpack(), NL3D::CVector3s::unpack(), NLPACS::CVector2s::unpack3f(), NL3D::CQuadGridClipManager::updateClustersFromCamera(), NL3D::CWaterHeightMap::updateUserPos(), NLAIAGENT::VectorType::VectorType(), NL3D::EBadBind::what(), and NLMISC::CBitmap::writeTGA().

+

+ + + + +
+ + +
typedef GLint GLint GLint yoffset +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1016 of file driver_opengl_extension_def.h.

+

+ + + + +
+ + +
typedef GLshort GLshort GLshort z +
+
+ + + + + +
+   + + +

+ +

+Definition at line 236 of file driver_opengl_extension_def.h. +

+Referenced by NLMISC::CVectorD::asVector(), NL3D::CVegetableShape::build(), NL3D::EBadBind::CBindError::CBindError(), NL3D::CPatch::compile(), NL3D::CZoneLighter::computeTileFlagsForPositionTowardWater(), NLMISC::CQuatT< float >::conjugate(), NLMISC::CVectorD::copyTo(), NLMISC::CQuatD::CQuatD(), NLMISC::CQuatT< float >::CQuatT(), NLMISC::CRandomGrid3D::CRandomGrid3D(), NLMISC::CVector::CVector(), NLMISC::CVectorD::CVectorD(), NLMISC::CVectorH::CVectorH(), NLMISC::CQuatT< T >::equal(), NLMISC::CHeapAllocator::erase(), NLMISC::CRandomGrid3D::evalBiLinear(), NLMISC::CRandomGrid3D::evalNearest(), NLMISC::CQuatT< T >::exp(), NL3D::FillWaterVB(), NLMEMORY::CHeapAllocator::find(), NLMISC::CQuatT< float >::getAxis(), NLAIAGENT::VectorType::getDebugString(), NL3D::CPSUtil::getInterpolatedNoise(), NL3D::CPSUtil::getPerlinNoise(), NLMISC::CQuatT< float >::identity(), NLSOUND::CSound::importForm(), NL3D::SCloudTextureClamp::init(), NLMISC::CQuatT< float >::isIdentity(), NLAIAGENT::IVector::IVector(), NLMISC::CQuatT< T >::log(), NLMISC::CVector::maxof(), NL3D::CCameraCol::minimizeDistanceAgainstTri(), NLMISC::CVector::minof(), NLMISC::CVectorD::norm(), NLMISC::CVector::norm(), NLMISC::CVectorD::operator *(), NLMISC::CVector::operator *(), NLMISC::CQuatT< T >::operator *(), NLMISC::CQuatT< float >::operator *(), NLMISC::CVectorD::operator *=(), NLMISC::CVector::operator *=(), NLMISC::CQuatT< float >::operator *=(), NLMISC::CQuatD::operator CQuat(), NLMISC::CVectorD::operator CVector(), NLMISC::CVectorH::operator CVector(), NLMISC::CVectorD::operator+(), NLMISC::CVector::operator+(), NLMISC::CQuatT< float >::operator+(), NLMISC::CVectorD::operator+=(), NLMISC::CVector::operator+=(), NLMISC::CQuatT< float >::operator+=(), NLMISC::CVectorD::operator-(), NLMISC::CVector::operator-(), NLMISC::CQuatT< float >::operator-(), NLMISC::CVectorD::operator-=(), NLMISC::CVector::operator-=(), NLMISC::CQuatT< float >::operator-=(), NLMISC::CQuatT< float >::operator/(), NLMISC::CQuatT< float >::operator/=(), NLMISC::CVector::operator<(), NLMISC::CVectorH::operator<(), NL3D::CMiniCol::CZoneIdent::operator<(), NLMISC::CVectorD::operator=(), NLMISC::CQuatD::operator=(), NLMISC::CQuat::operator=(), NLMISC::CVectorD::operator==(), NLMISC::CVector::operator==(), NLMISC::CVectorH::operator==(), NL3D::CTrackSampledQuat::CQuatPack::operator==(), NLMISC::CQuatT< float >::operator==(), NLMISC::CVectorD::operator^(), NLMISC::CVector::operator^(), NL3D::CVector3s::pack(), NL3D::CTextContext::printAt(), NL3D::CTextContext::printClipAt(), NL3D::CTextContext::printfAt(), NL3D::PSBinOpModulate(), NL3D::CVegetableManager::render(), NL3D::CComputedString::render2D(), NL3D::CComputedString::render2DClip(), NL3D::CComputedString::render2DUnProjected(), RenderTriangle(), NLMEMORY::CHeapAllocator::rotateRight(), NLAISCRIPT::CMethodContext::saveContext(), NLMISC::CVectorD::serial(), NLMISC::CVector::serial(), NL3D::CTrackSampledQuat::CQuatPack::serial(), NLMISC::CQuatT< float >::serial(), NL3D::CVector3s::serial(), NL3D::CLodCharacterShape::CVector3s::serial(), NLMISC::CVectorD::set(), NLMISC::CVector::set(), NLMISC::CVectorH::set(), NLMISC::CQuatT< float >::set(), NLMISC::CQuatT< T >::setAngleAxis(), NL3D::ITransformable::setPivot(), NL3D::ITransformable::setPos(), NL3D::CCloud::setSizeZ(), NL3D::CCamera::setTargetPos(), NL3D::CVertexBuffer::setValueDouble3Ex(), NL3D::CVertexBuffer::setValueDouble4Ex(), NL3D::CVertexBuffer::setValueFloat3Ex(), NL3D::CVertexBuffer::setValueFloat4Ex(), NL3D::CVertexBuffer::setValueShort3Ex(), NL3D::CVertexBuffer::setValueShort4Ex(), NL3D::CVertexBuffer::setVertexCoord(), NL3D::CCloud::setZ(), NLMISC::CVectorD::sphericToCartesian(), NLMISC::CVector::sphericToCartesian(), NLMISC::CVectorD::sqrnorm(), NLMISC::CVector::sqrnorm(), NLMISC::CQuatT< float >::sqrnorm(), testZPercentageCloserFilter(), NLMISC::CVector::toString(), NL3D::CFlareModel::traverseRender(), NL3D::CVector3s::unpack(), NLPACS::COrderedChain3f::unpack(), and NLAIAGENT::VectorType::VectorType().

+

+ + + + +
+ + +
typedef GLint GLint GLint GLint zoffset +
+
+ + + + + +
+   + + +

+ +

+Definition at line 1016 of file driver_opengl_extension_def.h.

+


Function Documentation

+

+ + + + +
+ + + + + + + + + + +
typedef GLboolean APIENTRY *  NEL_PFNGLISOBJECTBUFFERATIPROC  ) 
+
+ + + + + +
+   + + +

+ +

+Referenced by NL3D::CDriverGL::setupEXTVertexShader(), and NL3D::CVertexBufferHardGLNVidia::testFence().

+

+ + + + +
+ + + + + + + + + + +
typedef GLuint APIENTRY *  NEL_PFNGLNEWOBJECTBUFFERATIPROC  ) 
+
+ + + + + +
+   + + +

+ +

+Referenced by NL3D::CVertexArrayRangeMapObjectATI::allocate(), NL3D::convOutputRegisterToEXTVertexShader(), NL3D::CDriverGL::deleteARBFragmentPrograms(), NL3D::CDriverGL::deleteFragmentShaders(), NL3D::loadARBFragmentProgramStringNative(), and NL3D::CDriverGL::setupEXTVertexShader().

+

+ + + + +
+ + + + + + + + + + +
typedef void APIENTRY *  NEL_PFNGLGETVARIANTARRAYOBJECTIVATIPROC  ) 
+
+ + + + + +
+   + + +

+

+


Generated on Tue Mar 16 06:42:33 2004 for NeL by + +doxygen +1.3.6
+ + -- cgit v1.2.1